Multiview News

commit e8de544ece7292e636909f97a6386329c634b235 Author: Martin Donnelly Date: Tue May 26 21:59:25 2020 +0100 init diff --git a/.idea/.gitignore b/.idea/.gitignore new file mode 100644 index 0000000..b58b603 --- /dev/null +++ b/.idea/.gitignore @@ -0,0 +1,5 @@ +# Default ignored files +/shelf/ +/workspace.xml +# Editor-based HTTP Client requests +/httpRequests/ diff --git a/.idea/misc.xml b/.idea/misc.xml new file mode 100644 index 0000000..28a804d --- /dev/null +++ b/.idea/misc.xml @@ -0,0 +1,6 @@ + + + + + \ No newline at end of file diff --git a/.idea/modules.xml b/.idea/modules.xml new file mode 100644 index 0000000..1b70b4c --- /dev/null +++ b/.idea/modules.xml @@ -0,0 +1,8 @@ + + + + + + + + \ No newline at end of file diff --git a/.idea/multiview.iml b/.idea/multiview.iml new file mode 100644 index 0000000..24643cc --- /dev/null +++ b/.idea/multiview.iml @@ -0,0 +1,12 @@ + + + + + + + + + + + + \ No newline at end of file diff --git a/.idea/vcs.xml b/.idea/vcs.xml new file mode 100644 index 0000000..94a25f7 --- /dev/null +++ b/.idea/vcs.xml @@ -0,0 +1,6 @@ + + + + + + \ No newline at end of file diff --git a/live/css/design.css b/live/css/design.css new file mode 100644 index 0000000..90b13bf --- /dev/null +++ b/live/css/design.css @@ -0,0 +1,78 @@ +html, body { + background-color: #000000; + width: 100%; + height: 100%; + overflow: hidden; + margin: 0; + font-family: 'Muli', sans-serif; + color: #cccccc; +} + +#container { + width: 100%; + height: 100%; + padding: 1px 5px; +} + +.quarter { + width: calc(50% - 5px); + float: left; +} +.stream { + position: absolute; + top: 0; + left: 0; + bottom: 0; + right: 0; + border: 3px solid #000000; +} + +.wrapper { + padding-bottom: 56.55%; + width: 100%; + position: relative; + overflow: hidden; +} + +.active { + border: 3px solid #ff3333; +} + +.title { + background-color: #000000; + opacity: 0.3; + border-bottom-right-radius: 4px; + padding: 0px 8px 5px 5px; + color: #ffffff; + position: absolute; + top: 0; + left: 0; + z-index: 1000; +} + +.overlay { + width: 100%; + height: 100%; + position: absolute; + top: 0; + left: 0; + z-index: 1500; +} + +.live .overlay { + cursor: pointer; +} + +.offline { + background-color: #111111; +} + +.offline p { + position: absolute; + text-align: center; + top: 25%; + left: 25%; + width: 50%; + height: 50%; + +} diff --git a/live/index.html b/live/index.html new file mode 100644 index 0000000..d6061b1 --- /dev/null +++ b/live/index.html @@ -0,0 +1,80 @@ + + + + + + + Multiview News + + + + + + + +

Sky News

+ +

BBC News

+ +

Euronews

+ +

twitch.tv/rukpolitics

+ + + + + + + + diff --git a/live/js/multiview.js b/live/js/multiview.js new file mode 100644 index 0000000..080ed1e --- /dev/null +++ b/live/js/multiview.js @@ -0,0 +1,192 @@ +var Multiview = { + host: 'ws.silvrtree.co.cuk', + port: 80, + appId: 'multiview', + pusher: null, + youtube: {}, + twitch: {}, + + init: function () { + jQuery(document).ready(function () { + Multiview.ready(); + }) + }, + + ready: function () { + Multiview.bindEvents(); + //Multiview.connectToPusher(); + }, + + playYoutube: function(id) { + console.log(YT); + this.youtube[id]= new YT.Player(id, { + 'events': { + 'onReady': function(event) { + event.target.mute(); + } + } + }); + }, + + playTwitch: function(id, channel) { + this.twitch[id]= new Twitch.Player(id, { + 'channel': channel, + 'muted': true, + 'width': '100%', + 'height': '100%' + }); + }, + + connectToPusher: function() + { + this.pusher = new Pusher('092c4207-a7c6-4964-ac32-7a93feb511f6', { + wsHost: this.host, + wsPort: this.port, + wssPort: this.port, + disableStats: true, + authEndpoint: '/laravel-websockets/auth', + auth: { + headers: { + 'X-App-ID': this.appId + } + }, + enabledTransports: ['ws', 'flash'] + }); + this.pusher.subscribe('multiview').bind('App\\Events\\ChannelStatusEvent', function (data) { + Multiview.processStatus(data.streams); + }); + }, + + bindEvents: function () { + jQuery('.stream .overlay').unbind('click'); + jQuery('.stream .overlay').click(function() { + Multiview.toggleStream(jQuery(this).parent()); + }); + }, + + toggleStream: function(streamContainer) { + if (streamContainer.hasClass('active')) { + Multiview.muteStream(streamContainer); + } else { + if (!streamContainer.hasClass('live')) { + return; + } + Multiview.unmuteStream(streamContainer); + } + }, + + muteStream: function(streamContainer) { + console.log('Muting ', streamContainer); + console.log('streamContainer class', streamContainer.class); + if (streamContainer.hasClass('youtube')) { + let id = streamContainer.attr('data-youtube-id'); + if (this.youtube.hasOwnProperty(id)) { + this.youtube[id].mute(); + streamContainer.removeClass('active'); + } + } else if (streamContainer.hasClass('twitch')) { + let id = streamContainer.attr('data-twitch-id'); + if (this.twitch.hasOwnProperty(id)) { + this.twitch[id].setMuted(true); + streamContainer.removeClass('active'); + } + } else { + streamContainer.removeClass('active'); + try { + videojs('video_stream' + streamContainer.attr('data-video-id')).muted(true); + } catch (ex) { + // Do nothing + } + } + }, + + unmuteStream: function(streamContainer) { + console.log('Unmuting ', streamContainer); + console.log('streamContainer id', streamContainer.attr('data-youtube-id')); + if (streamContainer.hasClass('youtube')) { + let id = streamContainer.attr('data-youtube-id'); + + console.log('id', id); + console.log(this.youtube); + + if (this.youtube.hasOwnProperty(id)) { + jQuery('.stream').each(function() { + Multiview.muteStream(jQuery(this)); + }) + streamContainer.addClass('active'); + this.youtube[id].unMute(); + } + } else if (streamContainer.hasClass('twitch')) { + let id = streamContainer.attr('data-twitch-id'); + if (this.twitch.hasOwnProperty(id)) { + jQuery('.stream').each(function() { + Multiview.muteStream(jQuery(this)); + }) + streamContainer.addClass('active'); + this.twitch[id].setMuted(false); + } + } else { + jQuery('.stream').each(function() { + Multiview.muteStream(jQuery(this)); + }) + streamContainer.addClass('active'); + const id = 'video_stream' + streamContainer.attr('data-video-id'); + try { + videojs('video_stream' + streamContainer.attr('data-video-id')).muted(false); + } catch (ex) { + // Do nothing + } + } + }, + + removeStream: function(streamNumber) { + const streamContainer = jQuery('div[data-video-id=' + streamNumber + ']'); + streamContainer.removeAttr('data-video-source'); + streamContainer.html('

Stream Offline

'); + streamContainer.attr('class', 'stream offline'); + }, + + addStream: function(streamNumber, title, source, type) + { + let oldPlayer = videojs('video_stream' + streamNumber); + if (oldPlayer) { + oldPlayer.dispose(); + } + const streamContainer = jQuery('div[data-video-id=' + streamNumber + ']'); + streamContainer.attr('class', 'stream live'); + streamContainer.attr('data-video-source', source); + let html = ''; + html += '

'; + html += '

' + title + '

'; + html += '

'; + streamContainer.html(html); + videojs('video_stream' + streamNumber, {}); + Multiview.bindEvents(); + }, + + processStatus: function(streams) { + streams.forEach(stream => { + Multiview.updateStream(stream.id, stream); + }); + }, + + updateStream: function(streamNumber, stream) + { + if (!stream.live) { + Multiview.removeStream(streamNumber); + return; + } + + let currentVideoSource = jQuery('div[data-video-id=' + streamNumber + ']').attr('data-video-source'); + if (currentVideoSource === stream.url) { + return; + } + + Multiview.addStream(streamNumber, stream.title, stream.url, stream.type); + } + } +; + +Multiview.init(); diff --git a/live/js/videojs.youtube.min.js b/live/js/videojs.youtube.min.js new file mode 100644 index 0000000..1471886 --- /dev/null +++ b/live/js/videojs.youtube.min.js @@ -0,0 +1,544 @@ +(function (root, factory) { + if (typeof exports === "object" && typeof module !== "undefined") { + var videojs = require("video.js"); + module.exports = factory(videojs.default || videojs) + } else if (typeof define === "function" && define.amd) { + define(["videojs"], function (videojs) { + return root.Youtube = factory(videojs) + }) + } else { + root.Youtube = factory(root.videojs) + } +})(this, function (videojs) { + "use strict"; + var _isOnMobile = videojs.browser.IS_IOS || videojs.browser.IS_NATIVE_ANDROID; + var Tech = videojs.getTech("Tech"); + var Youtube = videojs.extend(Tech, { + constructor: function (options, ready) { + Tech.call(this, options, ready); + this.setPoster(options.poster); + this.setSrc(this.options_.source, true); + this.setTimeout(function () { + if (this.el_) { + this.el_.parentNode.className += " vjs-youtube"; + if (_isOnMobile) { + this.el_.parentNode.className += " vjs-youtube-mobile" + } + if (Youtube.isApiReady) { + this.initYTPlayer() + } else { + Youtube.apiReadyQueue.push(this) + } + } + }.bind(this)) + }, dispose: function () { + if (this.ytPlayer) { + if (this.ytPlayer.stopVideo) { + this.ytPlayer.stopVideo() + } + if (this.ytPlayer.destroy) { + this.ytPlayer.destroy() + } + } else { + var index = Youtube.apiReadyQueue.indexOf(this); + if (index !== -1) { + Youtube.apiReadyQueue.splice(index, 1) + } + } + this.ytPlayer = null; + this.el_.parentNode.className = this.el_.parentNode.className.replace(" vjs-youtube", "").replace(" vjs-youtube-mobile", ""); + this.el_.parentNode.removeChild(this.el_); + Tech.prototype.dispose.call(this) + }, createEl: function () { + var div = document.createElement("div"); + div.setAttribute("id", this.options_.techId); + div.setAttribute("style", "width:100%;height:100%;top:0;left:0;position:absolute"); + div.setAttribute("class", "vjs-tech"); + var divWrapper = document.createElement("div"); + divWrapper.appendChild(div); + if (!_isOnMobile && !this.options_.ytControls) { + var divBlocker = document.createElement("div"); + divBlocker.setAttribute("class", "vjs-iframe-blocker"); + divBlocker.setAttribute("style", "position:absolute;top:0;left:0;width:100%;height:100%"); + divBlocker.onclick = function () { + this.pause() + }.bind(this); + divWrapper.appendChild(divBlocker) + } + return divWrapper + }, initYTPlayer: function () { + var playerVars = {controls: 0, modestbranding: 1, rel: 0, showinfo: 0, loop: this.options_.loop ? 1 : 0}; + if (typeof this.options_.autohide !== "undefined") { + playerVars.autohide = this.options_.autohide + } + if (typeof this.options_["cc_load_policy"] !== "undefined") { + playerVars["cc_load_policy"] = this.options_["cc_load_policy"] + } + if (typeof this.options_.ytControls !== "undefined") { + playerVars.controls = this.options_.ytControls + } + if (typeof this.options_.disablekb !== "undefined") { + playerVars.disablekb = this.options_.disablekb + } + if (typeof this.options_.color !== "undefined") { + playerVars.color = this.options_.color + } + if (!playerVars.controls) { + playerVars.fs = 0 + } else if (typeof this.options_.fs !== "undefined") { + playerVars.fs = this.options_.fs + } + if (this.options_.source.src.indexOf("end=") !== -1) { + var srcEndTime = this.options_.source.src.match(/end=([0-9]*)/); + this.options_.end = parseInt(srcEndTime[1]) + } + if (typeof this.options_.end !== "undefined") { + playerVars.end = this.options_.end + } + if (typeof this.options_.hl !== "undefined") { + playerVars.hl = this.options_.hl + } else if (typeof this.options_.language !== "undefined") { + playerVars.hl = this.options_.language.substr(0, 2) + } + if (typeof this.options_["iv_load_policy"] !== "undefined") { + playerVars["iv_load_policy"] = this.options_["iv_load_policy"] + } + if (typeof this.options_.list !== "undefined") { + playerVars.list = this.options_.list + } else if (this.url && typeof this.url.listId !== "undefined") { + playerVars.list = this.url.listId + } + if (typeof this.options_.listType !== "undefined") { + playerVars.listType = this.options_.listType + } + if (typeof this.options_.modestbranding !== "undefined") { + playerVars.modestbranding = this.options_.modestbranding + } + if (typeof this.options_.playlist !== "undefined") { + playerVars.playlist = this.options_.playlist + } + if (typeof this.options_.playsinline !== "undefined") { + playerVars.playsinline = this.options_.playsinline + } + if (typeof this.options_.rel !== "undefined") { + playerVars.rel = this.options_.rel + } + if (typeof this.options_.showinfo !== "undefined") { + playerVars.showinfo = this.options_.showinfo + } + if (this.options_.source.src.indexOf("start=") !== -1) { + var srcStartTime = this.options_.source.src.match(/start=([0-9]*)/); + this.options_.start = parseInt(srcStartTime[1]) + } + if (typeof this.options_.start !== "undefined") { + playerVars.start = this.options_.start + } + if (typeof this.options_.theme !== "undefined") { + playerVars.theme = this.options_.theme + } + if (typeof this.options_.customVars !== "undefined") { + var customVars = this.options_.customVars; + Object.keys(customVars).forEach(function (key) { + playerVars[key] = customVars[key] + }) + } + this.activeVideoId = this.url ? this.url.videoId : null; + this.activeList = playerVars.list; + var playerConfig = { + videoId: this.activeVideoId, + playerVars: playerVars, + events: { + onReady: this.onPlayerReady.bind(this), + onPlaybackQualityChange: this.onPlayerPlaybackQualityChange.bind(this), + onPlaybackRateChange: this.onPlayerPlaybackRateChange.bind(this), + onStateChange: this.onPlayerStateChange.bind(this), + onVolumeChange: this.onPlayerVolumeChange.bind(this), + onError: this.onPlayerError.bind(this) + } + }; + if (typeof this.options_.enablePrivacyEnhancedMode !== "undefined" && this.options_.enablePrivacyEnhancedMode) { + playerConfig.host = "https://www.youtube-nocookie.com" + } + this.ytPlayer = new YT.Player(this.options_.techId, playerConfig) + }, onPlayerReady: function () { + if (this.options_.muted) { + this.ytPlayer.mute() + } + var playbackRates = this.ytPlayer.getAvailablePlaybackRates(); + if (playbackRates.length > 1) { + this.featuresPlaybackRate = true + } + this.playerReady_ = true; + this.triggerReady(); + if (this.playOnReady) { + this.play() + } else if (this.cueOnReady) { + this.cueVideoById_(this.url.videoId); + this.activeVideoId = this.url.videoId + } + }, onPlayerPlaybackQualityChange: function () { + }, onPlayerPlaybackRateChange: function () { + this.trigger("ratechange") + }, onPlayerStateChange: function (e) { + var state = e.data; + if (state === this.lastState || this.errorNumber) { + return + } + this.lastState = state; + switch (state) { + case-1: + this.trigger("loadstart"); + this.trigger("loadedmetadata"); + this.trigger("durationchange"); + this.trigger("ratechange"); + break; + case YT.PlayerState.ENDED: + this.trigger("ended"); + break; + case YT.PlayerState.PLAYING: + this.trigger("timeupdate"); + this.trigger("durationchange"); + this.trigger("playing"); + this.trigger("play"); + if (this.isSeeking) { + this.onSeeked() + } + break; + case YT.PlayerState.PAUSED: + this.trigger("canplay"); + if (this.isSeeking) { + this.onSeeked() + } else { + this.trigger("pause") + } + break; + case YT.PlayerState.BUFFERING: + this.player_.trigger("timeupdate"); + this.player_.trigger("waiting"); + break + } + }, onPlayerVolumeChange: function () { + this.trigger("volumechange") + }, onPlayerError: function (e) { + this.errorNumber = e.data; + this.trigger("pause"); + this.trigger("error") + }, error: function () { + var code = 1e3 + this.errorNumber; + switch (this.errorNumber) { + case 5: + return {code: code, message: "Error while trying to play the video"}; + case 2: + case 100: + return {code: code, message: "Unable to find the video"}; + case 101: + case 150: + return {code: code, message: "Playback on other Websites has been disabled by the video owner."} + } + return {code: code, message: "YouTube unknown error (" + this.errorNumber + ")"} + }, loadVideoById_: function (id) { + var options = {videoId: id}; + if (this.options_.start) { + options.startSeconds = this.options_.start + } + if (this.options_.end) { + options.endEnd = this.options_.end + } + this.ytPlayer.loadVideoById(options) + }, cueVideoById_: function (id) { + var options = {videoId: id}; + if (this.options_.start) { + options.startSeconds = this.options_.start + } + if (this.options_.end) { + options.endEnd = this.options_.end + } + this.ytPlayer.cueVideoById(options) + }, src: function (src) { + if (src) { + this.setSrc({src: src}) + } + return this.source + }, poster: function () { + if (_isOnMobile) { + return null + } + return this.poster_ + }, setPoster: function (poster) { + this.poster_ = poster + }, setSrc: function (source) { + if (!source || !source.src) { + return + } + delete this.errorNumber; + this.source = source; + this.url = Youtube.parseUrl(source.src); + if (!this.options_.poster) { + if (this.url.videoId) { + this.poster_ = "https://img.youtube.com/vi/" + this.url.videoId + "/0.jpg"; + this.trigger("posterchange"); + this.checkHighResPoster() + } + } + if (this.options_.autoplay && !_isOnMobile) { + if (this.isReady_) { + this.play() + } else { + this.playOnReady = true + } + } else if (this.activeVideoId !== this.url.videoId) { + if (this.isReady_) { + this.cueVideoById_(this.url.videoId); + this.activeVideoId = this.url.videoId + } else { + this.cueOnReady = true + } + } + }, autoplay: function () { + return this.options_.autoplay + }, setAutoplay: function (val) { + this.options_.autoplay = val + }, loop: function () { + return this.options_.loop + }, setLoop: function (val) { + this.options_.loop = val + }, play: function () { + if (!this.url || !this.url.videoId) { + return + } + this.wasPausedBeforeSeek = false; + if (this.isReady_) { + if (this.url.listId) { + if (this.activeList === this.url.listId) { + this.ytPlayer.playVideo() + } else { + this.ytPlayer.loadPlaylist(this.url.listId); + this.activeList = this.url.listId + } + } + if (this.activeVideoId === this.url.videoId) { + this.ytPlayer.playVideo() + } else { + this.loadVideoById_(this.url.videoId); + this.activeVideoId = this.url.videoId + } + } else { + this.trigger("waiting"); + this.playOnReady = true + } + }, pause: function () { + if (this.ytPlayer) { + this.ytPlayer.pauseVideo() + } + }, paused: function () { + return this.ytPlayer ? this.lastState !== YT.PlayerState.PLAYING && this.lastState !== YT.PlayerState.BUFFERING : true + }, currentTime: function () { + return this.ytPlayer ? this.ytPlayer.getCurrentTime() : 0 + }, setCurrentTime: function (seconds) { + if (this.lastState === YT.PlayerState.PAUSED) { + this.timeBeforeSeek = this.currentTime() + } + if (!this.isSeeking) { + this.wasPausedBeforeSeek = this.paused() + } + this.ytPlayer.seekTo(seconds, true); + this.trigger("timeupdate"); + this.trigger("seeking"); + this.isSeeking = true; + if (this.lastState === YT.PlayerState.PAUSED && this.timeBeforeSeek !== seconds) { + clearInterval(this.checkSeekedInPauseInterval); + this.checkSeekedInPauseInterval = setInterval(function () { + if (this.lastState !== YT.PlayerState.PAUSED || !this.isSeeking) { + clearInterval(this.checkSeekedInPauseInterval) + } else if (this.currentTime() !== this.timeBeforeSeek) { + this.trigger("timeupdate"); + this.onSeeked() + } + }.bind(this), 250) + } + }, seeking: function () { + return this.isSeeking + }, seekable: function () { + if (!this.ytPlayer) { + return videojs.createTimeRange() + } + return videojs.createTimeRange(0, this.ytPlayer.getDuration()) + }, onSeeked: function () { + clearInterval(this.checkSeekedInPauseInterval); + this.isSeeking = false; + if (this.wasPausedBeforeSeek) { + this.pause() + } + this.trigger("seeked") + }, playbackRate: function () { + return this.ytPlayer ? this.ytPlayer.getPlaybackRate() : 1 + }, setPlaybackRate: function (suggestedRate) { + if (!this.ytPlayer) { + return + } + this.ytPlayer.setPlaybackRate(suggestedRate) + }, duration: function () { + return this.ytPlayer ? this.ytPlayer.getDuration() : 0 + }, currentSrc: function () { + return this.source && this.source.src + }, ended: function () { + return this.ytPlayer ? this.lastState === YT.PlayerState.ENDED : false + }, volume: function () { + return this.ytPlayer ? this.ytPlayer.getVolume() / 100 : 1 + }, setVolume: function (percentAsDecimal) { + if (!this.ytPlayer) { + return + } + this.ytPlayer.setVolume(percentAsDecimal * 100) + }, muted: function () { + return this.ytPlayer ? this.ytPlayer.isMuted() : false + }, setMuted: function (mute) { + if (!this.ytPlayer) { + return + } else { + this.muted(true) + } + if (mute) { + this.ytPlayer.mute() + } else { + this.ytPlayer.unMute() + } + this.setTimeout(function () { + this.trigger("volumechange") + }, 50) + }, buffered: function () { + if (!this.ytPlayer || !this.ytPlayer.getVideoLoadedFraction) { + return videojs.createTimeRange() + } + var bufferedEnd = this.ytPlayer.getVideoLoadedFraction() * this.ytPlayer.getDuration(); + return videojs.createTimeRange(0, bufferedEnd) + }, preload: function () { + }, load: function () { + }, reset: function () { + }, networkState: function () { + if (!this.ytPlayer) { + return 0 + } + switch (this.ytPlayer.getPlayerState()) { + case-1: + return 0; + case 3: + return 2; + default: + return 1 + } + }, readyState: function () { + if (!this.ytPlayer) { + return 0 + } + switch (this.ytPlayer.getPlayerState()) { + case-1: + return 0; + case 5: + return 1; + case 3: + return 2; + default: + return 4 + } + }, supportsFullScreen: function () { + return document.fullscreenEnabled || document.webkitFullscreenEnabled || document.mozFullScreenEnabled || document.msFullscreenEnabled + }, checkHighResPoster: function () { + var uri = "https://img.youtube.com/vi/" + this.url.videoId + "/maxresdefault.jpg"; + try { + var image = new Image; + image.onload = function () { + if ("naturalHeight" in image) { + if (image.naturalHeight <= 90 || image.naturalWidth <= 120) { + return + } + } else if (image.height <= 90 || image.width <= 120) { + return + } + this.poster_ = uri; + this.trigger("posterchange") + }.bind(this); + image.onerror = function () { + }; + image.src = uri + } catch (e) { + } + } + }); + Youtube.isSupported = function () { + return true + }; + Youtube.canPlaySource = function (e) { + return Youtube.canPlayType(e.type) + }; + Youtube.canPlayType = function (e) { + return e === "video/youtube" + }; + Youtube.parseUrl = function (url) { + var result = {videoId: null}; + var regex = /^.*(youtu.be\/|v\/|u\/\w\/|embed\/|watch\?v=|\&v=)([^#\&\?]*).*/; + var match = url.match(regex); + if (match && match[2].length === 11) { + result.videoId = match[2] + } + var regPlaylist = /[?&]list=([^#\&\?]+)/; + match = url.match(regPlaylist); + if (match && match[1]) { + result.listId = match[1] + } + return result + }; + + function apiLoaded() { + YT.ready(function () { + Youtube.isApiReady = true; + for (var i = 0; i < Youtube.apiReadyQueue.length; ++i) { + Youtube.apiReadyQueue[i].initYTPlayer() + } + }) + } + + function loadScript(src, callback) { + var loaded = false; + var tag = document.createElement("script"); + var firstScriptTag = document.getElementsByTagName("script")[0]; + firstScriptTag.parentNode.insertBefore(tag, firstScriptTag); + tag.onload = function () { + if (!loaded) { + loaded = true; + callback() + } + }; + tag.onreadystatechange = function () { + if (!loaded && (this.readyState === "complete" || this.readyState === "loaded")) { + loaded = true; + callback() + } + }; + tag.src = src + } + + function injectCss() { + var css = ".vjs-youtube .vjs-iframe-blocker { display: none; }" + ".vjs-youtube.vjs-user-inactive .vjs-iframe-blocker { display: block; }" + ".vjs-youtube .vjs-poster { background-size: cover; }" + ".vjs-youtube-mobile .vjs-big-play-button { display: none; }"; + var head = document.head || document.getElementsByTagName("head")[0]; + var style = document.createElement("style"); + style.type = "text/css"; + if (style.styleSheet) { + style.styleSheet.cssText = css + } else { + style.appendChild(document.createTextNode(css)) + } + head.appendChild(style) + } + + Youtube.apiReadyQueue = []; + if (typeof document !== "undefined") { + loadScript("https://www.youtube.com/iframe_api", apiLoaded); + injectCss() + } + if (typeof videojs.registerTech !== "undefined") { + videojs.registerTech("Youtube", Youtube) + } else { + videojs.registerComponent("Youtube", Youtube) + } +}); diff --git a/node_modules/.bin/mime b/node_modules/.bin/mime new file mode 120000 index 0000000..fbb7ee0 --- /dev/null +++ b/node_modules/.bin/mime @@ -0,0 +1 @@ +../mime/cli.js \ No newline at end of file diff --git a/node_modules/@arr/every/index.js b/node_modules/@arr/every/index.js new file mode 100644 index 0000000..170cc49 --- /dev/null +++ b/node_modules/@arr/every/index.js @@ -0,0 +1,11 @@ +module.exports = function (arr, cb) { + var i=0, len=arr.length; + + for (; i < len; i++) { + if (!cb(arr[i], i, arr)) { + return false; + } + } + + return true; +} diff --git a/node_modules/@arr/every/module.d.ts b/node_modules/@arr/every/module.d.ts new file mode 100644 index 0000000..f2935dc --- /dev/null +++ b/node_modules/@arr/every/module.d.ts @@ -0,0 +1 @@ +export default function(arr: T[], callback: (val: T, idx: number, arr: T[]) => unknown): boolean; diff --git a/node_modules/@arr/every/module.js b/node_modules/@arr/every/module.js new file mode 100644 index 0000000..18a4208 --- /dev/null +++ b/node_modules/@arr/every/module.js @@ -0,0 +1,11 @@ +export default function (arr, cb) { + var i=0, len=arr.length; + + for (; i < len; i++) { + if (!cb(arr[i], i, arr)) { + return false; + } + } + + return true; +} diff --git a/node_modules/@arr/every/package.json b/node_modules/@arr/every/package.json new file mode 100644 index 0000000..ce4a4d6 --- /dev/null +++ b/node_modules/@arr/every/package.json @@ -0,0 +1,63 @@ +{ + "_from": "@arr/every@^1.0.0", + "_id": "@arr/every@1.0.1", + "_inBundle": false, + "_integrity": "sha512-UQFQ6SgyJ6LX42W8rHCs8KVc0JS0tzVL9ct4XYedJukskYVWTo49tNiMEK9C2HTyarbNiT/RVIRSY82vH+6sTg==", + "_location": "/@arr/every", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "@arr/every@^1.0.0", + "name": "@arr/every", + "escapedName": "@arr%2fevery", + "scope": "@arr", + "rawSpec": "^1.0.0", + "saveSpec": null, + "fetchSpec": "^1.0.0" + }, + "_requiredBy": [ + "/matchit" + ], + "_resolved": "https://registry.npmjs.org/@arr/every/-/every-1.0.1.tgz", + "_shasum": "22fe1f8e6355beca6c7c7bde965eb15cf994387b", + "_spec": "@arr/every@^1.0.0", + "_where": "/home/martin/dev/multiview/node_modules/matchit", + "author": { + "name": "Luke Edwards", + "email": "luke.edwards05@gmail.com", + "url": "https://lukeed.com" + }, + "bugs": { + "url": "https://github.com/lukeed/arr/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "A tiny, faster alternative to native Array.prototype.every", + "engines": { + "node": ">=4" + }, + "homepage": "https://github.com/lukeed/arr#readme", + "keywords": [ + "arr", + "array", + "Array.every", + "Array.prototype.every", + "performance", + "native", + "every" + ], + "license": "MIT", + "main": "index.js", + "module": "module.js", + "name": "@arr/every", + "publishConfig": { + "access": "public" + }, + "repository": { + "type": "git", + "url": "git+https://github.com/lukeed/arr.git" + }, + "types": "module.d.ts", + "version": "1.0.1" +} diff --git a/node_modules/@arr/every/readme.md b/node_modules/@arr/every/readme.md new file mode 100644 index 0000000..31cad87 --- /dev/null +++ b/node_modules/@arr/every/readme.md @@ -0,0 +1,45 @@ +# @arr/every + +> A tiny, faster alternative to native `Array.prototype.every` + +:warning: Unlike native, `@arr/every` does _not_ support the optional `thisArg` parameter! + +## Install + +``` +$ npm install --save @arr/every +``` + +## Usage + +```js +import every from '@arr/every'; + +const isBigEnough = val => val >= 10; + +every([12, 5, 8, 130, 44], isBigEnough); +//=> false +every([12, 54, 18, 130, 44], isBigEnough); +//=> true +``` + +## API + +### every(arr, callback) + +#### arr +Type: `Array`
+The array to iterate upon. + +#### callback(value[, index, array]) +Type: `Function`
+Function to test for each element, taking three arguments: + +* **value** (required) -- The current element being processed in the array. +* **index** (optional) -- The index of the current element being processed in the array. +* **array** (optional) -- The array `every` was called upon. + + +## License + +MIT © [Luke Edwards](http://lukeed.com) diff --git a/node_modules/@polka/url/index.js b/node_modules/@polka/url/index.js new file mode 100644 index 0000000..aa84fda --- /dev/null +++ b/node_modules/@polka/url/index.js @@ -0,0 +1,22 @@ +module.exports = function (req) { + let url = req.url; + if (url === void 0) return url; + + let obj = req._parsedUrl; + if (obj && obj._raw === url) return obj; + + obj = {}; + obj.query = obj.search = null; + obj.href = obj.path = obj.pathname = url; + + let idx = url.indexOf('?', 1); + if (idx !== -1) { + obj.search = url.substring(idx); + obj.query = obj.search.substring(1); + obj.pathname = url.substring(0, idx); + } + + obj._raw = url; + + return (req._parsedUrl = obj); +} diff --git a/node_modules/@polka/url/package.json b/node_modules/@polka/url/package.json new file mode 100644 index 0000000..77f7b70 --- /dev/null +++ b/node_modules/@polka/url/package.json @@ -0,0 +1,52 @@ +{ + "_from": "@polka/url@^0.5.0", + "_id": "@polka/url@0.5.0", + "_inBundle": false, + "_integrity": "sha512-oZLYFEAzUKyi3SKnXvj32ZCEGH6RDnao7COuCVhDydMS9NrCSVXhM79VaKyP5+Zc33m0QXEd2DN3UkU7OsHcfw==", + "_location": "/@polka/url", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "@polka/url@^0.5.0", + "name": "@polka/url", + "escapedName": "@polka%2furl", + "scope": "@polka", + "rawSpec": "^0.5.0", + "saveSpec": null, + "fetchSpec": "^0.5.0" + }, + "_requiredBy": [ + "/polka", + "/sirv" + ], + "_resolved": "https://registry.npmjs.org/@polka/url/-/url-0.5.0.tgz", + "_shasum": "b21510597fd601e5d7c95008b76bf0d254ebfd31", + "_spec": "@polka/url@^0.5.0", + "_where": "/home/martin/dev/multiview/node_modules/polka", + "author": { + "name": "Luke Edwards", + "email": "luke@lukeed.com", + "url": "https://lukeed.com" + }, + "bugs": { + "url": "https://github.com/lukeed/polka/issues" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "Super fast, memoized `req.url` parser", + "files": [ + "*.js" + ], + "homepage": "https://github.com/lukeed/polka#readme", + "license": "MIT", + "name": "@polka/url", + "publishConfig": { + "access": "public" + }, + "repository": { + "type": "git", + "url": "git+https://github.com/lukeed/polka.git" + }, + "version": "0.5.0" +} diff --git a/node_modules/@polka/url/readme.md b/node_modules/@polka/url/readme.md new file mode 100644 index 0000000..dda8379 --- /dev/null +++ b/node_modules/@polka/url/readme.md @@ -0,0 +1,86 @@ +# @polka/url [![npm](https://badgen.now.sh/npm/v/@polka/url)](https://npmjs.org/package/@polka/url) + +> Super fast, memoized `req.url` parser; _not_ limited to [Polka][polka]! + +Parses the `url` from a [`IncomingMessage`](https://nodejs.org/api/http.html#http_class_http_incomingmessage) request. The returned object will always only contain the following keys: `search`, `query`, `pathname`, `path`, `href`, and `_raw`. + +> **Note:** This library does not process `protocol`, `hostname`, `port`, etc.
This is because the incoming `req.url` value only begins with the path information. + +Parsed requests will be mutated with a `_parsedUrl` key, containing the returned output. This is used for future memoization, so as to avoid parsing the same `url` value multiple times. + +## Install + +``` +$ npm install --save @polka/url +``` + +## Usage + +```js +const parse = require('@polka/url'); + +let req = { url: '/foo/bar?fizz=buzz' }; +let foo = parse(req); +//=> { search: '?fizz=buzz', +//=> query: 'fizz=buzz', +//=> pathname: '/foo/bar', +//=> path: '/foo/bar?fizz=buzz', +//=> href: '/foo/bar?fizz=buzz', +//=> _raw: '/foo/bar?fizz=buzz' } + +// Attaches result for future memoization +assert.deepEqual(foo, req._parsedUrl); //=> true +``` + +## API + +### url(req) +Returns: `Object` or `undefined` + +> **Important:** The `req` must have a `url` key, otherwise `undefined` will be returned.
If no input is provided at all, a `TypeError` will be thrown. + +#### req +Type: `IncomingMessage` or `Object` + +The incoming HTTP request (`req`) or a plain `Object` with a `url` key. + +> **Note:** In Node.js servers, the [`req.url`](https://nodejs.org/api/http.html#http_message_url) begins with a pathname & does not include a `hash`. + + +## Benchmarks + +> Running the `parseurl` benchmark suite on Node 10.9.0 + +``` +Parsing: "/foo/bar?user=tj&pet=fluffy" + nativeurl x 3,496,593 ops/sec ±0.78% (194 runs sampled) + parseurl x 5,702,515 ops/sec ±0.59% (194 runs sampled) + @polka/url x 11,510,281 ops/sec ±1.93% (192 runs sampled) + +REPEAT: "/foo/bar?user=tj&pet=fluffy" + nativeurl x 3,344,884 ops/sec ±0.13% (191 runs sampled) + parseurl x 20,386,848 ops/sec ±0.22% (192 runs sampled) + @polka/url x 21,088,923 ops/sec ±0.58% (191 runs sampled) + +Parsing: "/foo/bar" + nativeurl x 9,808,119 ops/sec ±0.51% (190 runs sampled) + parseurl x 26,186,627 ops/sec ±0.16% (195 runs sampled) + @polka/url x 43,946,765 ops/sec ±0.55% (194 runs sampled) + +Parsing: "/" + nativeurl x 15,698,746 ops/sec ±0.79% (192 runs sampled) + parseurl x 36,861,339 ops/sec ±0.19% (195 runs sampled) + @polka/url x 48,295,119 ops/sec ±0.51% (194 runs sampled) +``` + + +## Support + +Any issues or questions can be sent to the [Polka][polka] repository.
However, please specify that your inquiry is about `@polka/url` specifically. + + +## License + +MIT © [Luke Edwards](https://lukeed.com) + +[polka]: https://github.com/lukeed/polka diff --git a/node_modules/accepts/HISTORY.md b/node_modules/accepts/HISTORY.md new file mode 100644 index 0000000..0bf0417 --- /dev/null +++ b/node_modules/accepts/HISTORY.md @@ -0,0 +1,236 @@ +1.3.7 / 2019-04-29 +================== + + * deps: negotiator@0.6.2 + - Fix sorting charset, encoding, and language with extra parameters + +1.3.6 / 2019-04-28 +================== + + * deps: mime-types@~2.1.24 + - deps: mime-db@~1.40.0 + +1.3.5 / 2018-02-28 +================== + + * deps: mime-types@~2.1.18 + - deps: mime-db@~1.33.0 + +1.3.4 / 2017-08-22 +================== + + * deps: mime-types@~2.1.16 + - deps: mime-db@~1.29.0 + +1.3.3 / 2016-05-02 +================== + + * deps: mime-types@~2.1.11 + - deps: mime-db@~1.23.0 + * deps: negotiator@0.6.1 + - perf: improve `Accept` parsing speed + - perf: improve `Accept-Charset` parsing speed + - perf: improve `Accept-Encoding` parsing speed + - perf: improve `Accept-Language` parsing speed + +1.3.2 / 2016-03-08 +================== + + * deps: mime-types@~2.1.10 + - Fix extension of `application/dash+xml` + - Update primary extension for `audio/mp4` + - deps: mime-db@~1.22.0 + +1.3.1 / 2016-01-19 +================== + + * deps: mime-types@~2.1.9 + - deps: mime-db@~1.21.0 + +1.3.0 / 2015-09-29 +================== + + * deps: mime-types@~2.1.7 + - deps: mime-db@~1.19.0 + * deps: negotiator@0.6.0 + - Fix including type extensions in parameters in `Accept` parsing + - Fix parsing `Accept` parameters with quoted equals + - Fix parsing `Accept` parameters with quoted semicolons + - Lazy-load modules from main entry point + - perf: delay type concatenation until needed + - perf: enable strict mode + - perf: hoist regular expressions + - perf: remove closures getting spec properties + - perf: remove a closure from media type parsing + - perf: remove property delete from media type parsing + +1.2.13 / 2015-09-06 +=================== + + * deps: mime-types@~2.1.6 + - deps: mime-db@~1.18.0 + +1.2.12 / 2015-07-30 +=================== + + * deps: mime-types@~2.1.4 + - deps: mime-db@~1.16.0 + +1.2.11 / 2015-07-16 +=================== + + * deps: mime-types@~2.1.3 + - deps: mime-db@~1.15.0 + +1.2.10 / 2015-07-01 +=================== + + * deps: mime-types@~2.1.2 + - deps: mime-db@~1.14.0 + +1.2.9 / 2015-06-08 +================== + + * deps: mime-types@~2.1.1 + - perf: fix deopt during mapping + +1.2.8 / 2015-06-07 +================== + + * deps: mime-types@~2.1.0 + - deps: mime-db@~1.13.0 + * perf: avoid argument reassignment & argument slice + * perf: avoid negotiator recursive construction + * perf: enable strict mode + * perf: remove unnecessary bitwise operator + +1.2.7 / 2015-05-10 +================== + + * deps: negotiator@0.5.3 + - Fix media type parameter matching to be case-insensitive + +1.2.6 / 2015-05-07 +================== + + * deps: mime-types@~2.0.11 + - deps: mime-db@~1.9.1 + * deps: negotiator@0.5.2 + - Fix comparing media types with quoted values + - Fix splitting media types with quoted commas + +1.2.5 / 2015-03-13 +================== + + * deps: mime-types@~2.0.10 + - deps: mime-db@~1.8.0 + +1.2.4 / 2015-02-14 +================== + + * Support Node.js 0.6 + * deps: mime-types@~2.0.9 + - deps: mime-db@~1.7.0 + * deps: negotiator@0.5.1 + - Fix preference sorting to be stable for long acceptable lists + +1.2.3 / 2015-01-31 +================== + + * deps: mime-types@~2.0.8 + - deps: mime-db@~1.6.0 + +1.2.2 / 2014-12-30 +================== + + * deps: mime-types@~2.0.7 + - deps: mime-db@~1.5.0 + +1.2.1 / 2014-12-30 +================== + + * deps: mime-types@~2.0.5 + - deps: mime-db@~1.3.1 + +1.2.0 / 2014-12-19 +================== + + * deps: negotiator@0.5.0 + - Fix list return order when large accepted list + - Fix missing identity encoding when q=0 exists + - Remove dynamic building of Negotiator class + +1.1.4 / 2014-12-10 +================== + + * deps: mime-types@~2.0.4 + - deps: mime-db@~1.3.0 + +1.1.3 / 2014-11-09 +================== + + * deps: mime-types@~2.0.3 + - deps: mime-db@~1.2.0 + +1.1.2 / 2014-10-14 +================== + + * deps: negotiator@0.4.9 + - Fix error when media type has invalid parameter + +1.1.1 / 2014-09-28 +================== + + * deps: mime-types@~2.0.2 + - deps: mime-db@~1.1.0 + * deps: negotiator@0.4.8 + - Fix all negotiations to be case-insensitive + - Stable sort preferences of same quality according to client order + +1.1.0 / 2014-09-02 +================== + + * update `mime-types` + +1.0.7 / 2014-07-04 +================== + + * Fix wrong type returned from `type` when match after unknown extension + +1.0.6 / 2014-06-24 +================== + + * deps: negotiator@0.4.7 + +1.0.5 / 2014-06-20 +================== + + * fix crash when unknown extension given + +1.0.4 / 2014-06-19 +================== + + * use `mime-types` + +1.0.3 / 2014-06-11 +================== + + * deps: negotiator@0.4.6 + - Order by specificity when quality is the same + +1.0.2 / 2014-05-29 +================== + + * Fix interpretation when header not in request + * deps: pin negotiator@0.4.5 + +1.0.1 / 2014-01-18 +================== + + * Identity encoding isn't always acceptable + * deps: negotiator@~0.4.0 + +1.0.0 / 2013-12-27 +================== + + * Genesis diff --git a/node_modules/accepts/LICENSE b/node_modules/accepts/LICENSE new file mode 100644 index 0000000..0616607 --- /dev/null +++ b/node_modules/accepts/LICENSE @@ -0,0 +1,23 @@ +(The MIT License) + +Copyright (c) 2014 Jonathan Ong +Copyright (c) 2015 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/accepts/README.md b/node_modules/accepts/README.md new file mode 100644 index 0000000..66a2f54 --- /dev/null +++ b/node_modules/accepts/README.md @@ -0,0 +1,142 @@ +# accepts + +[![NPM Version][npm-version-image]][npm-url] +[![NPM Downloads][npm-downloads-image]][npm-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Higher level content negotiation based on [negotiator](https://www.npmjs.com/package/negotiator). +Extracted from [koa](https://www.npmjs.com/package/koa) for general use. + +In addition to negotiator, it allows: + +- Allows types as an array or arguments list, ie `(['text/html', 'application/json'])` + as well as `('text/html', 'application/json')`. +- Allows type shorthands such as `json`. +- Returns `false` when no types match +- Treats non-existent headers as `*` + +## Installation + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```sh +$ npm install accepts +``` + +## API + + + +```js +var accepts = require('accepts') +``` + +### accepts(req) + +Create a new `Accepts` object for the given `req`. + +#### .charset(charsets) + +Return the first accepted charset. If nothing in `charsets` is accepted, +then `false` is returned. + +#### .charsets() + +Return the charsets that the request accepts, in the order of the client's +preference (most preferred first). + +#### .encoding(encodings) + +Return the first accepted encoding. If nothing in `encodings` is accepted, +then `false` is returned. + +#### .encodings() + +Return the encodings that the request accepts, in the order of the client's +preference (most preferred first). + +#### .language(languages) + +Return the first accepted language. If nothing in `languages` is accepted, +then `false` is returned. + +#### .languages() + +Return the languages that the request accepts, in the order of the client's +preference (most preferred first). + +#### .type(types) + +Return the first accepted type (and it is returned as the same text as what +appears in the `types` array). If nothing in `types` is accepted, then `false` +is returned. + +The `types` array can contain full MIME types or file extensions. Any value +that is not a full MIME types is passed to `require('mime-types').lookup`. + +#### .types() + +Return the types that the request accepts, in the order of the client's +preference (most preferred first). + +## Examples + +### Simple type negotiation + +This simple example shows how to use `accepts` to return a different typed +respond body based on what the client wants to accept. The server lists it's +preferences in order and will get back the best match between the client and +server. + +```js +var accepts = require('accepts') +var http = require('http') + +function app (req, res) { + var accept = accepts(req) + + // the order of this list is significant; should be server preferred order + switch (accept.type(['json', 'html'])) { + case 'json': + res.setHeader('Content-Type', 'application/json') + res.write('{"hello":"world!"}') + break + case 'html': + res.setHeader('Content-Type', 'text/html') + res.write('hello, world!') + break + default: + // the fallback is text/plain, so no need to specify it above + res.setHeader('Content-Type', 'text/plain') + res.write('hello, world!') + break + } + + res.end() +} + +http.createServer(app).listen(3000) +``` + +You can test this out with the cURL program: +```sh +curl -I -H'Accept: text/html' http://localhost:3000/ +``` + +## License + +[MIT](LICENSE) + +[coveralls-image]: https://badgen.net/coveralls/c/github/jshttp/accepts/master +[coveralls-url]: https://coveralls.io/r/jshttp/accepts?branch=master +[node-version-image]: https://badgen.net/npm/node/accepts +[node-version-url]: https://nodejs.org/en/download +[npm-downloads-image]: https://badgen.net/npm/dm/accepts +[npm-url]: https://npmjs.org/package/accepts +[npm-version-image]: https://badgen.net/npm/v/accepts +[travis-image]: https://badgen.net/travis/jshttp/accepts/master +[travis-url]: https://travis-ci.org/jshttp/accepts diff --git a/node_modules/accepts/index.js b/node_modules/accepts/index.js new file mode 100644 index 0000000..e9b2f63 --- /dev/null +++ b/node_modules/accepts/index.js @@ -0,0 +1,238 @@ +/*! + * accepts + * Copyright(c) 2014 Jonathan Ong + * Copyright(c) 2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var Negotiator = require('negotiator') +var mime = require('mime-types') + +/** + * Module exports. + * @public + */ + +module.exports = Accepts + +/** + * Create a new Accepts object for the given req. + * + * @param {object} req + * @public + */ + +function Accepts (req) { + if (!(this instanceof Accepts)) { + return new Accepts(req) + } + + this.headers = req.headers + this.negotiator = new Negotiator(req) +} + +/** + * Check if the given `type(s)` is acceptable, returning + * the best match when true, otherwise `undefined`, in which + * case you should respond with 406 "Not Acceptable". + * + * The `type` value may be a single mime type string + * such as "application/json", the extension name + * such as "json" or an array `["json", "html", "text/plain"]`. When a list + * or array is given the _best_ match, if any is returned. + * + * Examples: + * + * // Accept: text/html + * this.types('html'); + * // => "html" + * + * // Accept: text/*, application/json + * this.types('html'); + * // => "html" + * this.types('text/html'); + * // => "text/html" + * this.types('json', 'text'); + * // => "json" + * this.types('application/json'); + * // => "application/json" + * + * // Accept: text/*, application/json + * this.types('image/png'); + * this.types('png'); + * // => undefined + * + * // Accept: text/*;q=.5, application/json + * this.types(['html', 'json']); + * this.types('html', 'json'); + * // => "json" + * + * @param {String|Array} types... + * @return {String|Array|Boolean} + * @public + */ + +Accepts.prototype.type = +Accepts.prototype.types = function (types_) { + var types = types_ + + // support flattened arguments + if (types && !Array.isArray(types)) { + types = new Array(arguments.length) + for (var i = 0; i < types.length; i++) { + types[i] = arguments[i] + } + } + + // no types, return all requested types + if (!types || types.length === 0) { + return this.negotiator.mediaTypes() + } + + // no accept header, return first given type + if (!this.headers.accept) { + return types[0] + } + + var mimes = types.map(extToMime) + var accepts = this.negotiator.mediaTypes(mimes.filter(validMime)) + var first = accepts[0] + + return first + ? types[mimes.indexOf(first)] + : false +} + +/** + * Return accepted encodings or best fit based on `encodings`. + * + * Given `Accept-Encoding: gzip, deflate` + * an array sorted by quality is returned: + * + * ['gzip', 'deflate'] + * + * @param {String|Array} encodings... + * @return {String|Array} + * @public + */ + +Accepts.prototype.encoding = +Accepts.prototype.encodings = function (encodings_) { + var encodings = encodings_ + + // support flattened arguments + if (encodings && !Array.isArray(encodings)) { + encodings = new Array(arguments.length) + for (var i = 0; i < encodings.length; i++) { + encodings[i] = arguments[i] + } + } + + // no encodings, return all requested encodings + if (!encodings || encodings.length === 0) { + return this.negotiator.encodings() + } + + return this.negotiator.encodings(encodings)[0] || false +} + +/** + * Return accepted charsets or best fit based on `charsets`. + * + * Given `Accept-Charset: utf-8, iso-8859-1;q=0.2, utf-7;q=0.5` + * an array sorted by quality is returned: + * + * ['utf-8', 'utf-7', 'iso-8859-1'] + * + * @param {String|Array} charsets... + * @return {String|Array} + * @public + */ + +Accepts.prototype.charset = +Accepts.prototype.charsets = function (charsets_) { + var charsets = charsets_ + + // support flattened arguments + if (charsets && !Array.isArray(charsets)) { + charsets = new Array(arguments.length) + for (var i = 0; i < charsets.length; i++) { + charsets[i] = arguments[i] + } + } + + // no charsets, return all requested charsets + if (!charsets || charsets.length === 0) { + return this.negotiator.charsets() + } + + return this.negotiator.charsets(charsets)[0] || false +} + +/** + * Return accepted languages or best fit based on `langs`. + * + * Given `Accept-Language: en;q=0.8, es, pt` + * an array sorted by quality is returned: + * + * ['es', 'pt', 'en'] + * + * @param {String|Array} langs... + * @return {Array|String} + * @public + */ + +Accepts.prototype.lang = +Accepts.prototype.langs = +Accepts.prototype.language = +Accepts.prototype.languages = function (languages_) { + var languages = languages_ + + // support flattened arguments + if (languages && !Array.isArray(languages)) { + languages = new Array(arguments.length) + for (var i = 0; i < languages.length; i++) { + languages[i] = arguments[i] + } + } + + // no languages, return all requested languages + if (!languages || languages.length === 0) { + return this.negotiator.languages() + } + + return this.negotiator.languages(languages)[0] || false +} + +/** + * Convert extnames to mime. + * + * @param {String} type + * @return {String} + * @private + */ + +function extToMime (type) { + return type.indexOf('/') === -1 + ? mime.lookup(type) + : type +} + +/** + * Check if mime is valid. + * + * @param {String} type + * @return {String} + * @private + */ + +function validMime (type) { + return typeof type === 'string' +} diff --git a/node_modules/accepts/package.json b/node_modules/accepts/package.json new file mode 100644 index 0000000..db9934f --- /dev/null +++ b/node_modules/accepts/package.json @@ -0,0 +1,86 @@ +{ + "_from": "accepts@~1.3.5", + "_id": "accepts@1.3.7", + "_inBundle": false, + "_integrity": "sha512-Il80Qs2WjYlJIBNzNkK6KYqlVMTbZLXgHx2oT0pU/fjRHyEp+PEfEPY0R3WCwAGVOtauxh1hOxNgIf5bv7dQpA==", + "_location": "/accepts", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "accepts@~1.3.5", + "name": "accepts", + "escapedName": "accepts", + "rawSpec": "~1.3.5", + "saveSpec": null, + "fetchSpec": "~1.3.5" + }, + "_requiredBy": [ + "/compression" + ], + "_resolved": "https://registry.npmjs.org/accepts/-/accepts-1.3.7.tgz", + "_shasum": "531bc726517a3b2b41f850021c6cc15eaab507cd", + "_spec": "accepts@~1.3.5", + "_where": "/home/martin/dev/multiview/node_modules/compression", + "bugs": { + "url": "https://github.com/jshttp/accepts/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com" + } + ], + "dependencies": { + "mime-types": "~2.1.24", + "negotiator": "0.6.2" + }, + "deprecated": false, + "description": "Higher-level content negotiation", + "devDependencies": { + "deep-equal": "1.0.1", + "eslint": "5.16.0", + "eslint-config-standard": "12.0.0", + "eslint-plugin-import": "2.17.2", + "eslint-plugin-markdown": "1.0.0", + "eslint-plugin-node": "8.0.1", + "eslint-plugin-promise": "4.1.1", + "eslint-plugin-standard": "4.0.0", + "mocha": "6.1.4", + "nyc": "14.0.0" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "index.js" + ], + "homepage": "https://github.com/jshttp/accepts#readme", + "keywords": [ + "content", + "negotiation", + "accept", + "accepts" + ], + "license": "MIT", + "name": "accepts", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/accepts.git" + }, + "scripts": { + "lint": "eslint --plugin markdown --ext js,md .", + "test": "mocha --reporter spec --check-leaks --bail test/", + "test-cov": "nyc --reporter=html --reporter=text npm test", + "test-travis": "nyc --reporter=text npm test" + }, + "version": "1.3.7" +} diff --git a/node_modules/bytes/History.md b/node_modules/bytes/History.md new file mode 100644 index 0000000..13d463a --- /dev/null +++ b/node_modules/bytes/History.md @@ -0,0 +1,82 @@ +3.0.0 / 2017-08-31 +================== + + * Change "kB" to "KB" in format output + * Remove support for Node.js 0.6 + * Remove support for ComponentJS + +2.5.0 / 2017-03-24 +================== + + * Add option "unit" + +2.4.0 / 2016-06-01 +================== + + * Add option "unitSeparator" + +2.3.0 / 2016-02-15 +================== + + * Drop partial bytes on all parsed units + * Fix non-finite numbers to `.format` to return `null` + * Fix parsing byte string that looks like hex + * perf: hoist regular expressions + +2.2.0 / 2015-11-13 +================== + + * add option "decimalPlaces" + * add option "fixedDecimals" + +2.1.0 / 2015-05-21 +================== + + * add `.format` export + * add `.parse` export + +2.0.2 / 2015-05-20 +================== + + * remove map recreation + * remove unnecessary object construction + +2.0.1 / 2015-05-07 +================== + + * fix browserify require + * remove node.extend dependency + +2.0.0 / 2015-04-12 +================== + + * add option "case" + * add option "thousandsSeparator" + * return "null" on invalid parse input + * support proper round-trip: bytes(bytes(num)) === num + * units no longer case sensitive when parsing + +1.0.0 / 2014-05-05 +================== + + * add negative support. fixes #6 + +0.3.0 / 2014-03-19 +================== + + * added terabyte support + +0.2.1 / 2013-04-01 +================== + + * add .component + +0.2.0 / 2012-10-28 +================== + + * bytes(200).should.eql('200b') + +0.1.0 / 2012-07-04 +================== + + * add bytes to string conversion [yields] diff --git a/node_modules/bytes/LICENSE b/node_modules/bytes/LICENSE new file mode 100644 index 0000000..63e95a9 --- /dev/null +++ b/node_modules/bytes/LICENSE @@ -0,0 +1,23 @@ +(The MIT License) + +Copyright (c) 2012-2014 TJ Holowaychuk +Copyright (c) 2015 Jed Watson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/bytes/Readme.md b/node_modules/bytes/Readme.md new file mode 100644 index 0000000..9b53745 --- /dev/null +++ b/node_modules/bytes/Readme.md @@ -0,0 +1,125 @@ +# Bytes utility + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Utility to parse a string bytes (ex: `1TB`) to bytes (`1099511627776`) and vice-versa. + +## Installation + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```bash +$ npm install bytes +``` + +## Usage + +```js +var bytes = require('bytes'); +``` + +#### bytes.format(number value, [options]): string｜null + +Format the given value in bytes into a string. If the value is negative, it is kept as such. If it is a float, it is + rounded. + +**Arguments** + +| Name | Type | Description | +|---------|----------|--------------------| +| value | `number` | Value in bytes | +| options | `Object` | Conversion options | + +**Options** + +| Property | Type | Description | +|-------------------|--------|-----------------------------------------------------------------------------------------| +| decimalPlaces | `number`｜`null` | Maximum number of decimal places to include in output. Default value to `2`. | +| fixedDecimals | `boolean`｜`null` | Whether to always display the maximum number of decimal places. Default value to `false` | +| thousandsSeparator | `string`｜`null` | Example of values: `' '`, `','` and `.`... Default value to `''`. | +| unit | `string`｜`null` | The unit in which the result will be returned (B/KB/MB/GB/TB). Default value to `''` (which means auto detect). | +| unitSeparator | `string`｜`null` | Separator to use between number and unit. Default value to `''`. | + +**Returns** + +| Name | Type | Description | +|---------|------------------|-------------------------------------------------| +| results | `string`｜`null` | Return null upon error. String value otherwise. | + +**Example** + +```js +bytes(1024); +// output: '1KB' + +bytes(1000); +// output: '1000B' + +bytes(1000, {thousandsSeparator: ' '}); +// output: '1 000B' + +bytes(1024 * 1.7, {decimalPlaces: 0}); +// output: '2KB' + +bytes(1024, {unitSeparator: ' '}); +// output: '1 KB' + +``` + +#### bytes.parse(string｜number value): number｜null + +Parse the string value into an integer in bytes. If no unit is given, or `value` +is a number, it is assumed the value is in bytes. + +Supported units and abbreviations are as follows and are case-insensitive: + + * `b` for bytes + * `kb` for kilobytes + * `mb` for megabytes + * `gb` for gigabytes + * `tb` for terabytes + +The units are in powers of two, not ten. This means 1kb = 1024b according to this parser. + +**Arguments** + +| Name | Type | Description | +|---------------|--------|--------------------| +| value | `string`｜`number` | String to parse, or number in bytes. | + +**Returns** + +| Name | Type | Description | +|---------|-------------|-------------------------| +| results | `number`｜`null` | Return null upon error. Value in bytes otherwise. | + +**Example** + +```js +bytes('1KB'); +// output: 1024 + +bytes('1024'); +// output: 1024 + +bytes(1024); +// output: 1024 +``` + +## License + +[MIT](LICENSE) + +[downloads-image]: https://img.shields.io/npm/dm/bytes.svg +[downloads-url]: https://npmjs.org/package/bytes +[npm-image]: https://img.shields.io/npm/v/bytes.svg +[npm-url]: https://npmjs.org/package/bytes +[travis-image]: https://img.shields.io/travis/visionmedia/bytes.js/master.svg +[travis-url]: https://travis-ci.org/visionmedia/bytes.js +[coveralls-image]: https://img.shields.io/coveralls/visionmedia/bytes.js/master.svg +[coveralls-url]: https://coveralls.io/r/visionmedia/bytes.js?branch=master diff --git a/node_modules/bytes/index.js b/node_modules/bytes/index.js new file mode 100644 index 0000000..1e39afd --- /dev/null +++ b/node_modules/bytes/index.js @@ -0,0 +1,159 @@ +/*! + * bytes + * Copyright(c) 2012-2014 TJ Holowaychuk + * Copyright(c) 2015 Jed Watson + * MIT Licensed + */ + +'use strict'; + +/** + * Module exports. + * @public + */ + +module.exports = bytes; +module.exports.format = format; +module.exports.parse = parse; + +/** + * Module variables. + * @private + */ + +var formatThousandsRegExp = /\B(?=(\d{3})+(?!\d))/g; + +var formatDecimalsRegExp = /(?:\.0*|(\.[^0]+)0+)$/; + +var map = { + b: 1, + kb: 1 << 10, + mb: 1 << 20, + gb: 1 << 30, + tb: ((1 << 30) * 1024) +}; + +var parseRegExp = /^((-|\+)?(\d+(?:\.\d+)?)) *(kb|mb|gb|tb)$/i; + +/** + * Convert the given value in bytes into a string or parse to string to an integer in bytes. + * + * @param {string|number} value + * @param {{ + * case: [string], + * decimalPlaces: [number] + * fixedDecimals: [boolean] + * thousandsSeparator: [string] + * unitSeparator: [string] + * }} [options] bytes options. + * + * @returns {string|number|null} + */ + +function bytes(value, options) { + if (typeof value === 'string') { + return parse(value); + } + + if (typeof value === 'number') { + return format(value, options); + } + + return null; +} + +/** + * Format the given value in bytes into a string. + * + * If the value is negative, it is kept as such. If it is a float, + * it is rounded. + * + * @param {number} value + * @param {object} [options] + * @param {number} [options.decimalPlaces=2] + * @param {number} [options.fixedDecimals=false] + * @param {string} [options.thousandsSeparator=] + * @param {string} [options.unit=] + * @param {string} [options.unitSeparator=] + * + * @returns {string|null} + * @public + */ + +function format(value, options) { + if (!Number.isFinite(value)) { + return null; + } + + var mag = Math.abs(value); + var thousandsSeparator = (options && options.thousandsSeparator) || ''; + var unitSeparator = (options && options.unitSeparator) || ''; + var decimalPlaces = (options && options.decimalPlaces !== undefined) ? options.decimalPlaces : 2; + var fixedDecimals = Boolean(options && options.fixedDecimals); + var unit = (options && options.unit) || ''; + + if (!unit || !map[unit.toLowerCase()]) { + if (mag >= map.tb) { + unit = 'TB'; + } else if (mag >= map.gb) { + unit = 'GB'; + } else if (mag >= map.mb) { + unit = 'MB'; + } else if (mag >= map.kb) { + unit = 'KB'; + } else { + unit = 'B'; + } + } + + var val = value / map[unit.toLowerCase()]; + var str = val.toFixed(decimalPlaces); + + if (!fixedDecimals) { + str = str.replace(formatDecimalsRegExp, '$1'); + } + + if (thousandsSeparator) { + str = str.replace(formatThousandsRegExp, thousandsSeparator); + } + + return str + unitSeparator + unit; +} + +/** + * Parse the string value into an integer in bytes. + * + * If no unit is given, it is assumed the value is in bytes. + * + * @param {number|string} val + * + * @returns {number|null} + * @public + */ + +function parse(val) { + if (typeof val === 'number' && !isNaN(val)) { + return val; + } + + if (typeof val !== 'string') { + return null; + } + + // Test if the string passed is valid + var results = parseRegExp.exec(val); + var floatValue; + var unit = 'b'; + + if (!results) { + // Nothing could be extracted from the given string + floatValue = parseInt(val, 10); + unit = 'b' + } else { + // Retrieve the value and the unit + floatValue = parseFloat(results[1]); + unit = results[4].toLowerCase(); + } + + return Math.floor(map[unit] * floatValue); +} diff --git a/node_modules/bytes/package.json b/node_modules/bytes/package.json new file mode 100644 index 0000000..68224a7 --- /dev/null +++ b/node_modules/bytes/package.json @@ -0,0 +1,81 @@ +{ + "_from": "bytes@3.0.0", + "_id": "bytes@3.0.0", + "_inBundle": false, + "_integrity": "sha1-0ygVQE1olpn4Wk6k+odV3ROpYEg=", + "_location": "/bytes", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "bytes@3.0.0", + "name": "bytes", + "escapedName": "bytes", + "rawSpec": "3.0.0", + "saveSpec": null, + "fetchSpec": "3.0.0" + }, + "_requiredBy": [ + "/compression" + ], + "_resolved": "https://registry.npmjs.org/bytes/-/bytes-3.0.0.tgz", + "_shasum": "d32815404d689699f85a4ea4fa8755dd13a96048", + "_spec": "bytes@3.0.0", + "_where": "/home/martin/dev/multiview/node_modules/compression", + "author": { + "name": "TJ Holowaychuk", + "email": "tj@vision-media.ca", + "url": "http://tjholowaychuk.com" + }, + "bugs": { + "url": "https://github.com/visionmedia/bytes.js/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Jed Watson", + "email": "jed.watson@me.com" + }, + { + "name": "Théo FIDRY", + "email": "theo.fidry@gmail.com" + } + ], + "deprecated": false, + "description": "Utility to parse a string bytes to bytes and vice-versa", + "devDependencies": { + "mocha": "2.5.3", + "nyc": "10.3.2" + }, + "engines": { + "node": ">= 0.8" + }, + "files": [ + "History.md", + "LICENSE", + "Readme.md", + "index.js" + ], + "homepage": "https://github.com/visionmedia/bytes.js#readme", + "keywords": [ + "byte", + "bytes", + "utility", + "parse", + "parser", + "convert", + "converter" + ], + "license": "MIT", + "name": "bytes", + "repository": { + "type": "git", + "url": "git+https://github.com/visionmedia/bytes.js.git" + }, + "scripts": { + "test": "mocha --check-leaks --reporter spec", + "test-ci": "nyc --reporter=text npm test", + "test-cov": "nyc --reporter=html --reporter=text npm test" + }, + "version": "3.0.0" +} diff --git a/node_modules/compress/README.md b/node_modules/compress/README.md new file mode 100644 index 0000000..113adf2 --- /dev/null +++ b/node_modules/compress/README.md @@ -0,0 +1,3 @@ +# compress + +Compress a HTTP message diff --git a/node_modules/compress/index.js b/node_modules/compress/index.js new file mode 100644 index 0000000..e8a1fe9 --- /dev/null +++ b/node_modules/compress/index.js @@ -0,0 +1,10 @@ +/*! + * compress + * MIT Licensed + */ + +/** + * Module exports. + */ + +module.exports = {} diff --git a/node_modules/compress/package.json b/node_modules/compress/package.json new file mode 100644 index 0000000..b42848d --- /dev/null +++ b/node_modules/compress/package.json @@ -0,0 +1,36 @@ +{ + "_from": "compress", + "_id": "compress@0.99.0", + "_inBundle": false, + "_integrity": "sha1-l+MBwlxNAfCX2FED9l7Msud5ZQI=", + "_location": "/compress", + "_phantomChildren": {}, + "_requested": { + "type": "tag", + "registry": true, + "raw": "compress", + "name": "compress", + "escapedName": "compress", + "rawSpec": "", + "saveSpec": null, + "fetchSpec": "latest" + }, + "_requiredBy": [ + "#USER", + "/" + ], + "_resolved": "https://registry.npmjs.org/compress/-/compress-0.99.0.tgz", + "_shasum": "97e301c25c4d01f097d85103f65eccb2e7796502", + "_spec": "compress", + "_where": "/home/martin/dev/multiview", + "author": { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + "bundleDependencies": false, + "deprecated": false, + "description": "Compress a HTTP message", + "license": "MIT", + "name": "compress", + "version": "0.99.0" +} diff --git a/node_modules/compressible/HISTORY.md b/node_modules/compressible/HISTORY.md new file mode 100644 index 0000000..f204ef3 --- /dev/null +++ b/node_modules/compressible/HISTORY.md @@ -0,0 +1,111 @@ +2.0.18 / 2020-01-05 +=================== + + * deps: mime-db@'>= 1.43.0 < 2' + - Mark `font/ttf` as compressible + - Remove compressible from `multipart/mixed` + +2.0.17 / 2019-04-24 +=================== + + * deps: mime-db@'>= 1.40.0 < 2' + +2.0.16 / 2019-02-18 +=================== + + * deps: mime-db@'>= 1.38.0 < 2' + - Mark `text/less` as compressible + +2.0.15 / 2018-09-17 +=================== + + * deps: mime-db@'>= 1.36.0 < 2' + +2.0.14 / 2018-06-05 +=================== + + * deps: mime-db@'>= 1.34.0 < 2' + - Mark all XML-derived types as compressible + +2.0.13 / 2018-02-17 +=================== + + * deps: mime-db@'>= 1.33.0 < 2' + +2.0.12 / 2017-10-20 +=================== + + * deps: mime-db@'>= 1.30.0 < 2' + +2.0.11 / 2017-07-27 +=================== + + * deps: mime-db@'>= 1.29.0 < 2' + +2.0.10 / 2017-03-23 +=================== + + * deps: mime-db@'>= 1.27.0 < 2' + +2.0.9 / 2016-10-31 +================== + + * Fix regex fallback to not override `compressible: false` in db + * deps: mime-db@'>= 1.24.0 < 2' + +2.0.8 / 2016-05-12 +================== + + * deps: mime-db@'>= 1.23.0 < 2' + +2.0.7 / 2016-01-18 +================== + + * deps: mime-db@'>= 1.21.0 < 2' + +2.0.6 / 2015-09-29 +================== + + * deps: mime-db@'>= 1.19.0 < 2' + +2.0.5 / 2015-07-30 +================== + + * deps: mime-db@'>= 1.16.0 < 2' + +2.0.4 / 2015-07-01 +================== + + * deps: mime-db@'>= 1.14.0 < 2' + * perf: enable strict mode + +2.0.3 / 2015-06-08 +================== + + * Fix regex fallback to work if type exists, but is undefined + * perf: hoist regex declaration + * perf: use regex to extract mime + * deps: mime-db@'>= 1.13.0 < 2' + +2.0.2 / 2015-01-31 +================== + + * deps: mime-db@'>= 1.1.2 < 2' + +2.0.1 / 2014-09-28 +================== + + * deps: mime-db@1.x + - Add new mime types + - Add additional compressible + - Update charsets + + +2.0.0 / 2014-09-02 +================== + + * use mime-db + * remove .get() + * specifications are now private + * regex is now private + * stricter regex diff --git a/node_modules/compressible/LICENSE b/node_modules/compressible/LICENSE new file mode 100644 index 0000000..ce00b3f --- /dev/null +++ b/node_modules/compressible/LICENSE @@ -0,0 +1,24 @@ +(The MIT License) + +Copyright (c) 2013 Jonathan Ong +Copyright (c) 2014 Jeremiah Senkpiel +Copyright (c) 2015 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/compressible/README.md b/node_modules/compressible/README.md new file mode 100644 index 0000000..dc86ec0 --- /dev/null +++ b/node_modules/compressible/README.md @@ -0,0 +1,61 @@ +# compressible + +[![NPM Version][npm-version-image]][npm-url] +[![NPM Downloads][npm-downloads-image]][npm-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Compressible `Content-Type` / `mime` checking. + +## Installation + +```sh +$ npm install compressible +``` + +## API + + + +```js +var compressible = require('compressible') +``` + +### compressible(type) + +Checks if the given `Content-Type` is compressible. The `type` argument is expected +to be a value MIME type or `Content-Type` string, though no validation is performed. + +The MIME is looked up in the [`mime-db`](https://www.npmjs.com/package/mime-db) and +if there is compressible information in the database entry, that is returned. Otherwise, +this module will fallback to `true` for the following types: + + * `text/*` + * `*/*+json` + * `*/*+text` + * `*/*+xml` + +If this module is not sure if a type is specifically compressible or specifically +uncompressible, `undefined` is returned. + + + +```js +compressible('text/html') // => true +compressible('image/png') // => false +``` + +## License + +[MIT](LICENSE) + +[coveralls-image]: https://badgen.net/coveralls/c/github/jshttp/compressible/master +[coveralls-url]: https://coveralls.io/r/jshttp/compressible?branch=master +[node-version-image]: https://badgen.net/npm/node/compressible +[node-version-url]: https://nodejs.org/en/download +[npm-downloads-image]: https://badgen.net/npm/dm/compressible +[npm-url]: https://npmjs.org/package/compressible +[npm-version-image]: https://badgen.net/npm/v/compressible +[travis-image]: https://badgen.net/travis/jshttp/compressible/master +[travis-url]: https://travis-ci.org/jshttp/compressible diff --git a/node_modules/compressible/index.js b/node_modules/compressible/index.js new file mode 100644 index 0000000..1184ada --- /dev/null +++ b/node_modules/compressible/index.js @@ -0,0 +1,58 @@ +/*! + * compressible + * Copyright(c) 2013 Jonathan Ong + * Copyright(c) 2014 Jeremiah Senkpiel + * Copyright(c) 2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var db = require('mime-db') + +/** + * Module variables. + * @private + */ + +var COMPRESSIBLE_TYPE_REGEXP = /^text\/|\+(?:json|text|xml)$/i +var EXTRACT_TYPE_REGEXP = /^\s*([^;\s]*)(?:;|\s|$)/ + +/** + * Module exports. + * @public + */ + +module.exports = compressible + +/** + * Checks if a type is compressible. + * + * @param {string} type + * @return {Boolean} compressible + * @public + */ + +function compressible (type) { + if (!type || typeof type !== 'string') { + return false + } + + // strip parameters + var match = EXTRACT_TYPE_REGEXP.exec(type) + var mime = match && match[1].toLowerCase() + var data = db[mime] + + // return database information + if (data && data.compressible !== undefined) { + return data.compressible + } + + // fallback to regexp or unknown + return COMPRESSIBLE_TYPE_REGEXP.test(mime) || undefined +} diff --git a/node_modules/compressible/package.json b/node_modules/compressible/package.json new file mode 100644 index 0000000..45fe9a7 --- /dev/null +++ b/node_modules/compressible/package.json @@ -0,0 +1,91 @@ +{ + "_from": "compressible@~2.0.16", + "_id": "compressible@2.0.18", + "_inBundle": false, + "_integrity": "sha512-AF3r7P5dWxL8MxyITRMlORQNaOA2IkAFaTr4k7BUumjPtRpGDTZpl0Pb1XCO6JeDCBdp126Cgs9sMxqSjgYyRg==", + "_location": "/compressible", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "compressible@~2.0.16", + "name": "compressible", + "escapedName": "compressible", + "rawSpec": "~2.0.16", + "saveSpec": null, + "fetchSpec": "~2.0.16" + }, + "_requiredBy": [ + "/compression" + ], + "_resolved": "https://registry.npmjs.org/compressible/-/compressible-2.0.18.tgz", + "_shasum": "af53cca6b070d4c3c0750fbd77286a6d7cc46fba", + "_spec": "compressible@~2.0.16", + "_where": "/home/martin/dev/multiview/node_modules/compression", + "bugs": { + "url": "https://github.com/jshttp/compressible/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com" + }, + { + "name": "Jeremiah Senkpiel", + "email": "fishrock123@rocketmail.com", + "url": "https://searchbeam.jit.su" + } + ], + "dependencies": { + "mime-db": ">= 1.43.0 < 2" + }, + "deprecated": false, + "description": "Compressible Content-Type / mime checking", + "devDependencies": { + "eslint": "6.8.0", + "eslint-config-standard": "14.1.0", + "eslint-plugin-import": "2.19.1", + "eslint-plugin-markdown": "1.0.1", + "eslint-plugin-node": "11.0.0", + "eslint-plugin-promise": "4.2.1", + "eslint-plugin-standard": "4.0.1", + "mocha": "7.0.0", + "nyc": "15.0.0" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "HISTORY.md", + "LICENSE", + "README.md", + "index.js" + ], + "homepage": "https://github.com/jshttp/compressible#readme", + "keywords": [ + "compress", + "gzip", + "mime", + "content-type" + ], + "license": "MIT", + "name": "compressible", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/compressible.git" + }, + "scripts": { + "lint": "eslint --plugin markdown --ext js,md .", + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-cov": "nyc --reporter=html --reporter=text npm test", + "test-travis": "nyc --reporter=text npm test", + "version": "node scripts/version-history.js && git add HISTORY.md" + }, + "version": "2.0.18" +} diff --git a/node_modules/compression/HISTORY.md b/node_modules/compression/HISTORY.md new file mode 100644 index 0000000..c3e4b92 --- /dev/null +++ b/node_modules/compression/HISTORY.md @@ -0,0 +1,307 @@ +1.7.4 / 2019-03-18 +================== + + * deps: compressible@~2.0.16 + - Mark `text/less` as compressible + - deps: mime-db@'>= 1.38.0 < 2' + * deps: on-headers@~1.0.2 + - Fix `res.writeHead` patch missing return value + * perf: prevent unnecessary buffer copy + +1.7.3 / 2018-07-15 +================== + + * deps: accepts@~1.3.5 + - deps: mime-types@~2.1.18 + * deps: compressible@~2.0.14 + - Mark all XML-derived types as compressible + - deps: mime-db@'>= 1.34.0 < 2' + * deps: safe-buffer@5.1.2 + +1.7.2 / 2018-02-18 +================== + + * deps: compressible@~2.0.13 + - deps: mime-db@'>= 1.33.0 < 2' + +1.7.1 / 2017-09-26 +================== + + * deps: accepts@~1.3.4 + - deps: mime-types@~2.1.16 + * deps: bytes@3.0.0 + * deps: compressible@~2.0.11 + - deps: mime-db@'>= 1.29.0 < 2' + * deps: debug@2.6.9 + * deps: vary@~1.1.2 + - perf: improve header token parsing speed + +1.7.0 / 2017-07-10 +================== + + * Use `safe-buffer` for improved Buffer API + * deps: bytes@2.5.0 + * deps: compressible@~2.0.10 + - Fix regex fallback to not override `compressible: false` in db + - deps: mime-db@'>= 1.27.0 < 2' + * deps: debug@2.6.8 + - Allow colors in workers + - Deprecated `DEBUG_FD` environment variable set to `3` or higher + - Fix error when running under React Native + - Fix `DEBUG_MAX_ARRAY_LENGTH` + - Use same color for same namespace + - deps: ms@2.0.0 + * deps: vary@~1.1.1 + - perf: hoist regular expression + +1.6.2 / 2016-05-12 +================== + + * deps: accepts@~1.3.3 + - deps: mime-types@~2.1.11 + - deps: negotiator@0.6.1 + * deps: bytes@2.3.0 + - Drop partial bytes on all parsed units + - Fix parsing byte string that looks like hex + - perf: hoist regular expressions + * deps: compressible@~2.0.8 + - deps: mime-db@'>= 1.23.0 < 2' + +1.6.1 / 2016-01-19 +================== + + * deps: bytes@2.2.0 + * deps: compressible@~2.0.7 + - deps: mime-db@'>= 1.21.0 < 2' + * deps: accepts@~1.3.1 + - deps: mime-types@~2.1.9 + +1.6.0 / 2015-09-29 +================== + + * Skip compression when response has `Cache-Control: no-transform` + * deps: accepts@~1.3.0 + - deps: mime-types@~2.1.7 + - deps: negotiator@0.6.0 + * deps: compressible@~2.0.6 + - deps: mime-db@'>= 1.19.0 < 2' + * deps: on-headers@~1.0.1 + - perf: enable strict mode + * deps: vary@~1.1.0 + - Only accept valid field names in the `field` argument + +1.5.2 / 2015-07-30 +================== + + * deps: accepts@~1.2.12 + - deps: mime-types@~2.1.4 + * deps: compressible@~2.0.5 + - deps: mime-db@'>= 1.16.0 < 2' + * deps: vary@~1.0.1 + - Fix setting empty header from empty `field` + - perf: enable strict mode + - perf: remove argument reassignments + +1.5.1 / 2015-07-05 +================== + + * deps: accepts@~1.2.10 + - deps: mime-types@~2.1.2 + * deps: compressible@~2.0.4 + - deps: mime-db@'>= 1.14.0 < 2' + - perf: enable strict mode + +1.5.0 / 2015-06-09 +================== + + * Fix return value from `.end` and `.write` after end + * Improve detection of zero-length body without `Content-Length` + * deps: accepts@~1.2.9 + - deps: mime-types@~2.1.1 + - perf: avoid argument reassignment & argument slice + - perf: avoid negotiator recursive construction + - perf: enable strict mode + - perf: remove unnecessary bitwise operator + * deps: bytes@2.1.0 + - Slight optimizations + - Units no longer case sensitive when parsing + * deps: compressible@~2.0.3 + - Fix regex fallback to work if type exists, but is undefined + - deps: mime-db@'>= 1.13.0 < 2' + - perf: hoist regex declaration + - perf: use regex to extract mime + * perf: enable strict mode + * perf: remove flush reassignment + * perf: simplify threshold detection + +1.4.4 / 2015-05-11 +================== + + * deps: accepts@~1.2.7 + - deps: mime-types@~2.0.11 + - deps: negotiator@0.5.3 + * deps: debug@~2.2.0 + - deps: ms@0.7.1 + +1.4.3 / 2015-03-14 +================== + + * deps: accepts@~1.2.5 + - deps: mime-types@~2.0.10 + * deps: debug@~2.1.3 + - Fix high intensity foreground color for bold + - deps: ms@0.7.0 + +1.4.2 / 2015-03-11 +================== + + * Fix error when code calls `res.end(str, encoding)` + - Specific to Node.js 0.8 + * deps: debug@~2.1.2 + - deps: ms@0.7.0 + +1.4.1 / 2015-02-15 +================== + + * deps: accepts@~1.2.4 + - deps: mime-types@~2.0.9 + - deps: negotiator@0.5.1 + +1.4.0 / 2015-02-01 +================== + + * Prefer `gzip` over `deflate` on the server + - Not all clients agree on what "deflate" coding means + +1.3.1 / 2015-01-31 +================== + + * deps: accepts@~1.2.3 + - deps: mime-types@~2.0.8 + * deps: compressible@~2.0.2 + - deps: mime-db@'>= 1.1.2 < 2' + +1.3.0 / 2014-12-30 +================== + + * Export the default `filter` function for wrapping + * deps: accepts@~1.2.2 + - deps: mime-types@~2.0.7 + - deps: negotiator@0.5.0 + * deps: debug@~2.1.1 + +1.2.2 / 2014-12-10 +================== + + * Fix `.end` to only proxy to `.end` + - Fixes an issue with Node.js 0.11.14 + * deps: accepts@~1.1.4 + - deps: mime-types@~2.0.4 + +1.2.1 / 2014-11-23 +================== + + * deps: accepts@~1.1.3 + - deps: mime-types@~2.0.3 + +1.2.0 / 2014-10-16 +================== + + * deps: debug@~2.1.0 + - Implement `DEBUG_FD` env variable support + +1.1.2 / 2014-10-15 +================== + + * deps: accepts@~1.1.2 + - Fix error when media type has invalid parameter + - deps: negotiator@0.4.9 + +1.1.1 / 2014-10-12 +================== + + * deps: accepts@~1.1.1 + - deps: mime-types@~2.0.2 + - deps: negotiator@0.4.8 + * deps: compressible@~2.0.1 + - deps: mime-db@1.x + +1.1.0 / 2014-09-07 +================== + + * deps: accepts@~1.1.0 + * deps: compressible@~2.0.0 + * deps: debug@~2.0.0 + +1.0.11 / 2014-08-10 +=================== + + * deps: on-headers@~1.0.0 + * deps: vary@~1.0.0 + +1.0.10 / 2014-08-05 +=================== + + * deps: compressible@~1.1.1 + - Fix upper-case Content-Type characters prevent compression + +1.0.9 / 2014-07-20 +================== + + * Add `debug` messages + * deps: accepts@~1.0.7 + - deps: negotiator@0.4.7 + +1.0.8 / 2014-06-20 +================== + + * deps: accepts@~1.0.5 + - use `mime-types` + +1.0.7 / 2014-06-11 +================== + + * use vary module for better `Vary` behavior + * deps: accepts@1.0.3 + * deps: compressible@1.1.0 + +1.0.6 / 2014-06-03 +================== + + * fix regression when negotiation fails + +1.0.5 / 2014-06-03 +================== + + * fix listeners for delayed stream creation + - fixes regression for certain `stream.pipe(res)` situations + +1.0.4 / 2014-06-03 +================== + + * fix adding `Vary` when value stored as array + * fix back-pressure behavior + * fix length check for `res.end` + +1.0.3 / 2014-05-29 +================== + + * use `accepts` for negotiation + * use `on-headers` to handle header checking + * deps: bytes@1.0.0 + +1.0.2 / 2014-04-29 +================== + + * only version compatible with node.js 0.8 + * support headers given to `res.writeHead` + * deps: bytes@0.3.0 + * deps: negotiator@0.4.3 + +1.0.1 / 2014-03-08 +================== + + * bump negotiator + * use compressible + * use .headersSent (drops 0.8 support) + * handle identity;q=0 case diff --git a/node_modules/compression/LICENSE b/node_modules/compression/LICENSE new file mode 100644 index 0000000..386b7b6 --- /dev/null +++ b/node_modules/compression/LICENSE @@ -0,0 +1,23 @@ +(The MIT License) + +Copyright (c) 2014 Jonathan Ong +Copyright (c) 2014-2015 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/compression/README.md b/node_modules/compression/README.md new file mode 100644 index 0000000..680ece8 --- /dev/null +++ b/node_modules/compression/README.md @@ -0,0 +1,240 @@ +# compression + +[![NPM Version][npm-image]][npm-url] +[![NPM Downloads][downloads-image]][downloads-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +Node.js compression middleware. + +The following compression codings are supported: + + - deflate + - gzip + +## Install + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```bash +$ npm install compression +``` + +## API + + + +```js +var compression = require('compression') +``` + +### compression([options]) + +Returns the compression middleware using the given `options`. The middleware +will attempt to compress response bodies for all request that traverse through +the middleware, based on the given `options`. + +This middleware will never compress responses that include a `Cache-Control` +header with the [`no-transform` directive](https://tools.ietf.org/html/rfc7234#section-5.2.2.4), +as compressing will transform the body. + +#### Options + +`compression()` accepts these properties in the options object. In addition to +those listed below, [zlib](http://nodejs.org/api/zlib.html) options may be +passed in to the options object. + +##### chunkSize + +The default value is `zlib.Z_DEFAULT_CHUNK`, or `16384`. + +See [Node.js documentation](http://nodejs.org/api/zlib.html#zlib_memory_usage_tuning) +regarding the usage. + +##### filter + +A function to decide if the response should be considered for compression. +This function is called as `filter(req, res)` and is expected to return +`true` to consider the response for compression, or `false` to not compress +the response. + +The default filter function uses the [compressible](https://www.npmjs.com/package/compressible) +module to determine if `res.getHeader('Content-Type')` is compressible. + +##### level + +The level of zlib compression to apply to responses. A higher level will result +in better compression, but will take longer to complete. A lower level will +result in less compression, but will be much faster. + +This is an integer in the range of `0` (no compression) to `9` (maximum +compression). The special value `-1` can be used to mean the "default +compression level", which is a default compromise between speed and +compression (currently equivalent to level 6). + + - `-1` Default compression level (also `zlib.Z_DEFAULT_COMPRESSION`). + - `0` No compression (also `zlib.Z_NO_COMPRESSION`). + - `1` Fastest compression (also `zlib.Z_BEST_SPEED`). + - `2` + - `3` + - `4` + - `5` + - `6` (currently what `zlib.Z_DEFAULT_COMPRESSION` points to). + - `7` + - `8` + - `9` Best compression (also `zlib.Z_BEST_COMPRESSION`). + +The default value is `zlib.Z_DEFAULT_COMPRESSION`, or `-1`. + +**Note** in the list above, `zlib` is from `zlib = require('zlib')`. + +##### memLevel + +This specifies how much memory should be allocated for the internal compression +state and is an integer in the range of `1` (minimum level) and `9` (maximum +level). + +The default value is `zlib.Z_DEFAULT_MEMLEVEL`, or `8`. + +See [Node.js documentation](http://nodejs.org/api/zlib.html#zlib_memory_usage_tuning) +regarding the usage. + +##### strategy + +This is used to tune the compression algorithm. This value only affects the +compression ratio, not the correctness of the compressed output, even if it +is not set appropriately. + + - `zlib.Z_DEFAULT_STRATEGY` Use for normal data. + - `zlib.Z_FILTERED` Use for data produced by a filter (or predictor). + Filtered data consists mostly of small values with a somewhat random + distribution. In this case, the compression algorithm is tuned to + compress them better. The effect is to force more Huffman coding and less + string matching; it is somewhat intermediate between `zlib.Z_DEFAULT_STRATEGY` + and `zlib.Z_HUFFMAN_ONLY`. + - `zlib.Z_FIXED` Use to prevent the use of dynamic Huffman codes, allowing + for a simpler decoder for special applications. + - `zlib.Z_HUFFMAN_ONLY` Use to force Huffman encoding only (no string match). + - `zlib.Z_RLE` Use to limit match distances to one (run-length encoding). + This is designed to be almost as fast as `zlib.Z_HUFFMAN_ONLY`, but give + better compression for PNG image data. + +**Note** in the list above, `zlib` is from `zlib = require('zlib')`. + +##### threshold + +The byte threshold for the response body size before compression is considered +for the response, defaults to `1kb`. This is a number of bytes or any string +accepted by the [bytes](https://www.npmjs.com/package/bytes) module. + +**Note** this is only an advisory setting; if the response size cannot be determined +at the time the response headers are written, then it is assumed the response is +_over_ the threshold. To guarantee the response size can be determined, be sure +set a `Content-Length` response header. + +##### windowBits + +The default value is `zlib.Z_DEFAULT_WINDOWBITS`, or `15`. + +See [Node.js documentation](http://nodejs.org/api/zlib.html#zlib_memory_usage_tuning) +regarding the usage. + +#### .filter + +The default `filter` function. This is used to construct a custom filter +function that is an extension of the default function. + +```js +var compression = require('compression') +var express = require('express') + +var app = express() +app.use(compression({ filter: shouldCompress })) + +function shouldCompress (req, res) { + if (req.headers['x-no-compression']) { + // don't compress responses with this request header + return false + } + + // fallback to standard filter function + return compression.filter(req, res) +} +``` + +### res.flush + +This module adds a `res.flush()` method to force the partially-compressed +response to be flushed to the client. + +## Examples + +### express/connect + +When using this module with express or connect, simply `app.use` the module as +high as you like. Requests that pass through the middleware will be compressed. + +```js +var compression = require('compression') +var express = require('express') + +var app = express() + +// compress all responses +app.use(compression()) + +// add all routes +``` + +### Server-Sent Events + +Because of the nature of compression this module does not work out of the box +with server-sent events. To compress content, a window of the output needs to +be buffered up in order to get good compression. Typically when using server-sent +events, there are certain block of data that need to reach the client. + +You can achieve this by calling `res.flush()` when you need the data written to +actually make it to the client. + +```js +var compression = require('compression') +var express = require('express') + +var app = express() + +// compress responses +app.use(compression()) + +// server-sent event stream +app.get('/events', function (req, res) { + res.setHeader('Content-Type', 'text/event-stream') + res.setHeader('Cache-Control', 'no-cache') + + // send a ping approx every 2 seconds + var timer = setInterval(function () { + res.write('data: ping\n\n') + + // !!! this is the important part + res.flush() + }, 2000) + + res.on('close', function () { + clearInterval(timer) + }) +}) +``` + +## License + +[MIT](LICENSE) + +[npm-image]: https://img.shields.io/npm/v/compression.svg +[npm-url]: https://npmjs.org/package/compression +[travis-image]: https://img.shields.io/travis/expressjs/compression/master.svg +[travis-url]: https://travis-ci.org/expressjs/compression +[coveralls-image]: https://img.shields.io/coveralls/expressjs/compression/master.svg +[coveralls-url]: https://coveralls.io/r/expressjs/compression?branch=master +[downloads-image]: https://img.shields.io/npm/dm/compression.svg +[downloads-url]: https://npmjs.org/package/compression diff --git a/node_modules/compression/index.js b/node_modules/compression/index.js new file mode 100644 index 0000000..1d08942 --- /dev/null +++ b/node_modules/compression/index.js @@ -0,0 +1,288 @@ +/*! + * compression + * Copyright(c) 2010 Sencha Inc. + * Copyright(c) 2011 TJ Holowaychuk + * Copyright(c) 2014 Jonathan Ong + * Copyright(c) 2014-2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var accepts = require('accepts') +var Buffer = require('safe-buffer').Buffer +var bytes = require('bytes') +var compressible = require('compressible') +var debug = require('debug')('compression') +var onHeaders = require('on-headers') +var vary = require('vary') +var zlib = require('zlib') + +/** + * Module exports. + */ + +module.exports = compression +module.exports.filter = shouldCompress + +/** + * Module variables. + * @private + */ + +var cacheControlNoTransformRegExp = /(?:^|,)\s*?no-transform\s*?(?:,|$)/ + +/** + * Compress response data with gzip / deflate. + * + * @param {Object} [options] + * @return {Function} middleware + * @public + */ + +function compression (options) { + var opts = options || {} + + // options + var filter = opts.filter || shouldCompress + var threshold = bytes.parse(opts.threshold) + + if (threshold == null) { + threshold = 1024 + } + + return function compression (req, res, next) { + var ended = false + var length + var listeners = [] + var stream + + var _end = res.end + var _on = res.on + var _write = res.write + + // flush + res.flush = function flush () { + if (stream) { + stream.flush() + } + } + + // proxy + + res.write = function write (chunk, encoding) { + if (ended) { + return false + } + + if (!this._header) { + this._implicitHeader() + } + + return stream + ? stream.write(toBuffer(chunk, encoding)) + : _write.call(this, chunk, encoding) + } + + res.end = function end (chunk, encoding) { + if (ended) { + return false + } + + if (!this._header) { + // estimate the length + if (!this.getHeader('Content-Length')) { + length = chunkLength(chunk, encoding) + } + + this._implicitHeader() + } + + if (!stream) { + return _end.call(this, chunk, encoding) + } + + // mark ended + ended = true + + // write Buffer for Node.js 0.8 + return chunk + ? stream.end(toBuffer(chunk, encoding)) + : stream.end() + } + + res.on = function on (type, listener) { + if (!listeners || type !== 'drain') { + return _on.call(this, type, listener) + } + + if (stream) { + return stream.on(type, listener) + } + + // buffer listeners for future stream + listeners.push([type, listener]) + + return this + } + + function nocompress (msg) { + debug('no compression: %s', msg) + addListeners(res, _on, listeners) + listeners = null + } + + onHeaders(res, function onResponseHeaders () { + // determine if request is filtered + if (!filter(req, res)) { + nocompress('filtered') + return + } + + // determine if the entity should be transformed + if (!shouldTransform(req, res)) { + nocompress('no transform') + return + } + + // vary + vary(res, 'Accept-Encoding') + + // content-length below threshold + if (Number(res.getHeader('Content-Length')) < threshold || length < threshold) { + nocompress('size below threshold') + return + } + + var encoding = res.getHeader('Content-Encoding') || 'identity' + + // already encoded + if (encoding !== 'identity') { + nocompress('already encoded') + return + } + + // head + if (req.method === 'HEAD') { + nocompress('HEAD request') + return + } + + // compression method + var accept = accepts(req) + var method = accept.encoding(['gzip', 'deflate', 'identity']) + + // we really don't prefer deflate + if (method === 'deflate' && accept.encoding(['gzip'])) { + method = accept.encoding(['gzip', 'identity']) + } + + // negotiation failed + if (!method || method === 'identity') { + nocompress('not acceptable') + return + } + + // compression stream + debug('%s compression', method) + stream = method === 'gzip' + ? zlib.createGzip(opts) + : zlib.createDeflate(opts) + + // add buffered listeners to stream + addListeners(stream, stream.on, listeners) + + // header fields + res.setHeader('Content-Encoding', method) + res.removeHeader('Content-Length') + + // compression + stream.on('data', function onStreamData (chunk) { + if (_write.call(res, chunk) === false) { + stream.pause() + } + }) + + stream.on('end', function onStreamEnd () { + _end.call(res) + }) + + _on.call(res, 'drain', function onResponseDrain () { + stream.resume() + }) + }) + + next() + } +} + +/** + * Add bufferred listeners to stream + * @private + */ + +function addListeners (stream, on, listeners) { + for (var i = 0; i < listeners.length; i++) { + on.apply(stream, listeners[i]) + } +} + +/** + * Get the length of a given chunk + */ + +function chunkLength (chunk, encoding) { + if (!chunk) { + return 0 + } + + return !Buffer.isBuffer(chunk) + ? Buffer.byteLength(chunk, encoding) + : chunk.length +} + +/** + * Default filter function. + * @private + */ + +function shouldCompress (req, res) { + var type = res.getHeader('Content-Type') + + if (type === undefined || !compressible(type)) { + debug('%s not compressible', type) + return false + } + + return true +} + +/** + * Determine if the entity should be transformed. + * @private + */ + +function shouldTransform (req, res) { + var cacheControl = res.getHeader('Cache-Control') + + // Don't compress for Cache-Control: no-transform + // https://tools.ietf.org/html/rfc7234#section-5.2.2.4 + return !cacheControl || + !cacheControlNoTransformRegExp.test(cacheControl) +} + +/** + * Coerce arguments to Buffer + * @private + */ + +function toBuffer (chunk, encoding) { + return !Buffer.isBuffer(chunk) + ? Buffer.from(chunk, encoding) + : chunk +} diff --git a/node_modules/compression/package.json b/node_modules/compression/package.json new file mode 100644 index 0000000..113e609 --- /dev/null +++ b/node_modules/compression/package.json @@ -0,0 +1,87 @@ +{ + "_from": "compression", + "_id": "compression@1.7.4", + "_inBundle": false, + "_integrity": "sha512-jaSIDzP9pZVS4ZfQ+TzvtiWhdpFhE2RDHz8QJkpX9SIpLq88VueF5jJw6t+6CUQcAoA6t+x89MLrWAqpfDE8iQ==", + "_location": "/compression", + "_phantomChildren": {}, + "_requested": { + "type": "tag", + "registry": true, + "raw": "compression", + "name": "compression", + "escapedName": "compression", + "rawSpec": "", + "saveSpec": null, + "fetchSpec": "latest" + }, + "_requiredBy": [ + "#USER", + "/" + ], + "_resolved": "https://registry.npmjs.org/compression/-/compression-1.7.4.tgz", + "_shasum": "95523eff170ca57c29a0ca41e6fe131f41e5bb8f", + "_spec": "compression", + "_where": "/home/martin/dev/multiview", + "bugs": { + "url": "https://github.com/expressjs/compression/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com" + } + ], + "dependencies": { + "accepts": "~1.3.5", + "bytes": "3.0.0", + "compressible": "~2.0.16", + "debug": "2.6.9", + "on-headers": "~1.0.2", + "safe-buffer": "5.1.2", + "vary": "~1.1.2" + }, + "deprecated": false, + "description": "Node.js compression middleware", + "devDependencies": { + "after": "0.8.2", + "eslint": "5.15.1", + "eslint-config-standard": "12.0.0", + "eslint-plugin-import": "2.16.0", + "eslint-plugin-markdown": "1.0.0", + "eslint-plugin-node": "7.0.1", + "eslint-plugin-promise": "4.0.1", + "eslint-plugin-standard": "4.0.0", + "istanbul": "0.4.5", + "mocha": "6.0.2", + "supertest": "4.0.0" + }, + "engines": { + "node": ">= 0.8.0" + }, + "files": [ + "LICENSE", + "HISTORY.md", + "index.js" + ], + "homepage": "https://github.com/expressjs/compression#readme", + "license": "MIT", + "name": "compression", + "repository": { + "type": "git", + "url": "git+https://github.com/expressjs/compression.git" + }, + "scripts": { + "lint": "eslint --plugin markdown --ext js,md .", + "test": "mocha --check-leaks --reporter spec --bail", + "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --check-leaks --reporter dot", + "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --check-leaks --reporter spec" + }, + "version": "1.7.4" +} diff --git a/node_modules/debug/.coveralls.yml b/node_modules/debug/.coveralls.yml new file mode 100644 index 0000000..20a7068 --- /dev/null +++ b/node_modules/debug/.coveralls.yml @@ -0,0 +1 @@ +repo_token: SIAeZjKYlHK74rbcFvNHMUzjRiMpflxve diff --git a/node_modules/debug/.eslintrc b/node_modules/debug/.eslintrc new file mode 100644 index 0000000..8a37ae2 --- /dev/null +++ b/node_modules/debug/.eslintrc @@ -0,0 +1,11 @@ +{ + "env": { + "browser": true, + "node": true + }, + "rules": { + "no-console": 0, + "no-empty": [1, { "allowEmptyCatch": true }] + }, + "extends": "eslint:recommended" +} diff --git a/node_modules/debug/.npmignore b/node_modules/debug/.npmignore new file mode 100644 index 0000000..5f60eec --- /dev/null +++ b/node_modules/debug/.npmignore @@ -0,0 +1,9 @@ +support +test +examples +example +*.sock +dist +yarn.lock +coverage +bower.json diff --git a/node_modules/debug/.travis.yml b/node_modules/debug/.travis.yml new file mode 100644 index 0000000..6c6090c --- /dev/null +++ b/node_modules/debug/.travis.yml @@ -0,0 +1,14 @@ + +language: node_js +node_js: + - "6" + - "5" + - "4" + +install: + - make node_modules + +script: + - make lint + - make test + - make coveralls diff --git a/node_modules/debug/CHANGELOG.md b/node_modules/debug/CHANGELOG.md new file mode 100644 index 0000000..eadaa18 --- /dev/null +++ b/node_modules/debug/CHANGELOG.md @@ -0,0 +1,362 @@ + +2.6.9 / 2017-09-22 +================== + + * remove ReDoS regexp in %o formatter (#504) + +2.6.8 / 2017-05-18 +================== + + * Fix: Check for undefined on browser globals (#462, @marbemac) + +2.6.7 / 2017-05-16 +================== + + * Fix: Update ms to 2.0.0 to fix regular expression denial of service vulnerability (#458, @hubdotcom) + * Fix: Inline extend function in node implementation (#452, @dougwilson) + * Docs: Fix typo (#455, @msasad) + +2.6.5 / 2017-04-27 +================== + + * Fix: null reference check on window.documentElement.style.WebkitAppearance (#447, @thebigredgeek) + * Misc: clean up browser reference checks (#447, @thebigredgeek) + * Misc: add npm-debug.log to .gitignore (@thebigredgeek) + + +2.6.4 / 2017-04-20 +================== + + * Fix: bug that would occure if process.env.DEBUG is a non-string value. (#444, @LucianBuzzo) + * Chore: ignore bower.json in npm installations. (#437, @joaovieira) + * Misc: update "ms" to v0.7.3 (@tootallnate) + +2.6.3 / 2017-03-13 +================== + + * Fix: Electron reference to `process.env.DEBUG` (#431, @paulcbetts) + * Docs: Changelog fix (@thebigredgeek) + +2.6.2 / 2017-03-10 +================== + + * Fix: DEBUG_MAX_ARRAY_LENGTH (#420, @slavaGanzin) + * Docs: Add backers and sponsors from Open Collective (#422, @piamancini) + * Docs: Add Slackin invite badge (@tootallnate) + +2.6.1 / 2017-02-10 +================== + + * Fix: Module's `export default` syntax fix for IE8 `Expected identifier` error + * Fix: Whitelist DEBUG_FD for values 1 and 2 only (#415, @pi0) + * Fix: IE8 "Expected identifier" error (#414, @vgoma) + * Fix: Namespaces would not disable once enabled (#409, @musikov) + +2.6.0 / 2016-12-28 +================== + + * Fix: added better null pointer checks for browser useColors (@thebigredgeek) + * Improvement: removed explicit `window.debug` export (#404, @tootallnate) + * Improvement: deprecated `DEBUG_FD` environment variable (#405, @tootallnate) + +2.5.2 / 2016-12-25 +================== + + * Fix: reference error on window within webworkers (#393, @KlausTrainer) + * Docs: fixed README typo (#391, @lurch) + * Docs: added notice about v3 api discussion (@thebigredgeek) + +2.5.1 / 2016-12-20 +================== + + * Fix: babel-core compatibility + +2.5.0 / 2016-12-20 +================== + + * Fix: wrong reference in bower file (@thebigredgeek) + * Fix: webworker compatibility (@thebigredgeek) + * Fix: output formatting issue (#388, @kribblo) + * Fix: babel-loader compatibility (#383, @escwald) + * Misc: removed built asset from repo and publications (@thebigredgeek) + * Misc: moved source files to /src (#378, @yamikuronue) + * Test: added karma integration and replaced babel with browserify for browser tests (#378, @yamikuronue) + * Test: coveralls integration (#378, @yamikuronue) + * Docs: simplified language in the opening paragraph (#373, @yamikuronue) + +2.4.5 / 2016-12-17 +================== + + * Fix: `navigator` undefined in Rhino (#376, @jochenberger) + * Fix: custom log function (#379, @hsiliev) + * Improvement: bit of cleanup + linting fixes (@thebigredgeek) + * Improvement: rm non-maintainted `dist/` dir (#375, @freewil) + * Docs: simplified language in the opening paragraph. (#373, @yamikuronue) + +2.4.4 / 2016-12-14 +================== + + * Fix: work around debug being loaded in preload scripts for electron (#368, @paulcbetts) + +2.4.3 / 2016-12-14 +================== + + * Fix: navigation.userAgent error for react native (#364, @escwald) + +2.4.2 / 2016-12-14 +================== + + * Fix: browser colors (#367, @tootallnate) + * Misc: travis ci integration (@thebigredgeek) + * Misc: added linting and testing boilerplate with sanity check (@thebigredgeek) + +2.4.1 / 2016-12-13 +================== + + * Fix: typo that broke the package (#356) + +2.4.0 / 2016-12-13 +================== + + * Fix: bower.json references unbuilt src entry point (#342, @justmatt) + * Fix: revert "handle regex special characters" (@tootallnate) + * Feature: configurable util.inspect()`options for NodeJS (#327, @tootallnate) + * Feature: %O`(big O) pretty-prints objects (#322, @tootallnate) + * Improvement: allow colors in workers (#335, @botverse) + * Improvement: use same color for same namespace. (#338, @lchenay) + +2.3.3 / 2016-11-09 +================== + + * Fix: Catch `JSON.stringify()` errors (#195, Jovan Alleyne) + * Fix: Returning `localStorage` saved values (#331, Levi Thomason) + * Improvement: Don't create an empty object when no `process` (Nathan Rajlich) + +2.3.2 / 2016-11-09 +================== + + * Fix: be super-safe in index.js as well (@TooTallNate) + * Fix: should check whether process exists (Tom Newby) + +2.3.1 / 2016-11-09 +================== + + * Fix: Added electron compatibility (#324, @paulcbetts) + * Improvement: Added performance optimizations (@tootallnate) + * Readme: Corrected PowerShell environment variable example (#252, @gimre) + * Misc: Removed yarn lock file from source control (#321, @fengmk2) + +2.3.0 / 2016-11-07 +================== + + * Fix: Consistent placement of ms diff at end of output (#215, @gorangajic) + * Fix: Escaping of regex special characters in namespace strings (#250, @zacronos) + * Fix: Fixed bug causing crash on react-native (#282, @vkarpov15) + * Feature: Enabled ES6+ compatible import via default export (#212 @bucaran) + * Feature: Added %O formatter to reflect Chrome's console.log capability (#279, @oncletom) + * Package: Update "ms" to 0.7.2 (#315, @DevSide) + * Package: removed superfluous version property from bower.json (#207 @kkirsche) + * Readme: fix USE_COLORS to DEBUG_COLORS + * Readme: Doc fixes for format string sugar (#269, @mlucool) + * Readme: Updated docs for DEBUG_FD and DEBUG_COLORS environment variables (#232, @mattlyons0) + * Readme: doc fixes for PowerShell (#271 #243, @exoticknight @unreadable) + * Readme: better docs for browser support (#224, @matthewmueller) + * Tooling: Added yarn integration for development (#317, @thebigredgeek) + * Misc: Renamed History.md to CHANGELOG.md (@thebigredgeek) + * Misc: Added license file (#226 #274, @CantemoInternal @sdaitzman) + * Misc: Updated contributors (@thebigredgeek) + +2.2.0 / 2015-05-09 +================== + + * package: update "ms" to v0.7.1 (#202, @dougwilson) + * README: add logging to file example (#193, @DanielOchoa) + * README: fixed a typo (#191, @amir-s) + * browser: expose `storage` (#190, @stephenmathieson) + * Makefile: add a `distclean` target (#189, @stephenmathieson) + +2.1.3 / 2015-03-13 +================== + + * Updated stdout/stderr example (#186) + * Updated example/stdout.js to match debug current behaviour + * Renamed example/stderr.js to stdout.js + * Update Readme.md (#184) + * replace high intensity foreground color for bold (#182, #183) + +2.1.2 / 2015-03-01 +================== + + * dist: recompile + * update "ms" to v0.7.0 + * package: update "browserify" to v9.0.3 + * component: fix "ms.js" repo location + * changed bower package name + * updated documentation about using debug in a browser + * fix: security error on safari (#167, #168, @yields) + +2.1.1 / 2014-12-29 +================== + + * browser: use `typeof` to check for `console` existence + * browser: check for `console.log` truthiness (fix IE 8/9) + * browser: add support for Chrome apps + * Readme: added Windows usage remarks + * Add `bower.json` to properly support bower install + +2.1.0 / 2014-10-15 +================== + + * node: implement `DEBUG_FD` env variable support + * package: update "browserify" to v6.1.0 + * package: add "license" field to package.json (#135, @panuhorsmalahti) + +2.0.0 / 2014-09-01 +================== + + * package: update "browserify" to v5.11.0 + * node: use stderr rather than stdout for logging (#29, @stephenmathieson) + +1.0.4 / 2014-07-15 +================== + + * dist: recompile + * example: remove `console.info()` log usage + * example: add "Content-Type" UTF-8 header to browser example + * browser: place %c marker after the space character + * browser: reset the "content" color via `color: inherit` + * browser: add colors support for Firefox >= v31 + * debug: prefer an instance `log()` function over the global one (#119) + * Readme: update documentation about styled console logs for FF v31 (#116, @wryk) + +1.0.3 / 2014-07-09 +================== + + * Add support for multiple wildcards in namespaces (#122, @seegno) + * browser: fix lint + +1.0.2 / 2014-06-10 +================== + + * browser: update color palette (#113, @gscottolson) + * common: make console logging function configurable (#108, @timoxley) + * node: fix %o colors on old node <= 0.8.x + * Makefile: find node path using shell/which (#109, @timoxley) + +1.0.1 / 2014-06-06 +================== + + * browser: use `removeItem()` to clear localStorage + * browser, node: don't set DEBUG if namespaces is undefined (#107, @leedm777) + * package: add "contributors" section + * node: fix comment typo + * README: list authors + +1.0.0 / 2014-06-04 +================== + + * make ms diff be global, not be scope + * debug: ignore empty strings in enable() + * node: make DEBUG_COLORS able to disable coloring + * *: export the `colors` array + * npmignore: don't publish the `dist` dir + * Makefile: refactor to use browserify + * package: add "browserify" as a dev dependency + * Readme: add Web Inspector Colors section + * node: reset terminal color for the debug content + * node: map "%o" to `util.inspect()` + * browser: map "%j" to `JSON.stringify()` + * debug: add custom "formatters" + * debug: use "ms" module for humanizing the diff + * Readme: add "bash" syntax highlighting + * browser: add Firebug color support + * browser: add colors for WebKit browsers + * node: apply log to `console` + * rewrite: abstract common logic for Node & browsers + * add .jshintrc file + +0.8.1 / 2014-04-14 +================== + + * package: re-add the "component" section + +0.8.0 / 2014-03-30 +================== + + * add `enable()` method for nodejs. Closes #27 + * change from stderr to stdout + * remove unnecessary index.js file + +0.7.4 / 2013-11-13 +================== + + * remove "browserify" key from package.json (fixes something in browserify) + +0.7.3 / 2013-10-30 +================== + + * fix: catch localStorage security error when cookies are blocked (Chrome) + * add debug(err) support. Closes #46 + * add .browser prop to package.json. Closes #42 + +0.7.2 / 2013-02-06 +================== + + * fix package.json + * fix: Mobile Safari (private mode) is broken with debug + * fix: Use unicode to send escape character to shell instead of octal to work with strict mode javascript + +0.7.1 / 2013-02-05 +================== + + * add repository URL to package.json + * add DEBUG_COLORED to force colored output + * add browserify support + * fix component. Closes #24 + +0.7.0 / 2012-05-04 +================== + + * Added .component to package.json + * Added debug.component.js build + +0.6.0 / 2012-03-16 +================== + + * Added support for "-" prefix in DEBUG [Vinay Pulim] + * Added `.enabled` flag to the node version [TooTallNate] + +0.5.0 / 2012-02-02 +================== + + * Added: humanize diffs. Closes #8 + * Added `debug.disable()` to the CS variant + * Removed padding. Closes #10 + * Fixed: persist client-side variant again. Closes #9 + +0.4.0 / 2012-02-01 +================== + + * Added browser variant support for older browsers [TooTallNate] + * Added `debug.enable('project:*')` to browser variant [TooTallNate] + * Added padding to diff (moved it to the right) + +0.3.0 / 2012-01-26 +================== + + * Added millisecond diff when isatty, otherwise UTC string + +0.2.0 / 2012-01-22 +================== + + * Added wildcard support + +0.1.0 / 2011-12-02 +================== + + * Added: remove colors unless stderr isatty [TooTallNate] + +0.0.1 / 2010-01-03 +================== + + * Initial release diff --git a/node_modules/debug/LICENSE b/node_modules/debug/LICENSE new file mode 100644 index 0000000..658c933 --- /dev/null +++ b/node_modules/debug/LICENSE @@ -0,0 +1,19 @@ +(The MIT License) + +Copyright (c) 2014 TJ Holowaychuk + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software +and associated documentation files (the 'Software'), to deal in the Software without restriction, +including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, +and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, +subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial +portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT +LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + diff --git a/node_modules/debug/Makefile b/node_modules/debug/Makefile new file mode 100644 index 0000000..584da8b --- /dev/null +++ b/node_modules/debug/Makefile @@ -0,0 +1,50 @@ +# get Makefile directory name: http://stackoverflow.com/a/5982798/376773 +THIS_MAKEFILE_PATH:=$(word $(words $(MAKEFILE_LIST)),$(MAKEFILE_LIST)) +THIS_DIR:=$(shell cd $(dir $(THIS_MAKEFILE_PATH));pwd) + +# BIN directory +BIN := $(THIS_DIR)/node_modules/.bin + +# Path +PATH := node_modules/.bin:$(PATH) +SHELL := /bin/bash + +# applications +NODE ?= $(shell which node) +YARN ?= $(shell which yarn) +PKG ?= $(if $(YARN),$(YARN),$(NODE) $(shell which npm)) +BROWSERIFY ?= $(NODE) $(BIN)/browserify + +.FORCE: + +install: node_modules + +node_modules: package.json + @NODE_ENV= $(PKG) install + @touch node_modules + +lint: .FORCE + eslint browser.js debug.js index.js node.js + +test-node: .FORCE + istanbul cover node_modules/mocha/bin/_mocha -- test/**.js + +test-browser: .FORCE + mkdir -p dist + + @$(BROWSERIFY) \ + --standalone debug \ + . > dist/debug.js + + karma start --single-run + rimraf dist + +test: .FORCE + concurrently \ + "make test-node" \ + "make test-browser" + +coveralls: + cat ./coverage/lcov.info | ./node_modules/coveralls/bin/coveralls.js + +.PHONY: all install clean distclean diff --git a/node_modules/debug/README.md b/node_modules/debug/README.md new file mode 100644 index 0000000..f67be6b --- /dev/null +++ b/node_modules/debug/README.md @@ -0,0 +1,312 @@ +# debug +[![Build Status](https://travis-ci.org/visionmedia/debug.svg?branch=master)](https://travis-ci.org/visionmedia/debug) [![Coverage Status](https://coveralls.io/repos/github/visionmedia/debug/badge.svg?branch=master)](https://coveralls.io/github/visionmedia/debug?branch=master) [![Slack](https://visionmedia-community-slackin.now.sh/badge.svg)](https://visionmedia-community-slackin.now.sh/) [![OpenCollective](https://opencollective.com/debug/backers/badge.svg)](#backers) +[![OpenCollective](https://opencollective.com/debug/sponsors/badge.svg)](#sponsors) + + + +A tiny node.js debugging utility modelled after node core's debugging technique. + +**Discussion around the V3 API is under way [here](https://github.com/visionmedia/debug/issues/370)** + +## Installation + +```bash +$ npm install debug +``` + +## Usage + +`debug` exposes a function; simply pass this function the name of your module, and it will return a decorated version of `console.error` for you to pass debug statements to. This will allow you to toggle the debug output for different parts of your module as well as the module as a whole. + +Example _app.js_: + +```js +var debug = require('debug')('http') + , http = require('http') + , name = 'My App'; + +// fake app + +debug('booting %s', name); + +http.createServer(function(req, res){ + debug(req.method + ' ' + req.url); + res.end('hello\n'); +}).listen(3000, function(){ + debug('listening'); +}); + +// fake worker of some kind + +require('./worker'); +``` + +Example _worker.js_: + +```js +var debug = require('debug')('worker'); + +setInterval(function(){ + debug('doing some work'); +}, 1000); +``` + + The __DEBUG__ environment variable is then used to enable these based on space or comma-delimited names. Here are some examples: + + ![debug http and worker](http://f.cl.ly/items/18471z1H402O24072r1J/Screenshot.png) + + ![debug worker](http://f.cl.ly/items/1X413v1a3M0d3C2c1E0i/Screenshot.png) + +#### Windows note + + On Windows the environment variable is set using the `set` command. + + ```cmd + set DEBUG=*,-not_this + ``` + + Note that PowerShell uses different syntax to set environment variables. + + ```cmd + $env:DEBUG = "*,-not_this" + ``` + +Then, run the program to be debugged as usual. + +## Millisecond diff + + When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls. + + ![](http://f.cl.ly/items/2i3h1d3t121M2Z1A3Q0N/Screenshot.png) + + When stdout is not a TTY, `Date#toUTCString()` is used, making it more useful for logging the debug information as shown below: + + ![](http://f.cl.ly/items/112H3i0e0o0P0a2Q2r11/Screenshot.png) + +## Conventions + + If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser". + +## Wildcards + + The `*` character may be used as a wildcard. Suppose for example your library has debuggers named "connect:bodyParser", "connect:compress", "connect:session", instead of listing all three with `DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do `DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`. + + You can also exclude specific debuggers by prefixing them with a "-" character. For example, `DEBUG=*,-connect:*` would include all debuggers except those starting with "connect:". + +## Environment Variables + + When running through Node.js, you can set a few environment variables that will + change the behavior of the debug logging: + +| Name | Purpose | +|-----------|-------------------------------------------------| +| `DEBUG` | Enables/disables specific debugging namespaces. | +| `DEBUG_COLORS`| Whether or not to use colors in the debug output. | +| `DEBUG_DEPTH` | Object inspection depth. | +| `DEBUG_SHOW_HIDDEN` | Shows hidden properties on inspected objects. | + + + __Note:__ The environment variables beginning with `DEBUG_` end up being + converted into an Options object that gets used with `%o`/`%O` formatters. + See the Node.js documentation for + [`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options) + for the complete list. + +## Formatters + + + Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting. Below are the officially supported formatters: + +| Formatter | Representation | +|-----------|----------------| +| `%O` | Pretty-print an Object on multiple lines. | +| `%o` | Pretty-print an Object all on a single line. | +| `%s` | String. | +| `%d` | Number (both integer and float). | +| `%j` | JSON. Replaced with the string '[Circular]' if the argument contains circular references. | +| `%%` | Single percent sign ('%'). This does not consume an argument. | + +### Custom formatters + + You can add custom formatters by extending the `debug.formatters` object. For example, if you wanted to add support for rendering a Buffer as hex with `%h`, you could do something like: + +```js +const createDebug = require('debug') +createDebug.formatters.h = (v) => { + return v.toString('hex') +} + +// …elsewhere +const debug = createDebug('foo') +debug('this is hex: %h', new Buffer('hello world')) +// foo this is hex: 68656c6c6f20776f726c6421 +0ms +``` + +## Browser support + You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify), + or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest), + if you don't want to build it yourself. + + Debug's enable state is currently persisted by `localStorage`. + Consider the situation shown below where you have `worker:a` and `worker:b`, + and wish to debug both. You can enable this using `localStorage.debug`: + +```js +localStorage.debug = 'worker:*' +``` + +And then refresh the page. + +```js +a = debug('worker:a'); +b = debug('worker:b'); + +setInterval(function(){ + a('doing some work'); +}, 1000); + +setInterval(function(){ + b('doing some work'); +}, 1200); +``` + +#### Web Inspector Colors + + Colors are also enabled on "Web Inspectors" that understand the `%c` formatting + option. These are WebKit web inspectors, Firefox ([since version + 31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/)) + and the Firebug plugin for Firefox (any version). + + Colored output looks something like: + + ![](https://cloud.githubusercontent.com/assets/71256/3139768/b98c5fd8-e8ef-11e3-862a-f7253b6f47c6.png) + + +## Output streams + + By default `debug` will log to stderr, however this can be configured per-namespace by overriding the `log` method: + +Example _stdout.js_: + +```js +var debug = require('debug'); +var error = debug('app:error'); + +// by default stderr is used +error('goes to stderr!'); + +var log = debug('app:log'); +// set this namespace to log via console.log +log.log = console.log.bind(console); // don't forget to bind to console! +log('goes to stdout'); +error('still goes to stderr!'); + +// set all output to go via console.info +// overrides all per-namespace log settings +debug.log = console.info.bind(console); +error('now goes to stdout via console.info'); +log('still goes to stdout, but via console.info now'); +``` + + +## Authors + + - TJ Holowaychuk + - Nathan Rajlich + - Andrew Rhyne + +## Backers + +Support us with a monthly donation and help us continue our activities. [[Become a backer](https://opencollective.com/debug#backer)] + +

+ + +## Sponsors + +Become a sponsor and get your logo on our README on Github with a link to your site. [[Become a sponsor](https://opencollective.com/debug#sponsor)] + +

+ +## License + +(The MIT License) + +Copyright (c) 2014-2016 TJ Holowaychuk <tj@vision-media.ca> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/debug/component.json b/node_modules/debug/component.json new file mode 100644 index 0000000..9de2641 --- /dev/null +++ b/node_modules/debug/component.json @@ -0,0 +1,19 @@ +{ + "name": "debug", + "repo": "visionmedia/debug", + "description": "small debugging utility", + "version": "2.6.9", + "keywords": [ + "debug", + "log", + "debugger" + ], + "main": "src/browser.js", + "scripts": [ + "src/browser.js", + "src/debug.js" + ], + "dependencies": { + "rauchg/ms.js": "0.7.1" + } +} diff --git a/node_modules/debug/karma.conf.js b/node_modules/debug/karma.conf.js new file mode 100644 index 0000000..103a82d --- /dev/null +++ b/node_modules/debug/karma.conf.js @@ -0,0 +1,70 @@ +// Karma configuration +// Generated on Fri Dec 16 2016 13:09:51 GMT+0000 (UTC) + +module.exports = function(config) { + config.set({ + + // base path that will be used to resolve all patterns (eg. files, exclude) + basePath: '', + + + // frameworks to use + // available frameworks: https://npmjs.org/browse/keyword/karma-adapter + frameworks: ['mocha', 'chai', 'sinon'], + + + // list of files / patterns to load in the browser + files: [ + 'dist/debug.js', + 'test/*spec.js' + ], + + + // list of files to exclude + exclude: [ + 'src/node.js' + ], + + + // preprocess matching files before serving them to the browser + // available preprocessors: https://npmjs.org/browse/keyword/karma-preprocessor + preprocessors: { + }, + + // test results reporter to use + // possible values: 'dots', 'progress' + // available reporters: https://npmjs.org/browse/keyword/karma-reporter + reporters: ['progress'], + + + // web server port + port: 9876, + + + // enable / disable colors in the output (reporters and logs) + colors: true, + + + // level of logging + // possible values: config.LOG_DISABLE || config.LOG_ERROR || config.LOG_WARN || config.LOG_INFO || config.LOG_DEBUG + logLevel: config.LOG_INFO, + + + // enable / disable watching file and executing tests whenever any file changes + autoWatch: true, + + + // start these browsers + // available browser launchers: https://npmjs.org/browse/keyword/karma-launcher + browsers: ['PhantomJS'], + + + // Continuous Integration mode + // if true, Karma captures browsers, runs the tests and exits + singleRun: false, + + // Concurrency level + // how many browser should be started simultaneous + concurrency: Infinity + }) +} diff --git a/node_modules/debug/node.js b/node_modules/debug/node.js new file mode 100644 index 0000000..7fc36fe --- /dev/null +++ b/node_modules/debug/node.js @@ -0,0 +1 @@ +module.exports = require('./src/node'); diff --git a/node_modules/debug/package.json b/node_modules/debug/package.json new file mode 100644 index 0000000..1caeb90 --- /dev/null +++ b/node_modules/debug/package.json @@ -0,0 +1,88 @@ +{ + "_from": "debug@2.6.9", + "_id": "debug@2.6.9", + "_inBundle": false, + "_integrity": "sha512-bC7ElrdJaJnPbAP+1EotYvqZsb3ecl5wi6Bfi6BJTUcNowp6cvspg0jXznRTKDjm/E7AdgFBVeAPVMNcKGsHMA==", + "_location": "/debug", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "debug@2.6.9", + "name": "debug", + "escapedName": "debug", + "rawSpec": "2.6.9", + "saveSpec": null, + "fetchSpec": "2.6.9" + }, + "_requiredBy": [ + "/compression" + ], + "_resolved": "https://registry.npmjs.org/debug/-/debug-2.6.9.tgz", + "_shasum": "5d128515df134ff327e90a4c93f4e077a536341f", + "_spec": "debug@2.6.9", + "_where": "/home/martin/dev/multiview/node_modules/compression", + "author": { + "name": "TJ Holowaychuk", + "email": "tj@vision-media.ca" + }, + "browser": "./src/browser.js", + "bugs": { + "url": "https://github.com/visionmedia/debug/issues" + }, + "bundleDependencies": false, + "component": { + "scripts": { + "debug/index.js": "browser.js", + "debug/debug.js": "debug.js" + } + }, + "contributors": [ + { + "name": "Nathan Rajlich", + "email": "nathan@tootallnate.net", + "url": "http://n8.io" + }, + { + "name": "Andrew Rhyne", + "email": "rhyneandrew@gmail.com" + } + ], + "dependencies": { + "ms": "2.0.0" + }, + "deprecated": false, + "description": "small debugging utility", + "devDependencies": { + "browserify": "9.0.3", + "chai": "^3.5.0", + "concurrently": "^3.1.0", + "coveralls": "^2.11.15", + "eslint": "^3.12.1", + "istanbul": "^0.4.5", + "karma": "^1.3.0", + "karma-chai": "^0.1.0", + "karma-mocha": "^1.3.0", + "karma-phantomjs-launcher": "^1.0.2", + "karma-sinon": "^1.0.5", + "mocha": "^3.2.0", + "mocha-lcov-reporter": "^1.2.0", + "rimraf": "^2.5.4", + "sinon": "^1.17.6", + "sinon-chai": "^2.8.0" + }, + "homepage": "https://github.com/visionmedia/debug#readme", + "keywords": [ + "debug", + "log", + "debugger" + ], + "license": "MIT", + "main": "./src/index.js", + "name": "debug", + "repository": { + "type": "git", + "url": "git://github.com/visionmedia/debug.git" + }, + "version": "2.6.9" +} diff --git a/node_modules/debug/src/browser.js b/node_modules/debug/src/browser.js new file mode 100644 index 0000000..7106924 --- /dev/null +++ b/node_modules/debug/src/browser.js @@ -0,0 +1,185 @@ +/** + * This is the web browser implementation of `debug()`. + * + * Expose `debug()` as the module. + */ + +exports = module.exports = require('./debug'); +exports.log = log; +exports.formatArgs = formatArgs; +exports.save = save; +exports.load = load; +exports.useColors = useColors; +exports.storage = 'undefined' != typeof chrome + && 'undefined' != typeof chrome.storage + ? chrome.storage.local + : localstorage(); + +/** + * Colors. + */ + +exports.colors = [ + 'lightseagreen', + 'forestgreen', + 'goldenrod', + 'dodgerblue', + 'darkorchid', + 'crimson' +]; + +/** + * Currently only WebKit-based Web Inspectors, Firefox >= v31, + * and the Firebug extension (any Firefox version) are known + * to support "%c" CSS customizations. + * + * TODO: add a `localStorage` variable to explicitly enable/disable colors + */ + +function useColors() { + // NB: In an Electron preload script, document will be defined but not fully + // initialized. Since we know we're in Chrome, we'll just detect this case + // explicitly + if (typeof window !== 'undefined' && window.process && window.process.type === 'renderer') { + return true; + } + + // is webkit? http://stackoverflow.com/a/16459606/376773 + // document is undefined in react-native: https://github.com/facebook/react-native/pull/1632 + return (typeof document !== 'undefined' && document.documentElement && document.documentElement.style && document.documentElement.style.WebkitAppearance) || + // is firebug? http://stackoverflow.com/a/398120/376773 + (typeof window !== 'undefined' && window.console && (window.console.firebug || (window.console.exception && window.console.table))) || + // is firefox >= v31? + // https://developer.mozilla.org/en-US/docs/Tools/Web_Console#Styling_messages + (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/firefox\/(\d+)/) && parseInt(RegExp.$1, 10) >= 31) || + // double check webkit in userAgent just in case we are in a worker + (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/applewebkit\/(\d+)/)); +} + +/** + * Map %j to `JSON.stringify()`, since no Web Inspectors do that by default. + */ + +exports.formatters.j = function(v) { + try { + return JSON.stringify(v); + } catch (err) { + return '[UnexpectedJSONParseError]: ' + err.message; + } +}; + + +/** + * Colorize log arguments if enabled. + * + * @api public + */ + +function formatArgs(args) { + var useColors = this.useColors; + + args[0] = (useColors ? '%c' : '') + + this.namespace + + (useColors ? ' %c' : ' ') + + args[0] + + (useColors ? '%c ' : ' ') + + '+' + exports.humanize(this.diff); + + if (!useColors) return; + + var c = 'color: ' + this.color; + args.splice(1, 0, c, 'color: inherit') + + // the final "%c" is somewhat tricky, because there could be other + // arguments passed either before or after the %c, so we need to + // figure out the correct index to insert the CSS into + var index = 0; + var lastC = 0; + args[0].replace(/%[a-zA-Z%]/g, function(match) { + if ('%%' === match) return; + index++; + if ('%c' === match) { + // we only are interested in the *last* %c + // (the user may have provided their own) + lastC = index; + } + }); + + args.splice(lastC, 0, c); +} + +/** + * Invokes `console.log()` when available. + * No-op when `console.log` is not a "function". + * + * @api public + */ + +function log() { + // this hackery is required for IE8/9, where + // the `console.log` function doesn't have 'apply' + return 'object' === typeof console + && console.log + && Function.prototype.apply.call(console.log, console, arguments); +} + +/** + * Save `namespaces`. + * + * @param {String} namespaces + * @api private + */ + +function save(namespaces) { + try { + if (null == namespaces) { + exports.storage.removeItem('debug'); + } else { + exports.storage.debug = namespaces; + } + } catch(e) {} +} + +/** + * Load `namespaces`. + * + * @return {String} returns the previously persisted debug modes + * @api private + */ + +function load() { + var r; + try { + r = exports.storage.debug; + } catch(e) {} + + // If debug isn't set in LS, and we're in Electron, try to load $DEBUG + if (!r && typeof process !== 'undefined' && 'env' in process) { + r = process.env.DEBUG; + } + + return r; +} + +/** + * Enable namespaces listed in `localStorage.debug` initially. + */ + +exports.enable(load()); + +/** + * Localstorage attempts to return the localstorage. + * + * This is necessary because safari throws + * when a user disables cookies/localstorage + * and you attempt to access it. + * + * @return {LocalStorage} + * @api private + */ + +function localstorage() { + try { + return window.localStorage; + } catch (e) {} +} diff --git a/node_modules/debug/src/debug.js b/node_modules/debug/src/debug.js new file mode 100644 index 0000000..6a5e3fc --- /dev/null +++ b/node_modules/debug/src/debug.js @@ -0,0 +1,202 @@ + +/** + * This is the common logic for both the Node.js and web browser + * implementations of `debug()`. + * + * Expose `debug()` as the module. + */ + +exports = module.exports = createDebug.debug = createDebug['default'] = createDebug; +exports.coerce = coerce; +exports.disable = disable; +exports.enable = enable; +exports.enabled = enabled; +exports.humanize = require('ms'); + +/** + * The currently active debug mode names, and names to skip. + */ + +exports.names = []; +exports.skips = []; + +/** + * Map of special "%n" handling functions, for the debug "format" argument. + * + * Valid key names are a single, lower or upper-case letter, i.e. "n" and "N". + */ + +exports.formatters = {}; + +/** + * Previous log timestamp. + */ + +var prevTime; + +/** + * Select a color. + * @param {String} namespace + * @return {Number} + * @api private + */ + +function selectColor(namespace) { + var hash = 0, i; + + for (i in namespace) { + hash = ((hash << 5) - hash) + namespace.charCodeAt(i); + hash |= 0; // Convert to 32bit integer + } + + return exports.colors[Math.abs(hash) % exports.colors.length]; +} + +/** + * Create a debugger with the given `namespace`. + * + * @param {String} namespace + * @return {Function} + * @api public + */ + +function createDebug(namespace) { + + function debug() { + // disabled? + if (!debug.enabled) return; + + var self = debug; + + // set `diff` timestamp + var curr = +new Date(); + var ms = curr - (prevTime || curr); + self.diff = ms; + self.prev = prevTime; + self.curr = curr; + prevTime = curr; + + // turn the `arguments` into a proper Array + var args = new Array(arguments.length); + for (var i = 0; i < args.length; i++) { + args[i] = arguments[i]; + } + + args[0] = exports.coerce(args[0]); + + if ('string' !== typeof args[0]) { + // anything else let's inspect with %O + args.unshift('%O'); + } + + // apply any `formatters` transformations + var index = 0; + args[0] = args[0].replace(/%([a-zA-Z%])/g, function(match, format) { + // if we encounter an escaped % then don't increase the array index + if (match === '%%') return match; + index++; + var formatter = exports.formatters[format]; + if ('function' === typeof formatter) { + var val = args[index]; + match = formatter.call(self, val); + + // now we need to remove `args[index]` since it's inlined in the `format` + args.splice(index, 1); + index--; + } + return match; + }); + + // apply env-specific formatting (colors, etc.) + exports.formatArgs.call(self, args); + + var logFn = debug.log || exports.log || console.log.bind(console); + logFn.apply(self, args); + } + + debug.namespace = namespace; + debug.enabled = exports.enabled(namespace); + debug.useColors = exports.useColors(); + debug.color = selectColor(namespace); + + // env-specific initialization logic for debug instances + if ('function' === typeof exports.init) { + exports.init(debug); + } + + return debug; +} + +/** + * Enables a debug mode by namespaces. This can include modes + * separated by a colon and wildcards. + * + * @param {String} namespaces + * @api public + */ + +function enable(namespaces) { + exports.save(namespaces); + + exports.names = []; + exports.skips = []; + + var split = (typeof namespaces === 'string' ? namespaces : '').split(/[\s,]+/); + var len = split.length; + + for (var i = 0; i < len; i++) { + if (!split[i]) continue; // ignore empty strings + namespaces = split[i].replace(/\*/g, '.*?'); + if (namespaces[0] === '-') { + exports.skips.push(new RegExp('^' + namespaces.substr(1) + '$')); + } else { + exports.names.push(new RegExp('^' + namespaces + '$')); + } + } +} + +/** + * Disable debug output. + * + * @api public + */ + +function disable() { + exports.enable(''); +} + +/** + * Returns true if the given mode name is enabled, false otherwise. + * + * @param {String} name + * @return {Boolean} + * @api public + */ + +function enabled(name) { + var i, len; + for (i = 0, len = exports.skips.length; i < len; i++) { + if (exports.skips[i].test(name)) { + return false; + } + } + for (i = 0, len = exports.names.length; i < len; i++) { + if (exports.names[i].test(name)) { + return true; + } + } + return false; +} + +/** + * Coerce `val`. + * + * @param {Mixed} val + * @return {Mixed} + * @api private + */ + +function coerce(val) { + if (val instanceof Error) return val.stack || val.message; + return val; +} diff --git a/node_modules/debug/src/index.js b/node_modules/debug/src/index.js new file mode 100644 index 0000000..e12cf4d --- /dev/null +++ b/node_modules/debug/src/index.js @@ -0,0 +1,10 @@ +/** + * Detect Electron renderer process, which is node, but we should + * treat as a browser. + */ + +if (typeof process !== 'undefined' && process.type === 'renderer') { + module.exports = require('./browser.js'); +} else { + module.exports = require('./node.js'); +} diff --git a/node_modules/debug/src/inspector-log.js b/node_modules/debug/src/inspector-log.js new file mode 100644 index 0000000..60ea6c0 --- /dev/null +++ b/node_modules/debug/src/inspector-log.js @@ -0,0 +1,15 @@ +module.exports = inspectorLog; + +// black hole +const nullStream = new (require('stream').Writable)(); +nullStream._write = () => {}; + +/** + * Outputs a `console.log()` to the Node.js Inspector console *only*. + */ +function inspectorLog() { + const stdout = console._stdout; + console._stdout = nullStream; + console.log.apply(console, arguments); + console._stdout = stdout; +} diff --git a/node_modules/debug/src/node.js b/node_modules/debug/src/node.js new file mode 100644 index 0000000..b15109c --- /dev/null +++ b/node_modules/debug/src/node.js @@ -0,0 +1,248 @@ +/** + * Module dependencies. + */ + +var tty = require('tty'); +var util = require('util'); + +/** + * This is the Node.js implementation of `debug()`. + * + * Expose `debug()` as the module. + */ + +exports = module.exports = require('./debug'); +exports.init = init; +exports.log = log; +exports.formatArgs = formatArgs; +exports.save = save; +exports.load = load; +exports.useColors = useColors; + +/** + * Colors. + */ + +exports.colors = [6, 2, 3, 4, 5, 1]; + +/** + * Build up the default `inspectOpts` object from the environment variables. + * + * $ DEBUG_COLORS=no DEBUG_DEPTH=10 DEBUG_SHOW_HIDDEN=enabled node script.js + */ + +exports.inspectOpts = Object.keys(process.env).filter(function (key) { + return /^debug_/i.test(key); +}).reduce(function (obj, key) { + // camel-case + var prop = key + .substring(6) + .toLowerCase() + .replace(/_([a-z])/g, function (_, k) { return k.toUpperCase() }); + + // coerce string value into JS value + var val = process.env[key]; + if (/^(yes|on|true|enabled)$/i.test(val)) val = true; + else if (/^(no|off|false|disabled)$/i.test(val)) val = false; + else if (val === 'null') val = null; + else val = Number(val); + + obj[prop] = val; + return obj; +}, {}); + +/** + * The file descriptor to write the `debug()` calls to. + * Set the `DEBUG_FD` env variable to override with another value. i.e.: + * + * $ DEBUG_FD=3 node script.js 3>debug.log + */ + +var fd = parseInt(process.env.DEBUG_FD, 10) || 2; + +if (1 !== fd && 2 !== fd) { + util.deprecate(function(){}, 'except for stderr(2) and stdout(1), any other usage of DEBUG_FD is deprecated. Override debug.log if you want to use a different log function (https://git.io/debug_fd)')() +} + +var stream = 1 === fd ? process.stdout : + 2 === fd ? process.stderr : + createWritableStdioStream(fd); + +/** + * Is stdout a TTY? Colored output is enabled when `true`. + */ + +function useColors() { + return 'colors' in exports.inspectOpts + ? Boolean(exports.inspectOpts.colors) + : tty.isatty(fd); +} + +/** + * Map %o to `util.inspect()`, all on a single line. + */ + +exports.formatters.o = function(v) { + this.inspectOpts.colors = this.useColors; + return util.inspect(v, this.inspectOpts) + .split('\n').map(function(str) { + return str.trim() + }).join(' '); +}; + +/** + * Map %o to `util.inspect()`, allowing multiple lines if needed. + */ + +exports.formatters.O = function(v) { + this.inspectOpts.colors = this.useColors; + return util.inspect(v, this.inspectOpts); +}; + +/** + * Adds ANSI color escape codes if enabled. + * + * @api public + */ + +function formatArgs(args) { + var name = this.namespace; + var useColors = this.useColors; + + if (useColors) { + var c = this.color; + var prefix = ' \u001b[3' + c + ';1m' + name + ' ' + '\u001b[0m'; + + args[0] = prefix + args[0].split('\n').join('\n' + prefix); + args.push('\u001b[3' + c + 'm+' + exports.humanize(this.diff) + '\u001b[0m'); + } else { + args[0] = new Date().toUTCString() + + ' ' + name + ' ' + args[0]; + } +} + +/** + * Invokes `util.format()` with the specified arguments and writes to `stream`. + */ + +function log() { + return stream.write(util.format.apply(util, arguments) + '\n'); +} + +/** + * Save `namespaces`. + * + * @param {String} namespaces + * @api private + */ + +function save(namespaces) { + if (null == namespaces) { + // If you set a process.env field to null or undefined, it gets cast to the + // string 'null' or 'undefined'. Just delete instead. + delete process.env.DEBUG; + } else { + process.env.DEBUG = namespaces; + } +} + +/** + * Load `namespaces`. + * + * @return {String} returns the previously persisted debug modes + * @api private + */ + +function load() { + return process.env.DEBUG; +} + +/** + * Copied from `node/src/node.js`. + * + * XXX: It's lame that node doesn't expose this API out-of-the-box. It also + * relies on the undocumented `tty_wrap.guessHandleType()` which is also lame. + */ + +function createWritableStdioStream (fd) { + var stream; + var tty_wrap = process.binding('tty_wrap'); + + // Note stream._type is used for test-module-load-list.js + + switch (tty_wrap.guessHandleType(fd)) { + case 'TTY': + stream = new tty.WriteStream(fd); + stream._type = 'tty'; + + // Hack to have stream not keep the event loop alive. + // See https://github.com/joyent/node/issues/1726 + if (stream._handle && stream._handle.unref) { + stream._handle.unref(); + } + break; + + case 'FILE': + var fs = require('fs'); + stream = new fs.SyncWriteStream(fd, { autoClose: false }); + stream._type = 'fs'; + break; + + case 'PIPE': + case 'TCP': + var net = require('net'); + stream = new net.Socket({ + fd: fd, + readable: false, + writable: true + }); + + // FIXME Should probably have an option in net.Socket to create a + // stream from an existing fd which is writable only. But for now + // we'll just add this hack and set the `readable` member to false. + // Test: ./node test/fixtures/echo.js < /etc/passwd + stream.readable = false; + stream.read = null; + stream._type = 'pipe'; + + // FIXME Hack to have stream not keep the event loop alive. + // See https://github.com/joyent/node/issues/1726 + if (stream._handle && stream._handle.unref) { + stream._handle.unref(); + } + break; + + default: + // Probably an error on in uv_guess_handle() + throw new Error('Implement me. Unknown stream file type!'); + } + + // For supporting legacy API we put the FD here. + stream.fd = fd; + + stream._isStdio = true; + + return stream; +} + +/** + * Init logic for `debug` instances. + * + * Create a new `inspectOpts` object in case `useColors` is set + * differently for a particular `debug` instance. + */ + +function init (debug) { + debug.inspectOpts = {}; + + var keys = Object.keys(exports.inspectOpts); + for (var i = 0; i < keys.length; i++) { + debug.inspectOpts[keys[i]] = exports.inspectOpts[keys[i]]; + } +} + +/** + * Enable namespaces listed in `process.env.DEBUG` initially. + */ + +exports.enable(load()); diff --git a/node_modules/matchit/lib/matchit.js b/node_modules/matchit/lib/matchit.js new file mode 100644 index 0000000..2c76c54 --- /dev/null +++ b/node_modules/matchit/lib/matchit.js @@ -0,0 +1,119 @@ +'use strict'; + +const every = require('@arr/every'); + +const SEP = '/'; +// Types ~> static, param, any, optional +const STYPE=0, PTYPE=1, ATYPE=2, OTYPE=3; +// Char Codes ~> / : * +const SLASH=47, COLON=58, ASTER=42, QMARK=63; + +function strip(str) { + if (str === SEP) return str; + (str.charCodeAt(0) === SLASH) && (str=str.substring(1)); + var len = str.length - 1; + return str.charCodeAt(len) === SLASH ? str.substring(0, len) : str; +} + +function split(str) { + return (str=strip(str)) === SEP ? [SEP] : str.split(SEP); +} + +function isMatch(arr, obj, idx) { + idx = arr[idx]; + return (obj.val === idx && obj.type === STYPE) || (idx === SEP ? obj.type > PTYPE : obj.type !== STYPE && (idx || '').endsWith(obj.end)); +} + +function match(str, all) { + var i=0, tmp, segs=split(str), len=segs.length, l; + var fn = isMatch.bind(isMatch, segs); + + for (; i < all.length; i++) { + tmp = all[i]; + if ((l=tmp.length) === len || (l < len && tmp[l-1].type === ATYPE) || (l > len && tmp[l-1].type === OTYPE)) { + if (every(tmp, fn)) return tmp; + } + } + + return []; +} + +function parse(str) { + if (str === SEP) { + return [{ old:str, type:STYPE, val:str, end:'' }]; + } + + var c, x, t, sfx, nxt=strip(str), i=-1, j=0, len=nxt.length, out=[]; + + while (++i < len) { + c = nxt.charCodeAt(i); + + if (c === COLON) { + j = i + 1; // begining of param + t = PTYPE; // set type + x = 0; // reset mark + sfx = ''; + + while (i < len && nxt.charCodeAt(i) !== SLASH) { + c = nxt.charCodeAt(i); + if (c === QMARK) { + x=i; t=OTYPE; + } else if (c === 46 && sfx.length === 0) { + sfx = nxt.substring(x=i); + } + i++; // move on + } + + out.push({ + old: str, + type: t, + val: nxt.substring(j, x||i), + end: sfx + }); + + // shorten string & update pointers + nxt=nxt.substring(i); len-=i; i=0; + + continue; // loop + } else if (c === ASTER) { + out.push({ + old: str, + type: ATYPE, + val: nxt.substring(i), + end: '' + }); + continue; // loop + } else { + j = i; + while (i < len && nxt.charCodeAt(i) !== SLASH) { + ++i; // skip to next slash + } + out.push({ + old: str, + type: STYPE, + val: nxt.substring(j, i), + end: '' + }); + // shorten string & update pointers + nxt=nxt.substring(i); len-=i; i=j=0; + } + } + + return out; +} + +function exec(str, arr) { + var i=0, x, y, segs=split(str), out={}; + for (; i < arr.length; i++) { + x=segs[i]; y=arr[i]; + if (x === SEP) continue; + if (x !== void 0 && y.type | 2 === OTYPE) { + out[ y.val ] = x.replace(y.end, ''); + } + } + return out; +} + +exports.exec = exec; +exports.match = match; +exports.parse = parse; \ No newline at end of file diff --git a/node_modules/matchit/lib/matchit.mjs b/node_modules/matchit/lib/matchit.mjs new file mode 100644 index 0000000..03da81e --- /dev/null +++ b/node_modules/matchit/lib/matchit.mjs @@ -0,0 +1,115 @@ +'use strict'; + +import every from '@arr/every'; + +const SEP = '/'; +// Types ~> static, param, any, optional +const STYPE=0, PTYPE=1, ATYPE=2, OTYPE=3; +// Char Codes ~> / : * +const SLASH=47, COLON=58, ASTER=42, QMARK=63; + +function strip(str) { + if (str === SEP) return str; + (str.charCodeAt(0) === SLASH) && (str=str.substring(1)); + var len = str.length - 1; + return str.charCodeAt(len) === SLASH ? str.substring(0, len) : str; +} + +function split(str) { + return (str=strip(str)) === SEP ? [SEP] : str.split(SEP); +} + +function isMatch(arr, obj, idx) { + idx = arr[idx]; + return (obj.val === idx && obj.type === STYPE) || (idx === SEP ? obj.type > PTYPE : obj.type !== STYPE && (idx || '').endsWith(obj.end)); +} + +export function match(str, all) { + var i=0, tmp, segs=split(str), len=segs.length, l; + var fn = isMatch.bind(isMatch, segs); + + for (; i < all.length; i++) { + tmp = all[i]; + if ((l=tmp.length) === len || (l < len && tmp[l-1].type === ATYPE) || (l > len && tmp[l-1].type === OTYPE)) { + if (every(tmp, fn)) return tmp; + } + } + + return []; +} + +export function parse(str) { + if (str === SEP) { + return [{ old:str, type:STYPE, val:str, end:'' }]; + } + + var c, x, t, sfx, nxt=strip(str), i=-1, j=0, len=nxt.length, out=[]; + + while (++i < len) { + c = nxt.charCodeAt(i); + + if (c === COLON) { + j = i + 1; // begining of param + t = PTYPE; // set type + x = 0; // reset mark + sfx = ''; + + while (i < len && nxt.charCodeAt(i) !== SLASH) { + c = nxt.charCodeAt(i); + if (c === QMARK) { + x=i; t=OTYPE; + } else if (c === 46 && sfx.length === 0) { + sfx = nxt.substring(x=i); + } + i++; // move on + } + + out.push({ + old: str, + type: t, + val: nxt.substring(j, x||i), + end: sfx + }); + + // shorten string & update pointers + nxt=nxt.substring(i); len-=i; i=0; + + continue; // loop + } else if (c === ASTER) { + out.push({ + old: str, + type: ATYPE, + val: nxt.substring(i), + end: '' + }); + continue; // loop + } else { + j = i; + while (i < len && nxt.charCodeAt(i) !== SLASH) { + ++i; // skip to next slash + } + out.push({ + old: str, + type: STYPE, + val: nxt.substring(j, i), + end: '' + }); + // shorten string & update pointers + nxt=nxt.substring(i); len-=i; i=j=0; + } + } + + return out; +} + +export function exec(str, arr) { + var i=0, x, y, segs=split(str), out={}; + for (; i < arr.length; i++) { + x=segs[i]; y=arr[i]; + if (x === SEP) continue; + if (x !== void 0 && y.type | 2 === OTYPE) { + out[ y.val ] = x.replace(y.end, ''); + } + } + return out; +} diff --git a/node_modules/matchit/license.md b/node_modules/matchit/license.md new file mode 100644 index 0000000..a3f96f8 --- /dev/null +++ b/node_modules/matchit/license.md @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) Luke Edwards (lukeed.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/node_modules/matchit/package.json b/node_modules/matchit/package.json new file mode 100644 index 0000000..868b4dc --- /dev/null +++ b/node_modules/matchit/package.json @@ -0,0 +1,76 @@ +{ + "_from": "matchit@^1.0.0", + "_id": "matchit@1.0.8", + "_inBundle": false, + "_integrity": "sha512-CwPPICzozd/ezCzpVwGYG5bMVieaapnA0vvHDQnmQ2u2vZtVLynoPmvFsZjL67hFOvTBhhpqSR0bq3uloDP/Rw==", + "_location": "/matchit", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "matchit@^1.0.0", + "name": "matchit", + "escapedName": "matchit", + "rawSpec": "^1.0.0", + "saveSpec": null, + "fetchSpec": "^1.0.0" + }, + "_requiredBy": [ + "/trouter" + ], + "_resolved": "https://registry.npmjs.org/matchit/-/matchit-1.0.8.tgz", + "_shasum": "9a129e38f79b2053dd75339215b19e1f6bb88efb", + "_spec": "matchit@^1.0.0", + "_where": "/home/martin/dev/multiview/node_modules/trouter", + "author": { + "name": "Luke Edwards", + "email": "luke.edwards05@gmail.com", + "url": "lukeed.com" + }, + "bugs": { + "url": "https://github.com/lukeed/matchit/issues" + }, + "bundleDependencies": false, + "dependencies": { + "@arr/every": "^1.0.0" + }, + "deprecated": false, + "description": "Quickly parse & match URLs", + "devDependencies": { + "bundt": "^0.3.0", + "tap-spec": "^4.1.1", + "tape": "^4.6.3" + }, + "engines": { + "node": ">=6" + }, + "files": [ + "lib" + ], + "homepage": "https://github.com/lukeed/matchit#readme", + "keywords": [ + "route", + "regexp", + "routing", + "pattern", + "match", + "parse", + "url" + ], + "license": "MIT", + "main": "lib/matchit.js", + "module": "lib/matchit.mjs", + "name": "matchit", + "repository": { + "type": "git", + "url": "git+https://github.com/lukeed/matchit.git" + }, + "scripts": { + "bench": "node bench", + "build": "bundt", + "prebench": "npm run build", + "pretest": "npm run build", + "test": "tape test/*.js | tap-spec" + }, + "version": "1.0.8" +} diff --git a/node_modules/matchit/readme.md b/node_modules/matchit/readme.md new file mode 100644 index 0000000..c131890 --- /dev/null +++ b/node_modules/matchit/readme.md @@ -0,0 +1,166 @@ +# matchit [![Build Status](https://travis-ci.org/lukeed/matchit.svg?branch=master)](https://travis-ci.org/lukeed/matchit) + +> Quickly parse & match URLs + +## Install + +``` +$ npm install --save matchit +``` + + +## Usage + +```js +const { exec, match, parse } = require('matchit'); + +parse('/foo/:bar/:baz?'); +//=> [ +//=> { old:'/foo/:bar', type:0, val:'foo' }, +//=> { old:'/foo/:bar', type:1, val:'bar' }, +//=> { old:'/foo/:bar', type:3, val:'baz' } +//=> ] + +const routes = ['/', '/foo', 'bar', '/baz', '/baz/:title','/bat/*'].map(parse); + +match('/', routes); +//=> [{ old:'/', type:0, val:'/' }] + +match('/foo', routes); +//=> [{ old:'/foo', type:0, val:'foo' }] + +match('/bar', routes); +//=> [{ old:'bar', type:0, val:'bar' }] + +match('/baz', routes); +//=> [{ old:'/baz', type:0, val:'baz' }] + +let a = match('/baz/hello', routes); +//=> [{...}, {...}] +let b = exec('/baz/hello', a); +//=> { title:'hello' } + +match('/bat/quz/qut', routes); +//=> [ +//=> { old:'/bat/*', type:0, val:'bat' }, +//=> { old:'/bat/*', type:2, val:'*' } +//=> ] +``` + + +## API + +### matchit.parse(route) + +Returns: `Array` + +The `route` is `split` and parsed into a "definition" array of objects. Each object ("segment") contains a `val`, `type`, and `old` key: + +* `old` — The [`route`](#route)'s original value +* `type` — An numerical representation of the segment type. + * `0` - static + * `1` - parameter + * `2` - any/wildcard + * `3` - optional param +* `val` — The current segment's value. This is either a static value of the name of a parameter + +#### route + +Type: `String` + +A single URL pattern. + +> **Note:** Input will be stripped of all leading & trailing `/` characters, so there's no need to normalize your own URLs before passing it to `parse`! + + +### matchit.match(url, routes) + +Returns: `Array` + +Returns the [`route`](#route)'s encoded definition. See [`matchit.parse`](#matchitparseroute). + +#### url + +Type: `String` + +The true URL you want to be matched. + +#### routes + +Type: `Array` + +_All_ "parsed" route definitions, via [`matchit.parse`](#matchitparseroute). + +> **Important:** Multiple routes will require an Array of `matchit.parse` outputs. + + +### matchit.exec(url, match) + +Returns: `Object` + +Returns an object an object of `key:val` pairs, as defined by your [`route`](#route) pattern. + +#### url + +Type: `String` + +The URL (`pathname`) to evaluate. + +> **Important:** This should be `pathname`s only as any `querystring`s will be included the response. + +#### match + +Type: `Array` + +The route definition to use, via [`matchit.match`](#matchitmatchurl-routes). + + +## Benchmarks + +> Running Node v10.13.0 + +``` +# Parsing + matchit x 1,489,482 ops/sec ±2.89% (97 runs sampled) + regexparam x 406,824 ops/sec ±1.38% (96 runs sampled) + path-to-regexp x 83,439 ops/sec ±0.89% (96 runs sampled) + path-to-regexp.parse x 421,266 ops/sec ±0.13% (97 runs sampled) + +# Match (index) + matchit x 132,338,546 ops/sec ±0.14% (96 runs sampled) + regexparam x 49,889,162 ops/sec ±0.21% (95 runs sampled) + path-to-regexp.exec x 7,176,721 ops/sec ±1.23% (94 runs sampled) + path-to-regexp.tokens x 102,021 ops/sec ±0.21% (96 runs sampled) + +# Match (param) + matchit x 2,700,618 ops/sec ±0.92% (95 runs sampled) + regexparam x 6,924,653 ops/sec ±0.33% (94 runs sampled) + path-to-regexp.exec x 4,715,483 ops/sec ±0.28% (96 runs sampled) + path-to-regexp.tokens x 98,182 ops/sec ±0.45% (93 runs sampled) + +# Match (optional) + matchit x 2,816,313 ops/sec ±0.64% (93 runs sampled) + regexparam x 8,437,064 ops/sec ±0.41% (93 runs sampled) + path-to-regexp.exec x 5,909,510 ops/sec ±0.22% (97 runs sampled) + path-to-regexp.tokens x 101,832 ops/sec ±0.43% (98 runs sampled) + +# Match (wildcard) + matchit x 3,409,100 ops/sec ±0.34% (98 runs sampled) + regexparam x 9,740,429 ops/sec ±0.49% (95 runs sampled) + path-to-regexp.exec x 8,740,590 ops/sec ±0.43% (89 runs sampled) + path-to-regexp.tokens x 102,109 ops/sec ±0.35% (96 runs sampled) + +# Exec + matchit x 1,558,321 ops/sec ±0.33% (96 runs sampled) + regexparam x 6,966,297 ops/sec ±0.21% (97 runs sampled) + path-to-regexp x 102,250 ops/sec ±0.45% (95 runs sampled) +``` + +## Related + +- [regexparam](https://github.com/lukeed/regexparam) - A similar (285B) utility, but relies on `RegExp` instead of String comparisons. + + +## License + +MIT © [Luke Edwards](https://lukeed.com) diff --git a/node_modules/mime-db/HISTORY.md b/node_modules/mime-db/HISTORY.md new file mode 100644 index 0000000..85c0319 --- /dev/null +++ b/node_modules/mime-db/HISTORY.md @@ -0,0 +1,446 @@ +1.44.0 / 2020-04-22 +=================== + + * Add charsets from IANA + * Add extension `.cjs` to `application/node` + * Add new upstream MIME types + +1.43.0 / 2020-01-05 +=================== + + * Add `application/x-keepass2` with extension `.kdbx` + * Add extension `.mxmf` to `audio/mobile-xmf` + * Add extensions from IANA for `application/*+xml` types + * Add new upstream MIME types + +1.42.0 / 2019-09-25 +=================== + + * Add `image/vnd.ms-dds` with extension `.dds` + * Add new upstream MIME types + * Remove compressible from `multipart/mixed` + +1.41.0 / 2019-08-30 +=================== + + * Add new upstream MIME types + * Add `application/toml` with extension `.toml` + * Mark `font/ttf` as compressible + +1.40.0 / 2019-04-20 +=================== + + * Add extensions from IANA for `model/*` types + * Add `text/mdx` with extension `.mdx` + +1.39.0 / 2019-04-04 +=================== + + * Add extensions `.siv` and `.sieve` to `application/sieve` + * Add new upstream MIME types + +1.38.0 / 2019-02-04 +=================== + + * Add extension `.nq` to `application/n-quads` + * Add extension `.nt` to `application/n-triples` + * Add new upstream MIME types + * Mark `text/less` as compressible + +1.37.0 / 2018-10-19 +=================== + + * Add extensions to HEIC image types + * Add new upstream MIME types + +1.36.0 / 2018-08-20 +=================== + + * Add Apple file extensions from IANA + * Add extensions from IANA for `image/*` types + * Add new upstream MIME types + +1.35.0 / 2018-07-15 +=================== + + * Add extension `.owl` to `application/rdf+xml` + * Add new upstream MIME types + - Removes extension `.woff` from `application/font-woff` + +1.34.0 / 2018-06-03 +=================== + + * Add extension `.csl` to `application/vnd.citationstyles.style+xml` + * Add extension `.es` to `application/ecmascript` + * Add new upstream MIME types + * Add `UTF-8` as default charset for `text/turtle` + * Mark all XML-derived types as compressible + +1.33.0 / 2018-02-15 +=================== + + * Add extensions from IANA for `message/*` types + * Add new upstream MIME types + * Fix some incorrect OOXML types + * Remove `application/font-woff2` + +1.32.0 / 2017-11-29 +=================== + + * Add new upstream MIME types + * Update `text/hjson` to registered `application/hjson` + * Add `text/shex` with extension `.shex` + +1.31.0 / 2017-10-25 +=================== + + * Add `application/raml+yaml` with extension `.raml` + * Add `application/wasm` with extension `.wasm` + * Add new `font` type from IANA + * Add new upstream font extensions + * Add new upstream MIME types + * Add extensions for JPEG-2000 images + +1.30.0 / 2017-08-27 +=================== + + * Add `application/vnd.ms-outlook` + * Add `application/x-arj` + * Add extension `.mjs` to `application/javascript` + * Add glTF types and extensions + * Add new upstream MIME types + * Add `text/x-org` + * Add VirtualBox MIME types + * Fix `source` records for `video/*` types that are IANA + * Update `font/opentype` to registered `font/otf` + +1.29.0 / 2017-07-10 +=================== + + * Add `application/fido.trusted-apps+json` + * Add extension `.wadl` to `application/vnd.sun.wadl+xml` + * Add new upstream MIME types + * Add `UTF-8` as default charset for `text/css` + +1.28.0 / 2017-05-14 +=================== + + * Add new upstream MIME types + * Add extension `.gz` to `application/gzip` + * Update extensions `.md` and `.markdown` to be `text/markdown` + +1.27.0 / 2017-03-16 +=================== + + * Add new upstream MIME types + * Add `image/apng` with extension `.apng` + +1.26.0 / 2017-01-14 +=================== + + * Add new upstream MIME types + * Add extension `.geojson` to `application/geo+json` + +1.25.0 / 2016-11-11 +=================== + + * Add new upstream MIME types + +1.24.0 / 2016-09-18 +=================== + + * Add `audio/mp3` + * Add new upstream MIME types + +1.23.0 / 2016-05-01 +=================== + + * Add new upstream MIME types + * Add extension `.3gpp` to `audio/3gpp` + +1.22.0 / 2016-02-15 +=================== + + * Add `text/slim` + * Add extension `.rng` to `application/xml` + * Add new upstream MIME types + * Fix extension of `application/dash+xml` to be `.mpd` + * Update primary extension to `.m4a` for `audio/mp4` + +1.21.0 / 2016-01-06 +=================== + + * Add Google document types + * Add new upstream MIME types + +1.20.0 / 2015-11-10 +=================== + + * Add `text/x-suse-ymp` + * Add new upstream MIME types + +1.19.0 / 2015-09-17 +=================== + + * Add `application/vnd.apple.pkpass` + * Add new upstream MIME types + +1.18.0 / 2015-09-03 +=================== + + * Add new upstream MIME types + +1.17.0 / 2015-08-13 +=================== + + * Add `application/x-msdos-program` + * Add `audio/g711-0` + * Add `image/vnd.mozilla.apng` + * Add extension `.exe` to `application/x-msdos-program` + +1.16.0 / 2015-07-29 +=================== + + * Add `application/vnd.uri-map` + +1.15.0 / 2015-07-13 +=================== + + * Add `application/x-httpd-php` + +1.14.0 / 2015-06-25 +=================== + + * Add `application/scim+json` + * Add `application/vnd.3gpp.ussd+xml` + * Add `application/vnd.biopax.rdf+xml` + * Add `text/x-processing` + +1.13.0 / 2015-06-07 +=================== + + * Add nginx as a source + * Add `application/x-cocoa` + * Add `application/x-java-archive-diff` + * Add `application/x-makeself` + * Add `application/x-perl` + * Add `application/x-pilot` + * Add `application/x-redhat-package-manager` + * Add `application/x-sea` + * Add `audio/x-m4a` + * Add `audio/x-realaudio` + * Add `image/x-jng` + * Add `text/mathml` + +1.12.0 / 2015-06-05 +=================== + + * Add `application/bdoc` + * Add `application/vnd.hyperdrive+json` + * Add `application/x-bdoc` + * Add extension `.rtf` to `text/rtf` + +1.11.0 / 2015-05-31 +=================== + + * Add `audio/wav` + * Add `audio/wave` + * Add extension `.litcoffee` to `text/coffeescript` + * Add extension `.sfd-hdstx` to `application/vnd.hydrostatix.sof-data` + * Add extension `.n-gage` to `application/vnd.nokia.n-gage.symbian.install` + +1.10.0 / 2015-05-19 +=================== + + * Add `application/vnd.balsamiq.bmpr` + * Add `application/vnd.microsoft.portable-executable` + * Add `application/x-ns-proxy-autoconfig` + +1.9.1 / 2015-04-19 +================== + + * Remove `.json` extension from `application/manifest+json` + - This is causing bugs downstream + +1.9.0 / 2015-04-19 +================== + + * Add `application/manifest+json` + * Add `application/vnd.micro+json` + * Add `image/vnd.zbrush.pcx` + * Add `image/x-ms-bmp` + +1.8.0 / 2015-03-13 +================== + + * Add `application/vnd.citationstyles.style+xml` + * Add `application/vnd.fastcopy-disk-image` + * Add `application/vnd.gov.sk.xmldatacontainer+xml` + * Add extension `.jsonld` to `application/ld+json` + +1.7.0 / 2015-02-08 +================== + + * Add `application/vnd.gerber` + * Add `application/vnd.msa-disk-image` + +1.6.1 / 2015-02-05 +================== + + * Community extensions ownership transferred from `node-mime` + +1.6.0 / 2015-01-29 +================== + + * Add `application/jose` + * Add `application/jose+json` + * Add `application/json-seq` + * Add `application/jwk+json` + * Add `application/jwk-set+json` + * Add `application/jwt` + * Add `application/rdap+json` + * Add `application/vnd.gov.sk.e-form+xml` + * Add `application/vnd.ims.imsccv1p3` + +1.5.0 / 2014-12-30 +================== + + * Add `application/vnd.oracle.resource+json` + * Fix various invalid MIME type entries + - `application/mbox+xml` + - `application/oscp-response` + - `application/vwg-multiplexed` + - `audio/g721` + +1.4.0 / 2014-12-21 +================== + + * Add `application/vnd.ims.imsccv1p2` + * Fix various invalid MIME type entries + - `application/vnd-acucobol` + - `application/vnd-curl` + - `application/vnd-dart` + - `application/vnd-dxr` + - `application/vnd-fdf` + - `application/vnd-mif` + - `application/vnd-sema` + - `application/vnd-wap-wmlc` + - `application/vnd.adobe.flash-movie` + - `application/vnd.dece-zip` + - `application/vnd.dvb_service` + - `application/vnd.micrografx-igx` + - `application/vnd.sealed-doc` + - `application/vnd.sealed-eml` + - `application/vnd.sealed-mht` + - `application/vnd.sealed-ppt` + - `application/vnd.sealed-tiff` + - `application/vnd.sealed-xls` + - `application/vnd.sealedmedia.softseal-html` + - `application/vnd.sealedmedia.softseal-pdf` + - `application/vnd.wap-slc` + - `application/vnd.wap-wbxml` + - `audio/vnd.sealedmedia.softseal-mpeg` + - `image/vnd-djvu` + - `image/vnd-svf` + - `image/vnd-wap-wbmp` + - `image/vnd.sealed-png` + - `image/vnd.sealedmedia.softseal-gif` + - `image/vnd.sealedmedia.softseal-jpg` + - `model/vnd-dwf` + - `model/vnd.parasolid.transmit-binary` + - `model/vnd.parasolid.transmit-text` + - `text/vnd-a` + - `text/vnd-curl` + - `text/vnd.wap-wml` + * Remove example template MIME types + - `application/example` + - `audio/example` + - `image/example` + - `message/example` + - `model/example` + - `multipart/example` + - `text/example` + - `video/example` + +1.3.1 / 2014-12-16 +================== + + * Fix missing extensions + - `application/json5` + - `text/hjson` + +1.3.0 / 2014-12-07 +================== + + * Add `application/a2l` + * Add `application/aml` + * Add `application/atfx` + * Add `application/atxml` + * Add `application/cdfx+xml` + * Add `application/dii` + * Add `application/json5` + * Add `application/lxf` + * Add `application/mf4` + * Add `application/vnd.apache.thrift.compact` + * Add `application/vnd.apache.thrift.json` + * Add `application/vnd.coffeescript` + * Add `application/vnd.enphase.envoy` + * Add `application/vnd.ims.imsccv1p1` + * Add `text/csv-schema` + * Add `text/hjson` + * Add `text/markdown` + * Add `text/yaml` + +1.2.0 / 2014-11-09 +================== + + * Add `application/cea` + * Add `application/dit` + * Add `application/vnd.gov.sk.e-form+zip` + * Add `application/vnd.tmd.mediaflex.api+xml` + * Type `application/epub+zip` is now IANA-registered + +1.1.2 / 2014-10-23 +================== + + * Rebuild database for `application/x-www-form-urlencoded` change + +1.1.1 / 2014-10-20 +================== + + * Mark `application/x-www-form-urlencoded` as compressible. + +1.1.0 / 2014-09-28 +================== + + * Add `application/font-woff2` + +1.0.3 / 2014-09-25 +================== + + * Fix engine requirement in package + +1.0.2 / 2014-09-25 +================== + + * Add `application/coap-group+json` + * Add `application/dcd` + * Add `application/vnd.apache.thrift.binary` + * Add `image/vnd.tencent.tap` + * Mark all JSON-derived types as compressible + * Update `text/vtt` data + +1.0.1 / 2014-08-30 +================== + + * Fix extension ordering + +1.0.0 / 2014-08-30 +================== + + * Add `application/atf` + * Add `application/merge-patch+json` + * Add `multipart/x-mixed-replace` + * Add `source: 'apache'` metadata + * Add `source: 'iana'` metadata + * Remove badly-assumed charset data diff --git a/node_modules/mime-db/LICENSE b/node_modules/mime-db/LICENSE new file mode 100644 index 0000000..a7ae8ee --- /dev/null +++ b/node_modules/mime-db/LICENSE @@ -0,0 +1,22 @@ + +The MIT License (MIT) + +Copyright (c) 2014 Jonathan Ong me@jongleberry.com + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/node_modules/mime-db/README.md b/node_modules/mime-db/README.md new file mode 100644 index 0000000..d6a6f80 --- /dev/null +++ b/node_modules/mime-db/README.md @@ -0,0 +1,102 @@ +# mime-db + +[![NPM Version][npm-version-image]][npm-url] +[![NPM Downloads][npm-downloads-image]][npm-url] +[![Node.js Version][node-image]][node-url] +[![Build Status][travis-image]][travis-url] +[![Coverage Status][coveralls-image]][coveralls-url] + +This is a database of all mime types. +It consists of a single, public JSON file and does not include any logic, +allowing it to remain as un-opinionated as possible with an API. +It aggregates data from the following sources: + +- http://www.iana.org/assignments/media-types/media-types.xhtml +- http://svn.apache.org/repos/asf/httpd/httpd/trunk/docs/conf/mime.types +- http://hg.nginx.org/nginx/raw-file/default/conf/mime.types + +## Installation + +```bash +npm install mime-db +``` + +### Database Download + +If you're crazy enough to use this in the browser, you can just grab the +JSON file using [jsDelivr](https://www.jsdelivr.com/). It is recommended to +replace `master` with [a release tag](https://github.com/jshttp/mime-db/tags) +as the JSON format may change in the future. + +``` +https://cdn.jsdelivr.net/gh/jshttp/mime-db@master/db.json +``` + +## Usage + + + +```js +var db = require('mime-db') + +// grab data on .js files +var data = db['application/javascript'] +``` + +## Data Structure + +The JSON file is a map lookup for lowercased mime types. +Each mime type has the following properties: + +- `.source` - where the mime type is defined. + If not set, it's probably a custom media type. + - `apache` - [Apache common media types](http://svn.apache.org/repos/asf/httpd/httpd/trunk/docs/conf/mime.types) + - `iana` - [IANA-defined media types](http://www.iana.org/assignments/media-types/media-types.xhtml) + - `nginx` - [nginx media types](http://hg.nginx.org/nginx/raw-file/default/conf/mime.types) +- `.extensions[]` - known extensions associated with this mime type. +- `.compressible` - whether a file of this type can be gzipped. +- `.charset` - the default charset associated with this type, if any. + +If unknown, every property could be `undefined`. + +## Contributing + +To edit the database, only make PRs against `src/custom.json` or +`src/custom-suffix.json`. + +The `src/custom.json` file is a JSON object with the MIME type as the keys +and the values being an object with the following keys: + +- `compressible` - leave out if you don't know, otherwise `true`/`false` to + indicate whether the data represented by the type is typically compressible. +- `extensions` - include an array of file extensions that are associated with + the type. +- `notes` - human-readable notes about the type, typically what the type is. +- `sources` - include an array of URLs of where the MIME type and the associated + extensions are sourced from. This needs to be a [primary source](https://en.wikipedia.org/wiki/Primary_source); + links to type aggregating sites and Wikipedia are _not acceptable_. + +To update the build, run `npm run build`. + +### Adding Custom Media Types + +The best way to get new media types included in this library is to register +them with the IANA. The community registration procedure is outlined in +[RFC 6838 section 5](http://tools.ietf.org/html/rfc6838#section-5). Types +registered with the IANA are automatically pulled into this library. + +If that is not possible / feasible, they can be added directly here as a +"custom" type. To do this, it is required to have a primary source that +definitively lists the media type. If an extension is going to be listed as +associateed with this media type, the source must definitively link the +media type and extension as well. + +[coveralls-image]: https://badgen.net/coveralls/c/github/jshttp/mime-db/master +[coveralls-url]: https://coveralls.io/r/jshttp/mime-db?branch=master +[node-image]: https://badgen.net/npm/node/mime-db +[node-url]: https://nodejs.org/en/download +[npm-downloads-image]: https://badgen.net/npm/dm/mime-db +[npm-url]: https://npmjs.org/package/mime-db +[npm-version-image]: https://badgen.net/npm/v/mime-db +[travis-image]: https://badgen.net/travis/jshttp/mime-db/master +[travis-url]: https://travis-ci.org/jshttp/mime-db diff --git a/node_modules/mime-db/db.json b/node_modules/mime-db/db.json new file mode 100644 index 0000000..e69f352 --- /dev/null +++ b/node_modules/mime-db/db.json @@ -0,0 +1,8176 @@ +{ + "application/1d-interleaved-parityfec": { + "source": "iana" + }, + "application/3gpdash-qoe-report+xml": { + "source": "iana", + "charset": "UTF-8", + "compressible": true + }, + "application/3gpp-ims+xml": { + "source": "iana", + "compressible": true + }, + "application/a2l": { + "source": "iana" + }, + "application/activemessage": { + "source": "iana" + }, + "application/activity+json": { + "source": "iana", + "compressible": true + }, + "application/alto-costmap+json": { + "source": "iana", + "compressible": true + }, + "application/alto-costmapfilter+json": { + "source": "iana", + "compressible": true + }, + "application/alto-directory+json": { + "source": "iana", + "compressible": true + }, + "application/alto-endpointcost+json": { + "source": "iana", + "compressible": true + }, + "application/alto-endpointcostparams+json": { + "source": "iana", + "compressible": true + }, + "application/alto-endpointprop+json": { + "source": "iana", + "compressible": true + }, + "application/alto-endpointpropparams+json": { + "source": "iana", + "compressible": true + }, + "application/alto-error+json": { + "source": "iana", + "compressible": true + }, + "application/alto-networkmap+json": { + "source": "iana", + "compressible": true + }, + "application/alto-networkmapfilter+json": { + "source": "iana", + "compressible": true + }, + "application/alto-updatestreamcontrol+json": { + "source": "iana", + "compressible": true + }, + "application/alto-updatestreamparams+json": { + "source": "iana", + "compressible": true + }, + "application/aml": { + "source": "iana" + }, + "application/andrew-inset": { + "source": "iana", + "extensions": ["ez"] + }, + "application/applefile": { + "source": "iana" + }, + "application/applixware": { + "source": "apache", + "extensions": ["aw"] + }, + "application/atf": { + "source": "iana" + }, + "application/atfx": { + "source": "iana" + }, + "application/atom+xml": { + "source": "iana", + "compressible": true, + "extensions": ["atom"] + }, + "application/atomcat+xml": { + "source": "iana", + "compressible": true, + "extensions": ["atomcat"] + }, + "application/atomdeleted+xml": { + "source": "iana", + "compressible": true, + "extensions": ["atomdeleted"] + }, + "application/atomicmail": { + "source": "iana" + }, + "application/atomsvc+xml": { + "source": "iana", + "compressible": true, + "extensions": ["atomsvc"] + }, + "application/atsc-dwd+xml": { + "source": "iana", + "compressible": true, + "extensions": ["dwd"] + }, + "application/atsc-dynamic-event-message": { + "source": "iana" + }, + "application/atsc-held+xml": { + "source": "iana", + "compressible": true, + "extensions": ["held"] + }, + "application/atsc-rdt+json": { + "source": "iana", + "compressible": true + }, + "application/atsc-rsat+xml": { + "source": "iana", + "compressible": true, + "extensions": ["rsat"] + }, + "application/atxml": { + "source": "iana" + }, + "application/auth-policy+xml": { + "source": "iana", + "compressible": true + }, + "application/bacnet-xdd+zip": { + "source": "iana", + "compressible": false + }, + "application/batch-smtp": { + "source": "iana" + }, + "application/bdoc": { + "compressible": false, + "extensions": ["bdoc"] + }, + "application/beep+xml": { + "source": "iana", + "charset": "UTF-8", + "compressible": true + }, + "application/calendar+json": { + "source": "iana", + "compressible": true + }, + "application/calendar+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xcs"] + }, + "application/call-completion": { + "source": "iana" + }, + "application/cals-1840": { + "source": "iana" + }, + "application/cap+xml": { + "source": "iana", + "charset": "UTF-8", + "compressible": true + }, + "application/cbor": { + "source": "iana" + }, + "application/cbor-seq": { + "source": "iana" + }, + "application/cccex": { + "source": "iana" + }, + "application/ccmp+xml": { + "source": "iana", + "compressible": true + }, + "application/ccxml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["ccxml"] + }, + "application/cdfx+xml": { + "source": "iana", + "compressible": true, + "extensions": ["cdfx"] + }, + "application/cdmi-capability": { + "source": "iana", + "extensions": ["cdmia"] + }, + "application/cdmi-container": { + "source": "iana", + "extensions": ["cdmic"] + }, + "application/cdmi-domain": { + "source": "iana", + "extensions": ["cdmid"] + }, + "application/cdmi-object": { + "source": "iana", + "extensions": ["cdmio"] + }, + "application/cdmi-queue": { + "source": "iana", + "extensions": ["cdmiq"] + }, + "application/cdni": { + "source": "iana" + }, + "application/cea": { + "source": "iana" + }, + "application/cea-2018+xml": { + "source": "iana", + "compressible": true + }, + "application/cellml+xml": { + "source": "iana", + "compressible": true + }, + "application/cfw": { + "source": "iana" + }, + "application/clue+xml": { + "source": "iana", + "compressible": true + }, + "application/clue_info+xml": { + "source": "iana", + "compressible": true + }, + "application/cms": { + "source": "iana" + }, + "application/cnrp+xml": { + "source": "iana", + "compressible": true + }, + "application/coap-group+json": { + "source": "iana", + "compressible": true + }, + "application/coap-payload": { + "source": "iana" + }, + "application/commonground": { + "source": "iana" + }, + "application/conference-info+xml": { + "source": "iana", + "compressible": true + }, + "application/cose": { + "source": "iana" + }, + "application/cose-key": { + "source": "iana" + }, + "application/cose-key-set": { + "source": "iana" + }, + "application/cpl+xml": { + "source": "iana", + "compressible": true + }, + "application/csrattrs": { + "source": "iana" + }, + "application/csta+xml": { + "source": "iana", + "compressible": true + }, + "application/cstadata+xml": { + "source": "iana", + "compressible": true + }, + "application/csvm+json": { + "source": "iana", + "compressible": true + }, + "application/cu-seeme": { + "source": "apache", + "extensions": ["cu"] + }, + "application/cwt": { + "source": "iana" + }, + "application/cybercash": { + "source": "iana" + }, + "application/dart": { + "compressible": true + }, + "application/dash+xml": { + "source": "iana", + "compressible": true, + "extensions": ["mpd"] + }, + "application/dashdelta": { + "source": "iana" + }, + "application/davmount+xml": { + "source": "iana", + "compressible": true, + "extensions": ["davmount"] + }, + "application/dca-rft": { + "source": "iana" + }, + "application/dcd": { + "source": "iana" + }, + "application/dec-dx": { + "source": "iana" + }, + "application/dialog-info+xml": { + "source": "iana", + "compressible": true + }, + "application/dicom": { + "source": "iana" + }, + "application/dicom+json": { + "source": "iana", + "compressible": true + }, + "application/dicom+xml": { + "source": "iana", + "compressible": true + }, + "application/dii": { + "source": "iana" + }, + "application/dit": { + "source": "iana" + }, + "application/dns": { + "source": "iana" + }, + "application/dns+json": { + "source": "iana", + "compressible": true + }, + "application/dns-message": { + "source": "iana" + }, + "application/docbook+xml": { + "source": "apache", + "compressible": true, + "extensions": ["dbk"] + }, + "application/dots+cbor": { + "source": "iana" + }, + "application/dskpp+xml": { + "source": "iana", + "compressible": true + }, + "application/dssc+der": { + "source": "iana", + "extensions": ["dssc"] + }, + "application/dssc+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xdssc"] + }, + "application/dvcs": { + "source": "iana" + }, + "application/ecmascript": { + "source": "iana", + "compressible": true, + "extensions": ["ecma","es"] + }, + "application/edi-consent": { + "source": "iana" + }, + "application/edi-x12": { + "source": "iana", + "compressible": false + }, + "application/edifact": { + "source": "iana", + "compressible": false + }, + "application/efi": { + "source": "iana" + }, + "application/emergencycalldata.comment+xml": { + "source": "iana", + "compressible": true + }, + "application/emergencycalldata.control+xml": { + "source": "iana", + "compressible": true + }, + "application/emergencycalldata.deviceinfo+xml": { + "source": "iana", + "compressible": true + }, + "application/emergencycalldata.ecall.msd": { + "source": "iana" + }, + "application/emergencycalldata.providerinfo+xml": { + "source": "iana", + "compressible": true + }, + "application/emergencycalldata.serviceinfo+xml": { + "source": "iana", + "compressible": true + }, + "application/emergencycalldata.subscriberinfo+xml": { + "source": "iana", + "compressible": true + }, + "application/emergencycalldata.veds+xml": { + "source": "iana", + "compressible": true + }, + "application/emma+xml": { + "source": "iana", + "compressible": true, + "extensions": ["emma"] + }, + "application/emotionml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["emotionml"] + }, + "application/encaprtp": { + "source": "iana" + }, + "application/epp+xml": { + "source": "iana", + "compressible": true + }, + "application/epub+zip": { + "source": "iana", + "compressible": false, + "extensions": ["epub"] + }, + "application/eshop": { + "source": "iana" + }, + "application/exi": { + "source": "iana", + "extensions": ["exi"] + }, + "application/expect-ct-report+json": { + "source": "iana", + "compressible": true + }, + "application/fastinfoset": { + "source": "iana" + }, + "application/fastsoap": { + "source": "iana" + }, + "application/fdt+xml": { + "source": "iana", + "compressible": true, + "extensions": ["fdt"] + }, + "application/fhir+json": { + "source": "iana", + "charset": "UTF-8", + "compressible": true + }, + "application/fhir+xml": { + "source": "iana", + "charset": "UTF-8", + "compressible": true + }, + "application/fido.trusted-apps+json": { + "compressible": true + }, + "application/fits": { + "source": "iana" + }, + "application/flexfec": { + "source": "iana" + }, + "application/font-sfnt": { + "source": "iana" + }, + "application/font-tdpfr": { + "source": "iana", + "extensions": ["pfr"] + }, + "application/font-woff": { + "source": "iana", + "compressible": false + }, + "application/framework-attributes+xml": { + "source": "iana", + "compressible": true + }, + "application/geo+json": { + "source": "iana", + "compressible": true, + "extensions": ["geojson"] + }, + "application/geo+json-seq": { + "source": "iana" + }, + "application/geopackage+sqlite3": { + "source": "iana" + }, + "application/geoxacml+xml": { + "source": "iana", + "compressible": true + }, + "application/gltf-buffer": { + "source": "iana" + }, + "application/gml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["gml"] + }, + "application/gpx+xml": { + "source": "apache", + "compressible": true, + "extensions": ["gpx"] + }, + "application/gxf": { + "source": "apache", + "extensions": ["gxf"] + }, + "application/gzip": { + "source": "iana", + "compressible": false, + "extensions": ["gz"] + }, + "application/h224": { + "source": "iana" + }, + "application/held+xml": { + "source": "iana", + "compressible": true + }, + "application/hjson": { + "extensions": ["hjson"] + }, + "application/http": { + "source": "iana" + }, + "application/hyperstudio": { + "source": "iana", + "extensions": ["stk"] + }, + "application/ibe-key-request+xml": { + "source": "iana", + "compressible": true + }, + "application/ibe-pkg-reply+xml": { + "source": "iana", + "compressible": true + }, + "application/ibe-pp-data": { + "source": "iana" + }, + "application/iges": { + "source": "iana" + }, + "application/im-iscomposing+xml": { + "source": "iana", + "charset": "UTF-8", + "compressible": true + }, + "application/index": { + "source": "iana" + }, + "application/index.cmd": { + "source": "iana" + }, + "application/index.obj": { + "source": "iana" + }, + "application/index.response": { + "source": "iana" + }, + "application/index.vnd": { + "source": "iana" + }, + "application/inkml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["ink","inkml"] + }, + "application/iotp": { + "source": "iana" + }, + "application/ipfix": { + "source": "iana", + "extensions": ["ipfix"] + }, + "application/ipp": { + "source": "iana" + }, + "application/isup": { + "source": "iana" + }, + "application/its+xml": { + "source": "iana", + "compressible": true, + "extensions": ["its"] + }, + "application/java-archive": { + "source": "apache", + "compressible": false, + "extensions": ["jar","war","ear"] + }, + "application/java-serialized-object": { + "source": "apache", + "compressible": false, + "extensions": ["ser"] + }, + "application/java-vm": { + "source": "apache", + "compressible": false, + "extensions": ["class"] + }, + "application/javascript": { + "source": "iana", + "charset": "UTF-8", + "compressible": true, + "extensions": ["js","mjs"] + }, + "application/jf2feed+json": { + "source": "iana", + "compressible": true + }, + "application/jose": { + "source": "iana" + }, + "application/jose+json": { + "source": "iana", + "compressible": true + }, + "application/jrd+json": { + "source": "iana", + "compressible": true + }, + "application/json": { + "source": "iana", + "charset": "UTF-8", + "compressible": true, + "extensions": ["json","map"] + }, + "application/json-patch+json": { + "source": "iana", + "compressible": true + }, + "application/json-seq": { + "source": "iana" + }, + "application/json5": { + "extensions": ["json5"] + }, + "application/jsonml+json": { + "source": "apache", + "compressible": true, + "extensions": ["jsonml"] + }, + "application/jwk+json": { + "source": "iana", + "compressible": true + }, + "application/jwk-set+json": { + "source": "iana", + "compressible": true + }, + "application/jwt": { + "source": "iana" + }, + "application/kpml-request+xml": { + "source": "iana", + "compressible": true + }, + "application/kpml-response+xml": { + "source": "iana", + "compressible": true + }, + "application/ld+json": { + "source": "iana", + "compressible": true, + "extensions": ["jsonld"] + }, + "application/lgr+xml": { + "source": "iana", + "compressible": true, + "extensions": ["lgr"] + }, + "application/link-format": { + "source": "iana" + }, + "application/load-control+xml": { + "source": "iana", + "compressible": true + }, + "application/lost+xml": { + "source": "iana", + "compressible": true, + "extensions": ["lostxml"] + }, + "application/lostsync+xml": { + "source": "iana", + "compressible": true + }, + "application/lpf+zip": { + "source": "iana", + "compressible": false + }, + "application/lxf": { + "source": "iana" + }, + "application/mac-binhex40": { + "source": "iana", + "extensions": ["hqx"] + }, + "application/mac-compactpro": { + "source": "apache", + "extensions": ["cpt"] + }, + "application/macwriteii": { + "source": "iana" + }, + "application/mads+xml": { + "source": "iana", + "compressible": true, + "extensions": ["mads"] + }, + "application/manifest+json": { + "charset": "UTF-8", + "compressible": true, + "extensions": ["webmanifest"] + }, + "application/marc": { + "source": "iana", + "extensions": ["mrc"] + }, + "application/marcxml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["mrcx"] + }, + "application/mathematica": { + "source": "iana", + "extensions": ["ma","nb","mb"] + }, + "application/mathml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["mathml"] + }, + "application/mathml-content+xml": { + "source": "iana", + "compressible": true + }, + "application/mathml-presentation+xml": { + "source": "iana", + "compressible": true + }, + "application/mbms-associated-procedure-description+xml": { + "source": "iana", + "compressible": true + }, + "application/mbms-deregister+xml": { + "source": "iana", + "compressible": true + }, + "application/mbms-envelope+xml": { + "source": "iana", + "compressible": true + }, + "application/mbms-msk+xml": { + "source": "iana", + "compressible": true + }, + "application/mbms-msk-response+xml": { + "source": "iana", + "compressible": true + }, + "application/mbms-protection-description+xml": { + "source": "iana", + "compressible": true + }, + "application/mbms-reception-report+xml": { + "source": "iana", + "compressible": true + }, + "application/mbms-register+xml": { + "source": "iana", + "compressible": true + }, + "application/mbms-register-response+xml": { + "source": "iana", + "compressible": true + }, + "application/mbms-schedule+xml": { + "source": "iana", + "compressible": true + }, + "application/mbms-user-service-description+xml": { + "source": "iana", + "compressible": true + }, + "application/mbox": { + "source": "iana", + "extensions": ["mbox"] + }, + "application/media-policy-dataset+xml": { + "source": "iana", + "compressible": true + }, + "application/media_control+xml": { + "source": "iana", + "compressible": true + }, + "application/mediaservercontrol+xml": { + "source": "iana", + "compressible": true, + "extensions": ["mscml"] + }, + "application/merge-patch+json": { + "source": "iana", + "compressible": true + }, + "application/metalink+xml": { + "source": "apache", + "compressible": true, + "extensions": ["metalink"] + }, + "application/metalink4+xml": { + "source": "iana", + "compressible": true, + "extensions": ["meta4"] + }, + "application/mets+xml": { + "source": "iana", + "compressible": true, + "extensions": ["mets"] + }, + "application/mf4": { + "source": "iana" + }, + "application/mikey": { + "source": "iana" + }, + "application/mipc": { + "source": "iana" + }, + "application/mmt-aei+xml": { + "source": "iana", + "compressible": true, + "extensions": ["maei"] + }, + "application/mmt-usd+xml": { + "source": "iana", + "compressible": true, + "extensions": ["musd"] + }, + "application/mods+xml": { + "source": "iana", + "compressible": true, + "extensions": ["mods"] + }, + "application/moss-keys": { + "source": "iana" + }, + "application/moss-signature": { + "source": "iana" + }, + "application/mosskey-data": { + "source": "iana" + }, + "application/mosskey-request": { + "source": "iana" + }, + "application/mp21": { + "source": "iana", + "extensions": ["m21","mp21"] + }, + "application/mp4": { + "source": "iana", + "extensions": ["mp4s","m4p"] + }, + "application/mpeg4-generic": { + "source": "iana" + }, + "application/mpeg4-iod": { + "source": "iana" + }, + "application/mpeg4-iod-xmt": { + "source": "iana" + }, + "application/mrb-consumer+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xdf"] + }, + "application/mrb-publish+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xdf"] + }, + "application/msc-ivr+xml": { + "source": "iana", + "charset": "UTF-8", + "compressible": true + }, + "application/msc-mixer+xml": { + "source": "iana", + "charset": "UTF-8", + "compressible": true + }, + "application/msword": { + "source": "iana", + "compressible": false, + "extensions": ["doc","dot"] + }, + "application/mud+json": { + "source": "iana", + "compressible": true + }, + "application/multipart-core": { + "source": "iana" + }, + "application/mxf": { + "source": "iana", + "extensions": ["mxf"] + }, + "application/n-quads": { + "source": "iana", + "extensions": ["nq"] + }, + "application/n-triples": { + "source": "iana", + "extensions": ["nt"] + }, + "application/nasdata": { + "source": "iana" + }, + "application/news-checkgroups": { + "source": "iana", + "charset": "US-ASCII" + }, + "application/news-groupinfo": { + "source": "iana", + "charset": "US-ASCII" + }, + "application/news-transmission": { + "source": "iana" + }, + "application/nlsml+xml": { + "source": "iana", + "compressible": true + }, + "application/node": { + "source": "iana", + "extensions": ["cjs"] + }, + "application/nss": { + "source": "iana" + }, + "application/ocsp-request": { + "source": "iana" + }, + "application/ocsp-response": { + "source": "iana" + }, + "application/octet-stream": { + "source": "iana", + "compressible": false, + "extensions": ["bin","dms","lrf","mar","so","dist","distz","pkg","bpk","dump","elc","deploy","exe","dll","deb","dmg","iso","img","msi","msp","msm","buffer"] + }, + "application/oda": { + "source": "iana", + "extensions": ["oda"] + }, + "application/odm+xml": { + "source": "iana", + "compressible": true + }, + "application/odx": { + "source": "iana" + }, + "application/oebps-package+xml": { + "source": "iana", + "compressible": true, + "extensions": ["opf"] + }, + "application/ogg": { + "source": "iana", + "compressible": false, + "extensions": ["ogx"] + }, + "application/omdoc+xml": { + "source": "apache", + "compressible": true, + "extensions": ["omdoc"] + }, + "application/onenote": { + "source": "apache", + "extensions": ["onetoc","onetoc2","onetmp","onepkg"] + }, + "application/oscore": { + "source": "iana" + }, + "application/oxps": { + "source": "iana", + "extensions": ["oxps"] + }, + "application/p2p-overlay+xml": { + "source": "iana", + "compressible": true, + "extensions": ["relo"] + }, + "application/parityfec": { + "source": "iana" + }, + "application/passport": { + "source": "iana" + }, + "application/patch-ops-error+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xer"] + }, + "application/pdf": { + "source": "iana", + "compressible": false, + "extensions": ["pdf"] + }, + "application/pdx": { + "source": "iana" + }, + "application/pem-certificate-chain": { + "source": "iana" + }, + "application/pgp-encrypted": { + "source": "iana", + "compressible": false, + "extensions": ["pgp"] + }, + "application/pgp-keys": { + "source": "iana" + }, + "application/pgp-signature": { + "source": "iana", + "extensions": ["asc","sig"] + }, + "application/pics-rules": { + "source": "apache", + "extensions": ["prf"] + }, + "application/pidf+xml": { + "source": "iana", + "charset": "UTF-8", + "compressible": true + }, + "application/pidf-diff+xml": { + "source": "iana", + "charset": "UTF-8", + "compressible": true + }, + "application/pkcs10": { + "source": "iana", + "extensions": ["p10"] + }, + "application/pkcs12": { + "source": "iana" + }, + "application/pkcs7-mime": { + "source": "iana", + "extensions": ["p7m","p7c"] + }, + "application/pkcs7-signature": { + "source": "iana", + "extensions": ["p7s"] + }, + "application/pkcs8": { + "source": "iana", + "extensions": ["p8"] + }, + "application/pkcs8-encrypted": { + "source": "iana" + }, + "application/pkix-attr-cert": { + "source": "iana", + "extensions": ["ac"] + }, + "application/pkix-cert": { + "source": "iana", + "extensions": ["cer"] + }, + "application/pkix-crl": { + "source": "iana", + "extensions": ["crl"] + }, + "application/pkix-pkipath": { + "source": "iana", + "extensions": ["pkipath"] + }, + "application/pkixcmp": { + "source": "iana", + "extensions": ["pki"] + }, + "application/pls+xml": { + "source": "iana", + "compressible": true, + "extensions": ["pls"] + }, + "application/poc-settings+xml": { + "source": "iana", + "charset": "UTF-8", + "compressible": true + }, + "application/postscript": { + "source": "iana", + "compressible": true, + "extensions": ["ai","eps","ps"] + }, + "application/ppsp-tracker+json": { + "source": "iana", + "compressible": true + }, + "application/problem+json": { + "source": "iana", + "compressible": true + }, + "application/problem+xml": { + "source": "iana", + "compressible": true + }, + "application/provenance+xml": { + "source": "iana", + "compressible": true, + "extensions": ["provx"] + }, + "application/prs.alvestrand.titrax-sheet": { + "source": "iana" + }, + "application/prs.cww": { + "source": "iana", + "extensions": ["cww"] + }, + "application/prs.hpub+zip": { + "source": "iana", + "compressible": false + }, + "application/prs.nprend": { + "source": "iana" + }, + "application/prs.plucker": { + "source": "iana" + }, + "application/prs.rdf-xml-crypt": { + "source": "iana" + }, + "application/prs.xsf+xml": { + "source": "iana", + "compressible": true + }, + "application/pskc+xml": { + "source": "iana", + "compressible": true, + "extensions": ["pskcxml"] + }, + "application/pvd+json": { + "source": "iana", + "compressible": true + }, + "application/qsig": { + "source": "iana" + }, + "application/raml+yaml": { + "compressible": true, + "extensions": ["raml"] + }, + "application/raptorfec": { + "source": "iana" + }, + "application/rdap+json": { + "source": "iana", + "compressible": true + }, + "application/rdf+xml": { + "source": "iana", + "compressible": true, + "extensions": ["rdf","owl"] + }, + "application/reginfo+xml": { + "source": "iana", + "compressible": true, + "extensions": ["rif"] + }, + "application/relax-ng-compact-syntax": { + "source": "iana", + "extensions": ["rnc"] + }, + "application/remote-printing": { + "source": "iana" + }, + "application/reputon+json": { + "source": "iana", + "compressible": true + }, + "application/resource-lists+xml": { + "source": "iana", + "compressible": true, + "extensions": ["rl"] + }, + "application/resource-lists-diff+xml": { + "source": "iana", + "compressible": true, + "extensions": ["rld"] + }, + "application/rfc+xml": { + "source": "iana", + "compressible": true + }, + "application/riscos": { + "source": "iana" + }, + "application/rlmi+xml": { + "source": "iana", + "compressible": true + }, + "application/rls-services+xml": { + "source": "iana", + "compressible": true, + "extensions": ["rs"] + }, + "application/route-apd+xml": { + "source": "iana", + "compressible": true, + "extensions": ["rapd"] + }, + "application/route-s-tsid+xml": { + "source": "iana", + "compressible": true, + "extensions": ["sls"] + }, + "application/route-usd+xml": { + "source": "iana", + "compressible": true, + "extensions": ["rusd"] + }, + "application/rpki-ghostbusters": { + "source": "iana", + "extensions": ["gbr"] + }, + "application/rpki-manifest": { + "source": "iana", + "extensions": ["mft"] + }, + "application/rpki-publication": { + "source": "iana" + }, + "application/rpki-roa": { + "source": "iana", + "extensions": ["roa"] + }, + "application/rpki-updown": { + "source": "iana" + }, + "application/rsd+xml": { + "source": "apache", + "compressible": true, + "extensions": ["rsd"] + }, + "application/rss+xml": { + "source": "apache", + "compressible": true, + "extensions": ["rss"] + }, + "application/rtf": { + "source": "iana", + "compressible": true, + "extensions": ["rtf"] + }, + "application/rtploopback": { + "source": "iana" + }, + "application/rtx": { + "source": "iana" + }, + "application/samlassertion+xml": { + "source": "iana", + "compressible": true + }, + "application/samlmetadata+xml": { + "source": "iana", + "compressible": true + }, + "application/sbe": { + "source": "iana" + }, + "application/sbml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["sbml"] + }, + "application/scaip+xml": { + "source": "iana", + "compressible": true + }, + "application/scim+json": { + "source": "iana", + "compressible": true + }, + "application/scvp-cv-request": { + "source": "iana", + "extensions": ["scq"] + }, + "application/scvp-cv-response": { + "source": "iana", + "extensions": ["scs"] + }, + "application/scvp-vp-request": { + "source": "iana", + "extensions": ["spq"] + }, + "application/scvp-vp-response": { + "source": "iana", + "extensions": ["spp"] + }, + "application/sdp": { + "source": "iana", + "extensions": ["sdp"] + }, + "application/secevent+jwt": { + "source": "iana" + }, + "application/senml+cbor": { + "source": "iana" + }, + "application/senml+json": { + "source": "iana", + "compressible": true + }, + "application/senml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["senmlx"] + }, + "application/senml-etch+cbor": { + "source": "iana" + }, + "application/senml-etch+json": { + "source": "iana", + "compressible": true + }, + "application/senml-exi": { + "source": "iana" + }, + "application/sensml+cbor": { + "source": "iana" + }, + "application/sensml+json": { + "source": "iana", + "compressible": true + }, + "application/sensml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["sensmlx"] + }, + "application/sensml-exi": { + "source": "iana" + }, + "application/sep+xml": { + "source": "iana", + "compressible": true + }, + "application/sep-exi": { + "source": "iana" + }, + "application/session-info": { + "source": "iana" + }, + "application/set-payment": { + "source": "iana" + }, + "application/set-payment-initiation": { + "source": "iana", + "extensions": ["setpay"] + }, + "application/set-registration": { + "source": "iana" + }, + "application/set-registration-initiation": { + "source": "iana", + "extensions": ["setreg"] + }, + "application/sgml": { + "source": "iana" + }, + "application/sgml-open-catalog": { + "source": "iana" + }, + "application/shf+xml": { + "source": "iana", + "compressible": true, + "extensions": ["shf"] + }, + "application/sieve": { + "source": "iana", + "extensions": ["siv","sieve"] + }, + "application/simple-filter+xml": { + "source": "iana", + "compressible": true + }, + "application/simple-message-summary": { + "source": "iana" + }, + "application/simplesymbolcontainer": { + "source": "iana" + }, + "application/sipc": { + "source": "iana" + }, + "application/slate": { + "source": "iana" + }, + "application/smil": { + "source": "iana" + }, + "application/smil+xml": { + "source": "iana", + "compressible": true, + "extensions": ["smi","smil"] + }, + "application/smpte336m": { + "source": "iana" + }, + "application/soap+fastinfoset": { + "source": "iana" + }, + "application/soap+xml": { + "source": "iana", + "compressible": true + }, + "application/sparql-query": { + "source": "iana", + "extensions": ["rq"] + }, + "application/sparql-results+xml": { + "source": "iana", + "compressible": true, + "extensions": ["srx"] + }, + "application/spirits-event+xml": { + "source": "iana", + "compressible": true + }, + "application/sql": { + "source": "iana" + }, + "application/srgs": { + "source": "iana", + "extensions": ["gram"] + }, + "application/srgs+xml": { + "source": "iana", + "compressible": true, + "extensions": ["grxml"] + }, + "application/sru+xml": { + "source": "iana", + "compressible": true, + "extensions": ["sru"] + }, + "application/ssdl+xml": { + "source": "apache", + "compressible": true, + "extensions": ["ssdl"] + }, + "application/ssml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["ssml"] + }, + "application/stix+json": { + "source": "iana", + "compressible": true + }, + "application/swid+xml": { + "source": "iana", + "compressible": true, + "extensions": ["swidtag"] + }, + "application/tamp-apex-update": { + "source": "iana" + }, + "application/tamp-apex-update-confirm": { + "source": "iana" + }, + "application/tamp-community-update": { + "source": "iana" + }, + "application/tamp-community-update-confirm": { + "source": "iana" + }, + "application/tamp-error": { + "source": "iana" + }, + "application/tamp-sequence-adjust": { + "source": "iana" + }, + "application/tamp-sequence-adjust-confirm": { + "source": "iana" + }, + "application/tamp-status-query": { + "source": "iana" + }, + "application/tamp-status-response": { + "source": "iana" + }, + "application/tamp-update": { + "source": "iana" + }, + "application/tamp-update-confirm": { + "source": "iana" + }, + "application/tar": { + "compressible": true + }, + "application/taxii+json": { + "source": "iana", + "compressible": true + }, + "application/td+json": { + "source": "iana", + "compressible": true + }, + "application/tei+xml": { + "source": "iana", + "compressible": true, + "extensions": ["tei","teicorpus"] + }, + "application/tetra_isi": { + "source": "iana" + }, + "application/thraud+xml": { + "source": "iana", + "compressible": true, + "extensions": ["tfi"] + }, + "application/timestamp-query": { + "source": "iana" + }, + "application/timestamp-reply": { + "source": "iana" + }, + "application/timestamped-data": { + "source": "iana", + "extensions": ["tsd"] + }, + "application/tlsrpt+gzip": { + "source": "iana" + }, + "application/tlsrpt+json": { + "source": "iana", + "compressible": true + }, + "application/tnauthlist": { + "source": "iana" + }, + "application/toml": { + "compressible": true, + "extensions": ["toml"] + }, + "application/trickle-ice-sdpfrag": { + "source": "iana" + }, + "application/trig": { + "source": "iana" + }, + "application/ttml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["ttml"] + }, + "application/tve-trigger": { + "source": "iana" + }, + "application/tzif": { + "source": "iana" + }, + "application/tzif-leap": { + "source": "iana" + }, + "application/ulpfec": { + "source": "iana" + }, + "application/urc-grpsheet+xml": { + "source": "iana", + "compressible": true + }, + "application/urc-ressheet+xml": { + "source": "iana", + "compressible": true, + "extensions": ["rsheet"] + }, + "application/urc-targetdesc+xml": { + "source": "iana", + "compressible": true + }, + "application/urc-uisocketdesc+xml": { + "source": "iana", + "compressible": true + }, + "application/vcard+json": { + "source": "iana", + "compressible": true + }, + "application/vcard+xml": { + "source": "iana", + "compressible": true + }, + "application/vemmi": { + "source": "iana" + }, + "application/vividence.scriptfile": { + "source": "apache" + }, + "application/vnd.1000minds.decision-model+xml": { + "source": "iana", + "compressible": true, + "extensions": ["1km"] + }, + "application/vnd.3gpp-prose+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp-prose-pc3ch+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp-v2x-local-service-information": { + "source": "iana" + }, + "application/vnd.3gpp.access-transfer-events+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.bsf+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.gmop+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mc-signalling-ear": { + "source": "iana" + }, + "application/vnd.3gpp.mcdata-affiliation-command+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcdata-info+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcdata-payload": { + "source": "iana" + }, + "application/vnd.3gpp.mcdata-service-config+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcdata-signalling": { + "source": "iana" + }, + "application/vnd.3gpp.mcdata-ue-config+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcdata-user-profile+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcptt-affiliation-command+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcptt-floor-request+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcptt-info+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcptt-location-info+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcptt-mbms-usage-info+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcptt-service-config+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcptt-signed+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcptt-ue-config+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcptt-ue-init-config+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcptt-user-profile+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcvideo-affiliation-command+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcvideo-affiliation-info+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcvideo-info+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcvideo-location-info+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcvideo-mbms-usage-info+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcvideo-service-config+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcvideo-transmission-request+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcvideo-ue-config+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mcvideo-user-profile+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.mid-call+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.pic-bw-large": { + "source": "iana", + "extensions": ["plb"] + }, + "application/vnd.3gpp.pic-bw-small": { + "source": "iana", + "extensions": ["psb"] + }, + "application/vnd.3gpp.pic-bw-var": { + "source": "iana", + "extensions": ["pvb"] + }, + "application/vnd.3gpp.sms": { + "source": "iana" + }, + "application/vnd.3gpp.sms+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.srvcc-ext+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.srvcc-info+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.state-and-event-info+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp.ussd+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp2.bcmcsinfo+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.3gpp2.sms": { + "source": "iana" + }, + "application/vnd.3gpp2.tcap": { + "source": "iana", + "extensions": ["tcap"] + }, + "application/vnd.3lightssoftware.imagescal": { + "source": "iana" + }, + "application/vnd.3m.post-it-notes": { + "source": "iana", + "extensions": ["pwn"] + }, + "application/vnd.accpac.simply.aso": { + "source": "iana", + "extensions": ["aso"] + }, + "application/vnd.accpac.simply.imp": { + "source": "iana", + "extensions": ["imp"] + }, + "application/vnd.acucobol": { + "source": "iana", + "extensions": ["acu"] + }, + "application/vnd.acucorp": { + "source": "iana", + "extensions": ["atc","acutc"] + }, + "application/vnd.adobe.air-application-installer-package+zip": { + "source": "apache", + "compressible": false, + "extensions": ["air"] + }, + "application/vnd.adobe.flash.movie": { + "source": "iana" + }, + "application/vnd.adobe.formscentral.fcdt": { + "source": "iana", + "extensions": ["fcdt"] + }, + "application/vnd.adobe.fxp": { + "source": "iana", + "extensions": ["fxp","fxpl"] + }, + "application/vnd.adobe.partial-upload": { + "source": "iana" + }, + "application/vnd.adobe.xdp+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xdp"] + }, + "application/vnd.adobe.xfdf": { + "source": "iana", + "extensions": ["xfdf"] + }, + "application/vnd.aether.imp": { + "source": "iana" + }, + "application/vnd.afpc.afplinedata": { + "source": "iana" + }, + "application/vnd.afpc.afplinedata-pagedef": { + "source": "iana" + }, + "application/vnd.afpc.foca-charset": { + "source": "iana" + }, + "application/vnd.afpc.foca-codedfont": { + "source": "iana" + }, + "application/vnd.afpc.foca-codepage": { + "source": "iana" + }, + "application/vnd.afpc.modca": { + "source": "iana" + }, + "application/vnd.afpc.modca-formdef": { + "source": "iana" + }, + "application/vnd.afpc.modca-mediummap": { + "source": "iana" + }, + "application/vnd.afpc.modca-objectcontainer": { + "source": "iana" + }, + "application/vnd.afpc.modca-overlay": { + "source": "iana" + }, + "application/vnd.afpc.modca-pagesegment": { + "source": "iana" + }, + "application/vnd.ah-barcode": { + "source": "iana" + }, + "application/vnd.ahead.space": { + "source": "iana", + "extensions": ["ahead"] + }, + "application/vnd.airzip.filesecure.azf": { + "source": "iana", + "extensions": ["azf"] + }, + "application/vnd.airzip.filesecure.azs": { + "source": "iana", + "extensions": ["azs"] + }, + "application/vnd.amadeus+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.amazon.ebook": { + "source": "apache", + "extensions": ["azw"] + }, + "application/vnd.amazon.mobi8-ebook": { + "source": "iana" + }, + "application/vnd.americandynamics.acc": { + "source": "iana", + "extensions": ["acc"] + }, + "application/vnd.amiga.ami": { + "source": "iana", + "extensions": ["ami"] + }, + "application/vnd.amundsen.maze+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.android.ota": { + "source": "iana" + }, + "application/vnd.android.package-archive": { + "source": "apache", + "compressible": false, + "extensions": ["apk"] + }, + "application/vnd.anki": { + "source": "iana" + }, + "application/vnd.anser-web-certificate-issue-initiation": { + "source": "iana", + "extensions": ["cii"] + }, + "application/vnd.anser-web-funds-transfer-initiation": { + "source": "apache", + "extensions": ["fti"] + }, + "application/vnd.antix.game-component": { + "source": "iana", + "extensions": ["atx"] + }, + "application/vnd.apache.thrift.binary": { + "source": "iana" + }, + "application/vnd.apache.thrift.compact": { + "source": "iana" + }, + "application/vnd.apache.thrift.json": { + "source": "iana" + }, + "application/vnd.api+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.aplextor.warrp+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.apothekende.reservation+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.apple.installer+xml": { + "source": "iana", + "compressible": true, + "extensions": ["mpkg"] + }, + "application/vnd.apple.keynote": { + "source": "iana", + "extensions": ["keynote"] + }, + "application/vnd.apple.mpegurl": { + "source": "iana", + "extensions": ["m3u8"] + }, + "application/vnd.apple.numbers": { + "source": "iana", + "extensions": ["numbers"] + }, + "application/vnd.apple.pages": { + "source": "iana", + "extensions": ["pages"] + }, + "application/vnd.apple.pkpass": { + "compressible": false, + "extensions": ["pkpass"] + }, + "application/vnd.arastra.swi": { + "source": "iana" + }, + "application/vnd.aristanetworks.swi": { + "source": "iana", + "extensions": ["swi"] + }, + "application/vnd.artisan+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.artsquare": { + "source": "iana" + }, + "application/vnd.astraea-software.iota": { + "source": "iana", + "extensions": ["iota"] + }, + "application/vnd.audiograph": { + "source": "iana", + "extensions": ["aep"] + }, + "application/vnd.autopackage": { + "source": "iana" + }, + "application/vnd.avalon+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.avistar+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.balsamiq.bmml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["bmml"] + }, + "application/vnd.balsamiq.bmpr": { + "source": "iana" + }, + "application/vnd.banana-accounting": { + "source": "iana" + }, + "application/vnd.bbf.usp.error": { + "source": "iana" + }, + "application/vnd.bbf.usp.msg": { + "source": "iana" + }, + "application/vnd.bbf.usp.msg+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.bekitzur-stech+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.bint.med-content": { + "source": "iana" + }, + "application/vnd.biopax.rdf+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.blink-idb-value-wrapper": { + "source": "iana" + }, + "application/vnd.blueice.multipass": { + "source": "iana", + "extensions": ["mpm"] + }, + "application/vnd.bluetooth.ep.oob": { + "source": "iana" + }, + "application/vnd.bluetooth.le.oob": { + "source": "iana" + }, + "application/vnd.bmi": { + "source": "iana", + "extensions": ["bmi"] + }, + "application/vnd.bpf": { + "source": "iana" + }, + "application/vnd.bpf3": { + "source": "iana" + }, + "application/vnd.businessobjects": { + "source": "iana", + "extensions": ["rep"] + }, + "application/vnd.byu.uapi+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.cab-jscript": { + "source": "iana" + }, + "application/vnd.canon-cpdl": { + "source": "iana" + }, + "application/vnd.canon-lips": { + "source": "iana" + }, + "application/vnd.capasystems-pg+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.cendio.thinlinc.clientconf": { + "source": "iana" + }, + "application/vnd.century-systems.tcp_stream": { + "source": "iana" + }, + "application/vnd.chemdraw+xml": { + "source": "iana", + "compressible": true, + "extensions": ["cdxml"] + }, + "application/vnd.chess-pgn": { + "source": "iana" + }, + "application/vnd.chipnuts.karaoke-mmd": { + "source": "iana", + "extensions": ["mmd"] + }, + "application/vnd.ciedi": { + "source": "iana" + }, + "application/vnd.cinderella": { + "source": "iana", + "extensions": ["cdy"] + }, + "application/vnd.cirpack.isdn-ext": { + "source": "iana" + }, + "application/vnd.citationstyles.style+xml": { + "source": "iana", + "compressible": true, + "extensions": ["csl"] + }, + "application/vnd.claymore": { + "source": "iana", + "extensions": ["cla"] + }, + "application/vnd.cloanto.rp9": { + "source": "iana", + "extensions": ["rp9"] + }, + "application/vnd.clonk.c4group": { + "source": "iana", + "extensions": ["c4g","c4d","c4f","c4p","c4u"] + }, + "application/vnd.cluetrust.cartomobile-config": { + "source": "iana", + "extensions": ["c11amc"] + }, + "application/vnd.cluetrust.cartomobile-config-pkg": { + "source": "iana", + "extensions": ["c11amz"] + }, + "application/vnd.coffeescript": { + "source": "iana" + }, + "application/vnd.collabio.xodocuments.document": { + "source": "iana" + }, + "application/vnd.collabio.xodocuments.document-template": { + "source": "iana" + }, + "application/vnd.collabio.xodocuments.presentation": { + "source": "iana" + }, + "application/vnd.collabio.xodocuments.presentation-template": { + "source": "iana" + }, + "application/vnd.collabio.xodocuments.spreadsheet": { + "source": "iana" + }, + "application/vnd.collabio.xodocuments.spreadsheet-template": { + "source": "iana" + }, + "application/vnd.collection+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.collection.doc+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.collection.next+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.comicbook+zip": { + "source": "iana", + "compressible": false + }, + "application/vnd.comicbook-rar": { + "source": "iana" + }, + "application/vnd.commerce-battelle": { + "source": "iana" + }, + "application/vnd.commonspace": { + "source": "iana", + "extensions": ["csp"] + }, + "application/vnd.contact.cmsg": { + "source": "iana", + "extensions": ["cdbcmsg"] + }, + "application/vnd.coreos.ignition+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.cosmocaller": { + "source": "iana", + "extensions": ["cmc"] + }, + "application/vnd.crick.clicker": { + "source": "iana", + "extensions": ["clkx"] + }, + "application/vnd.crick.clicker.keyboard": { + "source": "iana", + "extensions": ["clkk"] + }, + "application/vnd.crick.clicker.palette": { + "source": "iana", + "extensions": ["clkp"] + }, + "application/vnd.crick.clicker.template": { + "source": "iana", + "extensions": ["clkt"] + }, + "application/vnd.crick.clicker.wordbank": { + "source": "iana", + "extensions": ["clkw"] + }, + "application/vnd.criticaltools.wbs+xml": { + "source": "iana", + "compressible": true, + "extensions": ["wbs"] + }, + "application/vnd.cryptii.pipe+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.crypto-shade-file": { + "source": "iana" + }, + "application/vnd.ctc-posml": { + "source": "iana", + "extensions": ["pml"] + }, + "application/vnd.ctct.ws+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.cups-pdf": { + "source": "iana" + }, + "application/vnd.cups-postscript": { + "source": "iana" + }, + "application/vnd.cups-ppd": { + "source": "iana", + "extensions": ["ppd"] + }, + "application/vnd.cups-raster": { + "source": "iana" + }, + "application/vnd.cups-raw": { + "source": "iana" + }, + "application/vnd.curl": { + "source": "iana" + }, + "application/vnd.curl.car": { + "source": "apache", + "extensions": ["car"] + }, + "application/vnd.curl.pcurl": { + "source": "apache", + "extensions": ["pcurl"] + }, + "application/vnd.cyan.dean.root+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.cybank": { + "source": "iana" + }, + "application/vnd.d2l.coursepackage1p0+zip": { + "source": "iana", + "compressible": false + }, + "application/vnd.dart": { + "source": "iana", + "compressible": true, + "extensions": ["dart"] + }, + "application/vnd.data-vision.rdz": { + "source": "iana", + "extensions": ["rdz"] + }, + "application/vnd.datapackage+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.dataresource+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.dbf": { + "source": "iana" + }, + "application/vnd.debian.binary-package": { + "source": "iana" + }, + "application/vnd.dece.data": { + "source": "iana", + "extensions": ["uvf","uvvf","uvd","uvvd"] + }, + "application/vnd.dece.ttml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["uvt","uvvt"] + }, + "application/vnd.dece.unspecified": { + "source": "iana", + "extensions": ["uvx","uvvx"] + }, + "application/vnd.dece.zip": { + "source": "iana", + "extensions": ["uvz","uvvz"] + }, + "application/vnd.denovo.fcselayout-link": { + "source": "iana", + "extensions": ["fe_launch"] + }, + "application/vnd.desmume.movie": { + "source": "iana" + }, + "application/vnd.dir-bi.plate-dl-nosuffix": { + "source": "iana" + }, + "application/vnd.dm.delegation+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.dna": { + "source": "iana", + "extensions": ["dna"] + }, + "application/vnd.document+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.dolby.mlp": { + "source": "apache", + "extensions": ["mlp"] + }, + "application/vnd.dolby.mobile.1": { + "source": "iana" + }, + "application/vnd.dolby.mobile.2": { + "source": "iana" + }, + "application/vnd.doremir.scorecloud-binary-document": { + "source": "iana" + }, + "application/vnd.dpgraph": { + "source": "iana", + "extensions": ["dpg"] + }, + "application/vnd.dreamfactory": { + "source": "iana", + "extensions": ["dfac"] + }, + "application/vnd.drive+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.ds-keypoint": { + "source": "apache", + "extensions": ["kpxx"] + }, + "application/vnd.dtg.local": { + "source": "iana" + }, + "application/vnd.dtg.local.flash": { + "source": "iana" + }, + "application/vnd.dtg.local.html": { + "source": "iana" + }, + "application/vnd.dvb.ait": { + "source": "iana", + "extensions": ["ait"] + }, + "application/vnd.dvb.dvbisl+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.dvb.dvbj": { + "source": "iana" + }, + "application/vnd.dvb.esgcontainer": { + "source": "iana" + }, + "application/vnd.dvb.ipdcdftnotifaccess": { + "source": "iana" + }, + "application/vnd.dvb.ipdcesgaccess": { + "source": "iana" + }, + "application/vnd.dvb.ipdcesgaccess2": { + "source": "iana" + }, + "application/vnd.dvb.ipdcesgpdd": { + "source": "iana" + }, + "application/vnd.dvb.ipdcroaming": { + "source": "iana" + }, + "application/vnd.dvb.iptv.alfec-base": { + "source": "iana" + }, + "application/vnd.dvb.iptv.alfec-enhancement": { + "source": "iana" + }, + "application/vnd.dvb.notif-aggregate-root+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.dvb.notif-container+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.dvb.notif-generic+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.dvb.notif-ia-msglist+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.dvb.notif-ia-registration-request+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.dvb.notif-ia-registration-response+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.dvb.notif-init+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.dvb.pfr": { + "source": "iana" + }, + "application/vnd.dvb.service": { + "source": "iana", + "extensions": ["svc"] + }, + "application/vnd.dxr": { + "source": "iana" + }, + "application/vnd.dynageo": { + "source": "iana", + "extensions": ["geo"] + }, + "application/vnd.dzr": { + "source": "iana" + }, + "application/vnd.easykaraoke.cdgdownload": { + "source": "iana" + }, + "application/vnd.ecdis-update": { + "source": "iana" + }, + "application/vnd.ecip.rlp": { + "source": "iana" + }, + "application/vnd.ecowin.chart": { + "source": "iana", + "extensions": ["mag"] + }, + "application/vnd.ecowin.filerequest": { + "source": "iana" + }, + "application/vnd.ecowin.fileupdate": { + "source": "iana" + }, + "application/vnd.ecowin.series": { + "source": "iana" + }, + "application/vnd.ecowin.seriesrequest": { + "source": "iana" + }, + "application/vnd.ecowin.seriesupdate": { + "source": "iana" + }, + "application/vnd.efi.img": { + "source": "iana" + }, + "application/vnd.efi.iso": { + "source": "iana" + }, + "application/vnd.emclient.accessrequest+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.enliven": { + "source": "iana", + "extensions": ["nml"] + }, + "application/vnd.enphase.envoy": { + "source": "iana" + }, + "application/vnd.eprints.data+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.epson.esf": { + "source": "iana", + "extensions": ["esf"] + }, + "application/vnd.epson.msf": { + "source": "iana", + "extensions": ["msf"] + }, + "application/vnd.epson.quickanime": { + "source": "iana", + "extensions": ["qam"] + }, + "application/vnd.epson.salt": { + "source": "iana", + "extensions": ["slt"] + }, + "application/vnd.epson.ssf": { + "source": "iana", + "extensions": ["ssf"] + }, + "application/vnd.ericsson.quickcall": { + "source": "iana" + }, + "application/vnd.espass-espass+zip": { + "source": "iana", + "compressible": false + }, + "application/vnd.eszigno3+xml": { + "source": "iana", + "compressible": true, + "extensions": ["es3","et3"] + }, + "application/vnd.etsi.aoc+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.asic-e+zip": { + "source": "iana", + "compressible": false + }, + "application/vnd.etsi.asic-s+zip": { + "source": "iana", + "compressible": false + }, + "application/vnd.etsi.cug+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.iptvcommand+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.iptvdiscovery+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.iptvprofile+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.iptvsad-bc+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.iptvsad-cod+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.iptvsad-npvr+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.iptvservice+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.iptvsync+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.iptvueprofile+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.mcid+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.mheg5": { + "source": "iana" + }, + "application/vnd.etsi.overload-control-policy-dataset+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.pstn+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.sci+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.simservs+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.timestamp-token": { + "source": "iana" + }, + "application/vnd.etsi.tsl+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.etsi.tsl.der": { + "source": "iana" + }, + "application/vnd.eudora.data": { + "source": "iana" + }, + "application/vnd.evolv.ecig.profile": { + "source": "iana" + }, + "application/vnd.evolv.ecig.settings": { + "source": "iana" + }, + "application/vnd.evolv.ecig.theme": { + "source": "iana" + }, + "application/vnd.exstream-empower+zip": { + "source": "iana", + "compressible": false + }, + "application/vnd.exstream-package": { + "source": "iana" + }, + "application/vnd.ezpix-album": { + "source": "iana", + "extensions": ["ez2"] + }, + "application/vnd.ezpix-package": { + "source": "iana", + "extensions": ["ez3"] + }, + "application/vnd.f-secure.mobile": { + "source": "iana" + }, + "application/vnd.fastcopy-disk-image": { + "source": "iana" + }, + "application/vnd.fdf": { + "source": "iana", + "extensions": ["fdf"] + }, + "application/vnd.fdsn.mseed": { + "source": "iana", + "extensions": ["mseed"] + }, + "application/vnd.fdsn.seed": { + "source": "iana", + "extensions": ["seed","dataless"] + }, + "application/vnd.ffsns": { + "source": "iana" + }, + "application/vnd.ficlab.flb+zip": { + "source": "iana", + "compressible": false + }, + "application/vnd.filmit.zfc": { + "source": "iana" + }, + "application/vnd.fints": { + "source": "iana" + }, + "application/vnd.firemonkeys.cloudcell": { + "source": "iana" + }, + "application/vnd.flographit": { + "source": "iana", + "extensions": ["gph"] + }, + "application/vnd.fluxtime.clip": { + "source": "iana", + "extensions": ["ftc"] + }, + "application/vnd.font-fontforge-sfd": { + "source": "iana" + }, + "application/vnd.framemaker": { + "source": "iana", + "extensions": ["fm","frame","maker","book"] + }, + "application/vnd.frogans.fnc": { + "source": "iana", + "extensions": ["fnc"] + }, + "application/vnd.frogans.ltf": { + "source": "iana", + "extensions": ["ltf"] + }, + "application/vnd.fsc.weblaunch": { + "source": "iana", + "extensions": ["fsc"] + }, + "application/vnd.fujitsu.oasys": { + "source": "iana", + "extensions": ["oas"] + }, + "application/vnd.fujitsu.oasys2": { + "source": "iana", + "extensions": ["oa2"] + }, + "application/vnd.fujitsu.oasys3": { + "source": "iana", + "extensions": ["oa3"] + }, + "application/vnd.fujitsu.oasysgp": { + "source": "iana", + "extensions": ["fg5"] + }, + "application/vnd.fujitsu.oasysprs": { + "source": "iana", + "extensions": ["bh2"] + }, + "application/vnd.fujixerox.art-ex": { + "source": "iana" + }, + "application/vnd.fujixerox.art4": { + "source": "iana" + }, + "application/vnd.fujixerox.ddd": { + "source": "iana", + "extensions": ["ddd"] + }, + "application/vnd.fujixerox.docuworks": { + "source": "iana", + "extensions": ["xdw"] + }, + "application/vnd.fujixerox.docuworks.binder": { + "source": "iana", + "extensions": ["xbd"] + }, + "application/vnd.fujixerox.docuworks.container": { + "source": "iana" + }, + "application/vnd.fujixerox.hbpl": { + "source": "iana" + }, + "application/vnd.fut-misnet": { + "source": "iana" + }, + "application/vnd.futoin+cbor": { + "source": "iana" + }, + "application/vnd.futoin+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.fuzzysheet": { + "source": "iana", + "extensions": ["fzs"] + }, + "application/vnd.genomatix.tuxedo": { + "source": "iana", + "extensions": ["txd"] + }, + "application/vnd.gentics.grd+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.geo+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.geocube+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.geogebra.file": { + "source": "iana", + "extensions": ["ggb"] + }, + "application/vnd.geogebra.tool": { + "source": "iana", + "extensions": ["ggt"] + }, + "application/vnd.geometry-explorer": { + "source": "iana", + "extensions": ["gex","gre"] + }, + "application/vnd.geonext": { + "source": "iana", + "extensions": ["gxt"] + }, + "application/vnd.geoplan": { + "source": "iana", + "extensions": ["g2w"] + }, + "application/vnd.geospace": { + "source": "iana", + "extensions": ["g3w"] + }, + "application/vnd.gerber": { + "source": "iana" + }, + "application/vnd.globalplatform.card-content-mgt": { + "source": "iana" + }, + "application/vnd.globalplatform.card-content-mgt-response": { + "source": "iana" + }, + "application/vnd.gmx": { + "source": "iana", + "extensions": ["gmx"] + }, + "application/vnd.google-apps.document": { + "compressible": false, + "extensions": ["gdoc"] + }, + "application/vnd.google-apps.presentation": { + "compressible": false, + "extensions": ["gslides"] + }, + "application/vnd.google-apps.spreadsheet": { + "compressible": false, + "extensions": ["gsheet"] + }, + "application/vnd.google-earth.kml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["kml"] + }, + "application/vnd.google-earth.kmz": { + "source": "iana", + "compressible": false, + "extensions": ["kmz"] + }, + "application/vnd.gov.sk.e-form+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.gov.sk.e-form+zip": { + "source": "iana", + "compressible": false + }, + "application/vnd.gov.sk.xmldatacontainer+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.grafeq": { + "source": "iana", + "extensions": ["gqf","gqs"] + }, + "application/vnd.gridmp": { + "source": "iana" + }, + "application/vnd.groove-account": { + "source": "iana", + "extensions": ["gac"] + }, + "application/vnd.groove-help": { + "source": "iana", + "extensions": ["ghf"] + }, + "application/vnd.groove-identity-message": { + "source": "iana", + "extensions": ["gim"] + }, + "application/vnd.groove-injector": { + "source": "iana", + "extensions": ["grv"] + }, + "application/vnd.groove-tool-message": { + "source": "iana", + "extensions": ["gtm"] + }, + "application/vnd.groove-tool-template": { + "source": "iana", + "extensions": ["tpl"] + }, + "application/vnd.groove-vcard": { + "source": "iana", + "extensions": ["vcg"] + }, + "application/vnd.hal+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.hal+xml": { + "source": "iana", + "compressible": true, + "extensions": ["hal"] + }, + "application/vnd.handheld-entertainment+xml": { + "source": "iana", + "compressible": true, + "extensions": ["zmm"] + }, + "application/vnd.hbci": { + "source": "iana", + "extensions": ["hbci"] + }, + "application/vnd.hc+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.hcl-bireports": { + "source": "iana" + }, + "application/vnd.hdt": { + "source": "iana" + }, + "application/vnd.heroku+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.hhe.lesson-player": { + "source": "iana", + "extensions": ["les"] + }, + "application/vnd.hp-hpgl": { + "source": "iana", + "extensions": ["hpgl"] + }, + "application/vnd.hp-hpid": { + "source": "iana", + "extensions": ["hpid"] + }, + "application/vnd.hp-hps": { + "source": "iana", + "extensions": ["hps"] + }, + "application/vnd.hp-jlyt": { + "source": "iana", + "extensions": ["jlt"] + }, + "application/vnd.hp-pcl": { + "source": "iana", + "extensions": ["pcl"] + }, + "application/vnd.hp-pclxl": { + "source": "iana", + "extensions": ["pclxl"] + }, + "application/vnd.httphone": { + "source": "iana" + }, + "application/vnd.hydrostatix.sof-data": { + "source": "iana", + "extensions": ["sfd-hdstx"] + }, + "application/vnd.hyper+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.hyper-item+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.hyperdrive+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.hzn-3d-crossword": { + "source": "iana" + }, + "application/vnd.ibm.afplinedata": { + "source": "iana" + }, + "application/vnd.ibm.electronic-media": { + "source": "iana" + }, + "application/vnd.ibm.minipay": { + "source": "iana", + "extensions": ["mpy"] + }, + "application/vnd.ibm.modcap": { + "source": "iana", + "extensions": ["afp","listafp","list3820"] + }, + "application/vnd.ibm.rights-management": { + "source": "iana", + "extensions": ["irm"] + }, + "application/vnd.ibm.secure-container": { + "source": "iana", + "extensions": ["sc"] + }, + "application/vnd.iccprofile": { + "source": "iana", + "extensions": ["icc","icm"] + }, + "application/vnd.ieee.1905": { + "source": "iana" + }, + "application/vnd.igloader": { + "source": "iana", + "extensions": ["igl"] + }, + "application/vnd.imagemeter.folder+zip": { + "source": "iana", + "compressible": false + }, + "application/vnd.imagemeter.image+zip": { + "source": "iana", + "compressible": false + }, + "application/vnd.immervision-ivp": { + "source": "iana", + "extensions": ["ivp"] + }, + "application/vnd.immervision-ivu": { + "source": "iana", + "extensions": ["ivu"] + }, + "application/vnd.ims.imsccv1p1": { + "source": "iana" + }, + "application/vnd.ims.imsccv1p2": { + "source": "iana" + }, + "application/vnd.ims.imsccv1p3": { + "source": "iana" + }, + "application/vnd.ims.lis.v2.result+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.ims.lti.v2.toolconsumerprofile+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.ims.lti.v2.toolproxy+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.ims.lti.v2.toolproxy.id+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.ims.lti.v2.toolsettings+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.ims.lti.v2.toolsettings.simple+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.informedcontrol.rms+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.informix-visionary": { + "source": "iana" + }, + "application/vnd.infotech.project": { + "source": "iana" + }, + "application/vnd.infotech.project+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.innopath.wamp.notification": { + "source": "iana" + }, + "application/vnd.insors.igm": { + "source": "iana", + "extensions": ["igm"] + }, + "application/vnd.intercon.formnet": { + "source": "iana", + "extensions": ["xpw","xpx"] + }, + "application/vnd.intergeo": { + "source": "iana", + "extensions": ["i2g"] + }, + "application/vnd.intertrust.digibox": { + "source": "iana" + }, + "application/vnd.intertrust.nncp": { + "source": "iana" + }, + "application/vnd.intu.qbo": { + "source": "iana", + "extensions": ["qbo"] + }, + "application/vnd.intu.qfx": { + "source": "iana", + "extensions": ["qfx"] + }, + "application/vnd.iptc.g2.catalogitem+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.iptc.g2.conceptitem+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.iptc.g2.knowledgeitem+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.iptc.g2.newsitem+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.iptc.g2.newsmessage+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.iptc.g2.packageitem+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.iptc.g2.planningitem+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.ipunplugged.rcprofile": { + "source": "iana", + "extensions": ["rcprofile"] + }, + "application/vnd.irepository.package+xml": { + "source": "iana", + "compressible": true, + "extensions": ["irp"] + }, + "application/vnd.is-xpr": { + "source": "iana", + "extensions": ["xpr"] + }, + "application/vnd.isac.fcs": { + "source": "iana", + "extensions": ["fcs"] + }, + "application/vnd.iso11783-10+zip": { + "source": "iana", + "compressible": false + }, + "application/vnd.jam": { + "source": "iana", + "extensions": ["jam"] + }, + "application/vnd.japannet-directory-service": { + "source": "iana" + }, + "application/vnd.japannet-jpnstore-wakeup": { + "source": "iana" + }, + "application/vnd.japannet-payment-wakeup": { + "source": "iana" + }, + "application/vnd.japannet-registration": { + "source": "iana" + }, + "application/vnd.japannet-registration-wakeup": { + "source": "iana" + }, + "application/vnd.japannet-setstore-wakeup": { + "source": "iana" + }, + "application/vnd.japannet-verification": { + "source": "iana" + }, + "application/vnd.japannet-verification-wakeup": { + "source": "iana" + }, + "application/vnd.jcp.javame.midlet-rms": { + "source": "iana", + "extensions": ["rms"] + }, + "application/vnd.jisp": { + "source": "iana", + "extensions": ["jisp"] + }, + "application/vnd.joost.joda-archive": { + "source": "iana", + "extensions": ["joda"] + }, + "application/vnd.jsk.isdn-ngn": { + "source": "iana" + }, + "application/vnd.kahootz": { + "source": "iana", + "extensions": ["ktz","ktr"] + }, + "application/vnd.kde.karbon": { + "source": "iana", + "extensions": ["karbon"] + }, + "application/vnd.kde.kchart": { + "source": "iana", + "extensions": ["chrt"] + }, + "application/vnd.kde.kformula": { + "source": "iana", + "extensions": ["kfo"] + }, + "application/vnd.kde.kivio": { + "source": "iana", + "extensions": ["flw"] + }, + "application/vnd.kde.kontour": { + "source": "iana", + "extensions": ["kon"] + }, + "application/vnd.kde.kpresenter": { + "source": "iana", + "extensions": ["kpr","kpt"] + }, + "application/vnd.kde.kspread": { + "source": "iana", + "extensions": ["ksp"] + }, + "application/vnd.kde.kword": { + "source": "iana", + "extensions": ["kwd","kwt"] + }, + "application/vnd.kenameaapp": { + "source": "iana", + "extensions": ["htke"] + }, + "application/vnd.kidspiration": { + "source": "iana", + "extensions": ["kia"] + }, + "application/vnd.kinar": { + "source": "iana", + "extensions": ["kne","knp"] + }, + "application/vnd.koan": { + "source": "iana", + "extensions": ["skp","skd","skt","skm"] + }, + "application/vnd.kodak-descriptor": { + "source": "iana", + "extensions": ["sse"] + }, + "application/vnd.las": { + "source": "iana" + }, + "application/vnd.las.las+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.las.las+xml": { + "source": "iana", + "compressible": true, + "extensions": ["lasxml"] + }, + "application/vnd.laszip": { + "source": "iana" + }, + "application/vnd.leap+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.liberty-request+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.llamagraphics.life-balance.desktop": { + "source": "iana", + "extensions": ["lbd"] + }, + "application/vnd.llamagraphics.life-balance.exchange+xml": { + "source": "iana", + "compressible": true, + "extensions": ["lbe"] + }, + "application/vnd.logipipe.circuit+zip": { + "source": "iana", + "compressible": false + }, + "application/vnd.loom": { + "source": "iana" + }, + "application/vnd.lotus-1-2-3": { + "source": "iana", + "extensions": ["123"] + }, + "application/vnd.lotus-approach": { + "source": "iana", + "extensions": ["apr"] + }, + "application/vnd.lotus-freelance": { + "source": "iana", + "extensions": ["pre"] + }, + "application/vnd.lotus-notes": { + "source": "iana", + "extensions": ["nsf"] + }, + "application/vnd.lotus-organizer": { + "source": "iana", + "extensions": ["org"] + }, + "application/vnd.lotus-screencam": { + "source": "iana", + "extensions": ["scm"] + }, + "application/vnd.lotus-wordpro": { + "source": "iana", + "extensions": ["lwp"] + }, + "application/vnd.macports.portpkg": { + "source": "iana", + "extensions": ["portpkg"] + }, + "application/vnd.mapbox-vector-tile": { + "source": "iana" + }, + "application/vnd.marlin.drm.actiontoken+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.marlin.drm.conftoken+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.marlin.drm.license+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.marlin.drm.mdcf": { + "source": "iana" + }, + "application/vnd.mason+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.maxmind.maxmind-db": { + "source": "iana" + }, + "application/vnd.mcd": { + "source": "iana", + "extensions": ["mcd"] + }, + "application/vnd.medcalcdata": { + "source": "iana", + "extensions": ["mc1"] + }, + "application/vnd.mediastation.cdkey": { + "source": "iana", + "extensions": ["cdkey"] + }, + "application/vnd.meridian-slingshot": { + "source": "iana" + }, + "application/vnd.mfer": { + "source": "iana", + "extensions": ["mwf"] + }, + "application/vnd.mfmp": { + "source": "iana", + "extensions": ["mfm"] + }, + "application/vnd.micro+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.micrografx.flo": { + "source": "iana", + "extensions": ["flo"] + }, + "application/vnd.micrografx.igx": { + "source": "iana", + "extensions": ["igx"] + }, + "application/vnd.microsoft.portable-executable": { + "source": "iana" + }, + "application/vnd.microsoft.windows.thumbnail-cache": { + "source": "iana" + }, + "application/vnd.miele+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.mif": { + "source": "iana", + "extensions": ["mif"] + }, + "application/vnd.minisoft-hp3000-save": { + "source": "iana" + }, + "application/vnd.mitsubishi.misty-guard.trustweb": { + "source": "iana" + }, + "application/vnd.mobius.daf": { + "source": "iana", + "extensions": ["daf"] + }, + "application/vnd.mobius.dis": { + "source": "iana", + "extensions": ["dis"] + }, + "application/vnd.mobius.mbk": { + "source": "iana", + "extensions": ["mbk"] + }, + "application/vnd.mobius.mqy": { + "source": "iana", + "extensions": ["mqy"] + }, + "application/vnd.mobius.msl": { + "source": "iana", + "extensions": ["msl"] + }, + "application/vnd.mobius.plc": { + "source": "iana", + "extensions": ["plc"] + }, + "application/vnd.mobius.txf": { + "source": "iana", + "extensions": ["txf"] + }, + "application/vnd.mophun.application": { + "source": "iana", + "extensions": ["mpn"] + }, + "application/vnd.mophun.certificate": { + "source": "iana", + "extensions": ["mpc"] + }, + "application/vnd.motorola.flexsuite": { + "source": "iana" + }, + "application/vnd.motorola.flexsuite.adsi": { + "source": "iana" + }, + "application/vnd.motorola.flexsuite.fis": { + "source": "iana" + }, + "application/vnd.motorola.flexsuite.gotap": { + "source": "iana" + }, + "application/vnd.motorola.flexsuite.kmr": { + "source": "iana" + }, + "application/vnd.motorola.flexsuite.ttc": { + "source": "iana" + }, + "application/vnd.motorola.flexsuite.wem": { + "source": "iana" + }, + "application/vnd.motorola.iprm": { + "source": "iana" + }, + "application/vnd.mozilla.xul+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xul"] + }, + "application/vnd.ms-3mfdocument": { + "source": "iana" + }, + "application/vnd.ms-artgalry": { + "source": "iana", + "extensions": ["cil"] + }, + "application/vnd.ms-asf": { + "source": "iana" + }, + "application/vnd.ms-cab-compressed": { + "source": "iana", + "extensions": ["cab"] + }, + "application/vnd.ms-color.iccprofile": { + "source": "apache" + }, + "application/vnd.ms-excel": { + "source": "iana", + "compressible": false, + "extensions": ["xls","xlm","xla","xlc","xlt","xlw"] + }, + "application/vnd.ms-excel.addin.macroenabled.12": { + "source": "iana", + "extensions": ["xlam"] + }, + "application/vnd.ms-excel.sheet.binary.macroenabled.12": { + "source": "iana", + "extensions": ["xlsb"] + }, + "application/vnd.ms-excel.sheet.macroenabled.12": { + "source": "iana", + "extensions": ["xlsm"] + }, + "application/vnd.ms-excel.template.macroenabled.12": { + "source": "iana", + "extensions": ["xltm"] + }, + "application/vnd.ms-fontobject": { + "source": "iana", + "compressible": true, + "extensions": ["eot"] + }, + "application/vnd.ms-htmlhelp": { + "source": "iana", + "extensions": ["chm"] + }, + "application/vnd.ms-ims": { + "source": "iana", + "extensions": ["ims"] + }, + "application/vnd.ms-lrm": { + "source": "iana", + "extensions": ["lrm"] + }, + "application/vnd.ms-office.activex+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.ms-officetheme": { + "source": "iana", + "extensions": ["thmx"] + }, + "application/vnd.ms-opentype": { + "source": "apache", + "compressible": true + }, + "application/vnd.ms-outlook": { + "compressible": false, + "extensions": ["msg"] + }, + "application/vnd.ms-package.obfuscated-opentype": { + "source": "apache" + }, + "application/vnd.ms-pki.seccat": { + "source": "apache", + "extensions": ["cat"] + }, + "application/vnd.ms-pki.stl": { + "source": "apache", + "extensions": ["stl"] + }, + "application/vnd.ms-playready.initiator+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.ms-powerpoint": { + "source": "iana", + "compressible": false, + "extensions": ["ppt","pps","pot"] + }, + "application/vnd.ms-powerpoint.addin.macroenabled.12": { + "source": "iana", + "extensions": ["ppam"] + }, + "application/vnd.ms-powerpoint.presentation.macroenabled.12": { + "source": "iana", + "extensions": ["pptm"] + }, + "application/vnd.ms-powerpoint.slide.macroenabled.12": { + "source": "iana", + "extensions": ["sldm"] + }, + "application/vnd.ms-powerpoint.slideshow.macroenabled.12": { + "source": "iana", + "extensions": ["ppsm"] + }, + "application/vnd.ms-powerpoint.template.macroenabled.12": { + "source": "iana", + "extensions": ["potm"] + }, + "application/vnd.ms-printdevicecapabilities+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.ms-printing.printticket+xml": { + "source": "apache", + "compressible": true + }, + "application/vnd.ms-printschematicket+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.ms-project": { + "source": "iana", + "extensions": ["mpp","mpt"] + }, + "application/vnd.ms-tnef": { + "source": "iana" + }, + "application/vnd.ms-windows.devicepairing": { + "source": "iana" + }, + "application/vnd.ms-windows.nwprinting.oob": { + "source": "iana" + }, + "application/vnd.ms-windows.printerpairing": { + "source": "iana" + }, + "application/vnd.ms-windows.wsd.oob": { + "source": "iana" + }, + "application/vnd.ms-wmdrm.lic-chlg-req": { + "source": "iana" + }, + "application/vnd.ms-wmdrm.lic-resp": { + "source": "iana" + }, + "application/vnd.ms-wmdrm.meter-chlg-req": { + "source": "iana" + }, + "application/vnd.ms-wmdrm.meter-resp": { + "source": "iana" + }, + "application/vnd.ms-word.document.macroenabled.12": { + "source": "iana", + "extensions": ["docm"] + }, + "application/vnd.ms-word.template.macroenabled.12": { + "source": "iana", + "extensions": ["dotm"] + }, + "application/vnd.ms-works": { + "source": "iana", + "extensions": ["wps","wks","wcm","wdb"] + }, + "application/vnd.ms-wpl": { + "source": "iana", + "extensions": ["wpl"] + }, + "application/vnd.ms-xpsdocument": { + "source": "iana", + "compressible": false, + "extensions": ["xps"] + }, + "application/vnd.msa-disk-image": { + "source": "iana" + }, + "application/vnd.mseq": { + "source": "iana", + "extensions": ["mseq"] + }, + "application/vnd.msign": { + "source": "iana" + }, + "application/vnd.multiad.creator": { + "source": "iana" + }, + "application/vnd.multiad.creator.cif": { + "source": "iana" + }, + "application/vnd.music-niff": { + "source": "iana" + }, + "application/vnd.musician": { + "source": "iana", + "extensions": ["mus"] + }, + "application/vnd.muvee.style": { + "source": "iana", + "extensions": ["msty"] + }, + "application/vnd.mynfc": { + "source": "iana", + "extensions": ["taglet"] + }, + "application/vnd.ncd.control": { + "source": "iana" + }, + "application/vnd.ncd.reference": { + "source": "iana" + }, + "application/vnd.nearst.inv+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.nervana": { + "source": "iana" + }, + "application/vnd.netfpx": { + "source": "iana" + }, + "application/vnd.neurolanguage.nlu": { + "source": "iana", + "extensions": ["nlu"] + }, + "application/vnd.nimn": { + "source": "iana" + }, + "application/vnd.nintendo.nitro.rom": { + "source": "iana" + }, + "application/vnd.nintendo.snes.rom": { + "source": "iana" + }, + "application/vnd.nitf": { + "source": "iana", + "extensions": ["ntf","nitf"] + }, + "application/vnd.noblenet-directory": { + "source": "iana", + "extensions": ["nnd"] + }, + "application/vnd.noblenet-sealer": { + "source": "iana", + "extensions": ["nns"] + }, + "application/vnd.noblenet-web": { + "source": "iana", + "extensions": ["nnw"] + }, + "application/vnd.nokia.catalogs": { + "source": "iana" + }, + "application/vnd.nokia.conml+wbxml": { + "source": "iana" + }, + "application/vnd.nokia.conml+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.nokia.iptv.config+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.nokia.isds-radio-presets": { + "source": "iana" + }, + "application/vnd.nokia.landmark+wbxml": { + "source": "iana" + }, + "application/vnd.nokia.landmark+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.nokia.landmarkcollection+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.nokia.n-gage.ac+xml": { + "source": "iana", + "compressible": true, + "extensions": ["ac"] + }, + "application/vnd.nokia.n-gage.data": { + "source": "iana", + "extensions": ["ngdat"] + }, + "application/vnd.nokia.n-gage.symbian.install": { + "source": "iana", + "extensions": ["n-gage"] + }, + "application/vnd.nokia.ncd": { + "source": "iana" + }, + "application/vnd.nokia.pcd+wbxml": { + "source": "iana" + }, + "application/vnd.nokia.pcd+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.nokia.radio-preset": { + "source": "iana", + "extensions": ["rpst"] + }, + "application/vnd.nokia.radio-presets": { + "source": "iana", + "extensions": ["rpss"] + }, + "application/vnd.novadigm.edm": { + "source": "iana", + "extensions": ["edm"] + }, + "application/vnd.novadigm.edx": { + "source": "iana", + "extensions": ["edx"] + }, + "application/vnd.novadigm.ext": { + "source": "iana", + "extensions": ["ext"] + }, + "application/vnd.ntt-local.content-share": { + "source": "iana" + }, + "application/vnd.ntt-local.file-transfer": { + "source": "iana" + }, + "application/vnd.ntt-local.ogw_remote-access": { + "source": "iana" + }, + "application/vnd.ntt-local.sip-ta_remote": { + "source": "iana" + }, + "application/vnd.ntt-local.sip-ta_tcp_stream": { + "source": "iana" + }, + "application/vnd.oasis.opendocument.chart": { + "source": "iana", + "extensions": ["odc"] + }, + "application/vnd.oasis.opendocument.chart-template": { + "source": "iana", + "extensions": ["otc"] + }, + "application/vnd.oasis.opendocument.database": { + "source": "iana", + "extensions": ["odb"] + }, + "application/vnd.oasis.opendocument.formula": { + "source": "iana", + "extensions": ["odf"] + }, + "application/vnd.oasis.opendocument.formula-template": { + "source": "iana", + "extensions": ["odft"] + }, + "application/vnd.oasis.opendocument.graphics": { + "source": "iana", + "compressible": false, + "extensions": ["odg"] + }, + "application/vnd.oasis.opendocument.graphics-template": { + "source": "iana", + "extensions": ["otg"] + }, + "application/vnd.oasis.opendocument.image": { + "source": "iana", + "extensions": ["odi"] + }, + "application/vnd.oasis.opendocument.image-template": { + "source": "iana", + "extensions": ["oti"] + }, + "application/vnd.oasis.opendocument.presentation": { + "source": "iana", + "compressible": false, + "extensions": ["odp"] + }, + "application/vnd.oasis.opendocument.presentation-template": { + "source": "iana", + "extensions": ["otp"] + }, + "application/vnd.oasis.opendocument.spreadsheet": { + "source": "iana", + "compressible": false, + "extensions": ["ods"] + }, + "application/vnd.oasis.opendocument.spreadsheet-template": { + "source": "iana", + "extensions": ["ots"] + }, + "application/vnd.oasis.opendocument.text": { + "source": "iana", + "compressible": false, + "extensions": ["odt"] + }, + "application/vnd.oasis.opendocument.text-master": { + "source": "iana", + "extensions": ["odm"] + }, + "application/vnd.oasis.opendocument.text-template": { + "source": "iana", + "extensions": ["ott"] + }, + "application/vnd.oasis.opendocument.text-web": { + "source": "iana", + "extensions": ["oth"] + }, + "application/vnd.obn": { + "source": "iana" + }, + "application/vnd.ocf+cbor": { + "source": "iana" + }, + "application/vnd.oci.image.manifest.v1+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.oftn.l10n+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.oipf.contentaccessdownload+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oipf.contentaccessstreaming+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oipf.cspg-hexbinary": { + "source": "iana" + }, + "application/vnd.oipf.dae.svg+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oipf.dae.xhtml+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oipf.mippvcontrolmessage+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oipf.pae.gem": { + "source": "iana" + }, + "application/vnd.oipf.spdiscovery+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oipf.spdlist+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oipf.ueprofile+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oipf.userprofile+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.olpc-sugar": { + "source": "iana", + "extensions": ["xo"] + }, + "application/vnd.oma-scws-config": { + "source": "iana" + }, + "application/vnd.oma-scws-http-request": { + "source": "iana" + }, + "application/vnd.oma-scws-http-response": { + "source": "iana" + }, + "application/vnd.oma.bcast.associated-procedure-parameter+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.bcast.drm-trigger+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.bcast.imd+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.bcast.ltkm": { + "source": "iana" + }, + "application/vnd.oma.bcast.notification+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.bcast.provisioningtrigger": { + "source": "iana" + }, + "application/vnd.oma.bcast.sgboot": { + "source": "iana" + }, + "application/vnd.oma.bcast.sgdd+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.bcast.sgdu": { + "source": "iana" + }, + "application/vnd.oma.bcast.simple-symbol-container": { + "source": "iana" + }, + "application/vnd.oma.bcast.smartcard-trigger+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.bcast.sprov+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.bcast.stkm": { + "source": "iana" + }, + "application/vnd.oma.cab-address-book+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.cab-feature-handler+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.cab-pcc+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.cab-subs-invite+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.cab-user-prefs+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.dcd": { + "source": "iana" + }, + "application/vnd.oma.dcdc": { + "source": "iana" + }, + "application/vnd.oma.dd2+xml": { + "source": "iana", + "compressible": true, + "extensions": ["dd2"] + }, + "application/vnd.oma.drm.risd+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.group-usage-list+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.lwm2m+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.lwm2m+tlv": { + "source": "iana" + }, + "application/vnd.oma.pal+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.poc.detailed-progress-report+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.poc.final-report+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.poc.groups+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.poc.invocation-descriptor+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.poc.optimized-progress-report+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.push": { + "source": "iana" + }, + "application/vnd.oma.scidm.messages+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oma.xcap-directory+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.omads-email+xml": { + "source": "iana", + "charset": "UTF-8", + "compressible": true + }, + "application/vnd.omads-file+xml": { + "source": "iana", + "charset": "UTF-8", + "compressible": true + }, + "application/vnd.omads-folder+xml": { + "source": "iana", + "charset": "UTF-8", + "compressible": true + }, + "application/vnd.omaloc-supl-init": { + "source": "iana" + }, + "application/vnd.onepager": { + "source": "iana" + }, + "application/vnd.onepagertamp": { + "source": "iana" + }, + "application/vnd.onepagertamx": { + "source": "iana" + }, + "application/vnd.onepagertat": { + "source": "iana" + }, + "application/vnd.onepagertatp": { + "source": "iana" + }, + "application/vnd.onepagertatx": { + "source": "iana" + }, + "application/vnd.openblox.game+xml": { + "source": "iana", + "compressible": true, + "extensions": ["obgx"] + }, + "application/vnd.openblox.game-binary": { + "source": "iana" + }, + "application/vnd.openeye.oeb": { + "source": "iana" + }, + "application/vnd.openofficeorg.extension": { + "source": "apache", + "extensions": ["oxt"] + }, + "application/vnd.openstreetmap.data+xml": { + "source": "iana", + "compressible": true, + "extensions": ["osm"] + }, + "application/vnd.openxmlformats-officedocument.custom-properties+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.customxmlproperties+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.drawing+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.drawingml.chart+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.drawingml.chartshapes+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.drawingml.diagramcolors+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.drawingml.diagramdata+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.drawingml.diagramlayout+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.drawingml.diagramstyle+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.extended-properties+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.commentauthors+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.comments+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.handoutmaster+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.notesmaster+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.notesslide+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.presentation": { + "source": "iana", + "compressible": false, + "extensions": ["pptx"] + }, + "application/vnd.openxmlformats-officedocument.presentationml.presentation.main+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.presprops+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.slide": { + "source": "iana", + "extensions": ["sldx"] + }, + "application/vnd.openxmlformats-officedocument.presentationml.slide+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.slidelayout+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.slidemaster+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.slideshow": { + "source": "iana", + "extensions": ["ppsx"] + }, + "application/vnd.openxmlformats-officedocument.presentationml.slideshow.main+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.slideupdateinfo+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.tablestyles+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.tags+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.template": { + "source": "iana", + "extensions": ["potx"] + }, + "application/vnd.openxmlformats-officedocument.presentationml.template.main+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.presentationml.viewprops+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.calcchain+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.chartsheet+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.comments+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.connections+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.dialogsheet+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.externallink+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.pivotcachedefinition+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.pivotcacherecords+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.pivottable+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.querytable+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.revisionheaders+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.revisionlog+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.sharedstrings+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.sheet": { + "source": "iana", + "compressible": false, + "extensions": ["xlsx"] + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.sheet.main+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.sheetmetadata+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.styles+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.table+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.tablesinglecells+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.template": { + "source": "iana", + "extensions": ["xltx"] + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.template.main+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.usernames+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.volatiledependencies+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.spreadsheetml.worksheet+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.theme+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.themeoverride+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.vmldrawing": { + "source": "iana" + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.comments+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.document": { + "source": "iana", + "compressible": false, + "extensions": ["docx"] + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.document.glossary+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.document.main+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.endnotes+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.fonttable+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.footer+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.footnotes+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.numbering+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.settings+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.styles+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.template": { + "source": "iana", + "extensions": ["dotx"] + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.template.main+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-officedocument.wordprocessingml.websettings+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-package.core-properties+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-package.digital-signature-xmlsignature+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.openxmlformats-package.relationships+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oracle.resource+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.orange.indata": { + "source": "iana" + }, + "application/vnd.osa.netdeploy": { + "source": "iana" + }, + "application/vnd.osgeo.mapguide.package": { + "source": "iana", + "extensions": ["mgp"] + }, + "application/vnd.osgi.bundle": { + "source": "iana" + }, + "application/vnd.osgi.dp": { + "source": "iana", + "extensions": ["dp"] + }, + "application/vnd.osgi.subsystem": { + "source": "iana", + "extensions": ["esa"] + }, + "application/vnd.otps.ct-kip+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.oxli.countgraph": { + "source": "iana" + }, + "application/vnd.pagerduty+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.palm": { + "source": "iana", + "extensions": ["pdb","pqa","oprc"] + }, + "application/vnd.panoply": { + "source": "iana" + }, + "application/vnd.paos.xml": { + "source": "iana" + }, + "application/vnd.patentdive": { + "source": "iana" + }, + "application/vnd.patientecommsdoc": { + "source": "iana" + }, + "application/vnd.pawaafile": { + "source": "iana", + "extensions": ["paw"] + }, + "application/vnd.pcos": { + "source": "iana" + }, + "application/vnd.pg.format": { + "source": "iana", + "extensions": ["str"] + }, + "application/vnd.pg.osasli": { + "source": "iana", + "extensions": ["ei6"] + }, + "application/vnd.piaccess.application-licence": { + "source": "iana" + }, + "application/vnd.picsel": { + "source": "iana", + "extensions": ["efif"] + }, + "application/vnd.pmi.widget": { + "source": "iana", + "extensions": ["wg"] + }, + "application/vnd.poc.group-advertisement+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.pocketlearn": { + "source": "iana", + "extensions": ["plf"] + }, + "application/vnd.powerbuilder6": { + "source": "iana", + "extensions": ["pbd"] + }, + "application/vnd.powerbuilder6-s": { + "source": "iana" + }, + "application/vnd.powerbuilder7": { + "source": "iana" + }, + "application/vnd.powerbuilder7-s": { + "source": "iana" + }, + "application/vnd.powerbuilder75": { + "source": "iana" + }, + "application/vnd.powerbuilder75-s": { + "source": "iana" + }, + "application/vnd.preminet": { + "source": "iana" + }, + "application/vnd.previewsystems.box": { + "source": "iana", + "extensions": ["box"] + }, + "application/vnd.proteus.magazine": { + "source": "iana", + "extensions": ["mgz"] + }, + "application/vnd.psfs": { + "source": "iana" + }, + "application/vnd.publishare-delta-tree": { + "source": "iana", + "extensions": ["qps"] + }, + "application/vnd.pvi.ptid1": { + "source": "iana", + "extensions": ["ptid"] + }, + "application/vnd.pwg-multiplexed": { + "source": "iana" + }, + "application/vnd.pwg-xhtml-print+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.qualcomm.brew-app-res": { + "source": "iana" + }, + "application/vnd.quarantainenet": { + "source": "iana" + }, + "application/vnd.quark.quarkxpress": { + "source": "iana", + "extensions": ["qxd","qxt","qwd","qwt","qxl","qxb"] + }, + "application/vnd.quobject-quoxdocument": { + "source": "iana" + }, + "application/vnd.radisys.moml+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.radisys.msml+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.radisys.msml-audit+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.radisys.msml-audit-conf+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.radisys.msml-audit-conn+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.radisys.msml-audit-dialog+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.radisys.msml-audit-stream+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.radisys.msml-conf+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.radisys.msml-dialog+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.radisys.msml-dialog-base+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.radisys.msml-dialog-fax-detect+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.radisys.msml-dialog-fax-sendrecv+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.radisys.msml-dialog-group+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.radisys.msml-dialog-speech+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.radisys.msml-dialog-transform+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.rainstor.data": { + "source": "iana" + }, + "application/vnd.rapid": { + "source": "iana" + }, + "application/vnd.rar": { + "source": "iana" + }, + "application/vnd.realvnc.bed": { + "source": "iana", + "extensions": ["bed"] + }, + "application/vnd.recordare.musicxml": { + "source": "iana", + "extensions": ["mxl"] + }, + "application/vnd.recordare.musicxml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["musicxml"] + }, + "application/vnd.renlearn.rlprint": { + "source": "iana" + }, + "application/vnd.restful+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.rig.cryptonote": { + "source": "iana", + "extensions": ["cryptonote"] + }, + "application/vnd.rim.cod": { + "source": "apache", + "extensions": ["cod"] + }, + "application/vnd.rn-realmedia": { + "source": "apache", + "extensions": ["rm"] + }, + "application/vnd.rn-realmedia-vbr": { + "source": "apache", + "extensions": ["rmvb"] + }, + "application/vnd.route66.link66+xml": { + "source": "iana", + "compressible": true, + "extensions": ["link66"] + }, + "application/vnd.rs-274x": { + "source": "iana" + }, + "application/vnd.ruckus.download": { + "source": "iana" + }, + "application/vnd.s3sms": { + "source": "iana" + }, + "application/vnd.sailingtracker.track": { + "source": "iana", + "extensions": ["st"] + }, + "application/vnd.sar": { + "source": "iana" + }, + "application/vnd.sbm.cid": { + "source": "iana" + }, + "application/vnd.sbm.mid2": { + "source": "iana" + }, + "application/vnd.scribus": { + "source": "iana" + }, + "application/vnd.sealed.3df": { + "source": "iana" + }, + "application/vnd.sealed.csf": { + "source": "iana" + }, + "application/vnd.sealed.doc": { + "source": "iana" + }, + "application/vnd.sealed.eml": { + "source": "iana" + }, + "application/vnd.sealed.mht": { + "source": "iana" + }, + "application/vnd.sealed.net": { + "source": "iana" + }, + "application/vnd.sealed.ppt": { + "source": "iana" + }, + "application/vnd.sealed.tiff": { + "source": "iana" + }, + "application/vnd.sealed.xls": { + "source": "iana" + }, + "application/vnd.sealedmedia.softseal.html": { + "source": "iana" + }, + "application/vnd.sealedmedia.softseal.pdf": { + "source": "iana" + }, + "application/vnd.seemail": { + "source": "iana", + "extensions": ["see"] + }, + "application/vnd.sema": { + "source": "iana", + "extensions": ["sema"] + }, + "application/vnd.semd": { + "source": "iana", + "extensions": ["semd"] + }, + "application/vnd.semf": { + "source": "iana", + "extensions": ["semf"] + }, + "application/vnd.shade-save-file": { + "source": "iana" + }, + "application/vnd.shana.informed.formdata": { + "source": "iana", + "extensions": ["ifm"] + }, + "application/vnd.shana.informed.formtemplate": { + "source": "iana", + "extensions": ["itp"] + }, + "application/vnd.shana.informed.interchange": { + "source": "iana", + "extensions": ["iif"] + }, + "application/vnd.shana.informed.package": { + "source": "iana", + "extensions": ["ipk"] + }, + "application/vnd.shootproof+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.shopkick+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.shp": { + "source": "iana" + }, + "application/vnd.shx": { + "source": "iana" + }, + "application/vnd.sigrok.session": { + "source": "iana" + }, + "application/vnd.simtech-mindmapper": { + "source": "iana", + "extensions": ["twd","twds"] + }, + "application/vnd.siren+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.smaf": { + "source": "iana", + "extensions": ["mmf"] + }, + "application/vnd.smart.notebook": { + "source": "iana" + }, + "application/vnd.smart.teacher": { + "source": "iana", + "extensions": ["teacher"] + }, + "application/vnd.snesdev-page-table": { + "source": "iana" + }, + "application/vnd.software602.filler.form+xml": { + "source": "iana", + "compressible": true, + "extensions": ["fo"] + }, + "application/vnd.software602.filler.form-xml-zip": { + "source": "iana" + }, + "application/vnd.solent.sdkm+xml": { + "source": "iana", + "compressible": true, + "extensions": ["sdkm","sdkd"] + }, + "application/vnd.spotfire.dxp": { + "source": "iana", + "extensions": ["dxp"] + }, + "application/vnd.spotfire.sfs": { + "source": "iana", + "extensions": ["sfs"] + }, + "application/vnd.sqlite3": { + "source": "iana" + }, + "application/vnd.sss-cod": { + "source": "iana" + }, + "application/vnd.sss-dtf": { + "source": "iana" + }, + "application/vnd.sss-ntf": { + "source": "iana" + }, + "application/vnd.stardivision.calc": { + "source": "apache", + "extensions": ["sdc"] + }, + "application/vnd.stardivision.draw": { + "source": "apache", + "extensions": ["sda"] + }, + "application/vnd.stardivision.impress": { + "source": "apache", + "extensions": ["sdd"] + }, + "application/vnd.stardivision.math": { + "source": "apache", + "extensions": ["smf"] + }, + "application/vnd.stardivision.writer": { + "source": "apache", + "extensions": ["sdw","vor"] + }, + "application/vnd.stardivision.writer-global": { + "source": "apache", + "extensions": ["sgl"] + }, + "application/vnd.stepmania.package": { + "source": "iana", + "extensions": ["smzip"] + }, + "application/vnd.stepmania.stepchart": { + "source": "iana", + "extensions": ["sm"] + }, + "application/vnd.street-stream": { + "source": "iana" + }, + "application/vnd.sun.wadl+xml": { + "source": "iana", + "compressible": true, + "extensions": ["wadl"] + }, + "application/vnd.sun.xml.calc": { + "source": "apache", + "extensions": ["sxc"] + }, + "application/vnd.sun.xml.calc.template": { + "source": "apache", + "extensions": ["stc"] + }, + "application/vnd.sun.xml.draw": { + "source": "apache", + "extensions": ["sxd"] + }, + "application/vnd.sun.xml.draw.template": { + "source": "apache", + "extensions": ["std"] + }, + "application/vnd.sun.xml.impress": { + "source": "apache", + "extensions": ["sxi"] + }, + "application/vnd.sun.xml.impress.template": { + "source": "apache", + "extensions": ["sti"] + }, + "application/vnd.sun.xml.math": { + "source": "apache", + "extensions": ["sxm"] + }, + "application/vnd.sun.xml.writer": { + "source": "apache", + "extensions": ["sxw"] + }, + "application/vnd.sun.xml.writer.global": { + "source": "apache", + "extensions": ["sxg"] + }, + "application/vnd.sun.xml.writer.template": { + "source": "apache", + "extensions": ["stw"] + }, + "application/vnd.sus-calendar": { + "source": "iana", + "extensions": ["sus","susp"] + }, + "application/vnd.svd": { + "source": "iana", + "extensions": ["svd"] + }, + "application/vnd.swiftview-ics": { + "source": "iana" + }, + "application/vnd.symbian.install": { + "source": "apache", + "extensions": ["sis","sisx"] + }, + "application/vnd.syncml+xml": { + "source": "iana", + "charset": "UTF-8", + "compressible": true, + "extensions": ["xsm"] + }, + "application/vnd.syncml.dm+wbxml": { + "source": "iana", + "charset": "UTF-8", + "extensions": ["bdm"] + }, + "application/vnd.syncml.dm+xml": { + "source": "iana", + "charset": "UTF-8", + "compressible": true, + "extensions": ["xdm"] + }, + "application/vnd.syncml.dm.notification": { + "source": "iana" + }, + "application/vnd.syncml.dmddf+wbxml": { + "source": "iana" + }, + "application/vnd.syncml.dmddf+xml": { + "source": "iana", + "charset": "UTF-8", + "compressible": true, + "extensions": ["ddf"] + }, + "application/vnd.syncml.dmtnds+wbxml": { + "source": "iana" + }, + "application/vnd.syncml.dmtnds+xml": { + "source": "iana", + "charset": "UTF-8", + "compressible": true + }, + "application/vnd.syncml.ds.notification": { + "source": "iana" + }, + "application/vnd.tableschema+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.tao.intent-module-archive": { + "source": "iana", + "extensions": ["tao"] + }, + "application/vnd.tcpdump.pcap": { + "source": "iana", + "extensions": ["pcap","cap","dmp"] + }, + "application/vnd.think-cell.ppttc+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.tmd.mediaflex.api+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.tml": { + "source": "iana" + }, + "application/vnd.tmobile-livetv": { + "source": "iana", + "extensions": ["tmo"] + }, + "application/vnd.tri.onesource": { + "source": "iana" + }, + "application/vnd.trid.tpt": { + "source": "iana", + "extensions": ["tpt"] + }, + "application/vnd.triscape.mxs": { + "source": "iana", + "extensions": ["mxs"] + }, + "application/vnd.trueapp": { + "source": "iana", + "extensions": ["tra"] + }, + "application/vnd.truedoc": { + "source": "iana" + }, + "application/vnd.ubisoft.webplayer": { + "source": "iana" + }, + "application/vnd.ufdl": { + "source": "iana", + "extensions": ["ufd","ufdl"] + }, + "application/vnd.uiq.theme": { + "source": "iana", + "extensions": ["utz"] + }, + "application/vnd.umajin": { + "source": "iana", + "extensions": ["umj"] + }, + "application/vnd.unity": { + "source": "iana", + "extensions": ["unityweb"] + }, + "application/vnd.uoml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["uoml"] + }, + "application/vnd.uplanet.alert": { + "source": "iana" + }, + "application/vnd.uplanet.alert-wbxml": { + "source": "iana" + }, + "application/vnd.uplanet.bearer-choice": { + "source": "iana" + }, + "application/vnd.uplanet.bearer-choice-wbxml": { + "source": "iana" + }, + "application/vnd.uplanet.cacheop": { + "source": "iana" + }, + "application/vnd.uplanet.cacheop-wbxml": { + "source": "iana" + }, + "application/vnd.uplanet.channel": { + "source": "iana" + }, + "application/vnd.uplanet.channel-wbxml": { + "source": "iana" + }, + "application/vnd.uplanet.list": { + "source": "iana" + }, + "application/vnd.uplanet.list-wbxml": { + "source": "iana" + }, + "application/vnd.uplanet.listcmd": { + "source": "iana" + }, + "application/vnd.uplanet.listcmd-wbxml": { + "source": "iana" + }, + "application/vnd.uplanet.signal": { + "source": "iana" + }, + "application/vnd.uri-map": { + "source": "iana" + }, + "application/vnd.valve.source.material": { + "source": "iana" + }, + "application/vnd.vcx": { + "source": "iana", + "extensions": ["vcx"] + }, + "application/vnd.vd-study": { + "source": "iana" + }, + "application/vnd.vectorworks": { + "source": "iana" + }, + "application/vnd.vel+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.verimatrix.vcas": { + "source": "iana" + }, + "application/vnd.veryant.thin": { + "source": "iana" + }, + "application/vnd.ves.encrypted": { + "source": "iana" + }, + "application/vnd.vidsoft.vidconference": { + "source": "iana" + }, + "application/vnd.visio": { + "source": "iana", + "extensions": ["vsd","vst","vss","vsw"] + }, + "application/vnd.visionary": { + "source": "iana", + "extensions": ["vis"] + }, + "application/vnd.vividence.scriptfile": { + "source": "iana" + }, + "application/vnd.vsf": { + "source": "iana", + "extensions": ["vsf"] + }, + "application/vnd.wap.sic": { + "source": "iana" + }, + "application/vnd.wap.slc": { + "source": "iana" + }, + "application/vnd.wap.wbxml": { + "source": "iana", + "charset": "UTF-8", + "extensions": ["wbxml"] + }, + "application/vnd.wap.wmlc": { + "source": "iana", + "extensions": ["wmlc"] + }, + "application/vnd.wap.wmlscriptc": { + "source": "iana", + "extensions": ["wmlsc"] + }, + "application/vnd.webturbo": { + "source": "iana", + "extensions": ["wtb"] + }, + "application/vnd.wfa.p2p": { + "source": "iana" + }, + "application/vnd.wfa.wsc": { + "source": "iana" + }, + "application/vnd.windows.devicepairing": { + "source": "iana" + }, + "application/vnd.wmc": { + "source": "iana" + }, + "application/vnd.wmf.bootstrap": { + "source": "iana" + }, + "application/vnd.wolfram.mathematica": { + "source": "iana" + }, + "application/vnd.wolfram.mathematica.package": { + "source": "iana" + }, + "application/vnd.wolfram.player": { + "source": "iana", + "extensions": ["nbp"] + }, + "application/vnd.wordperfect": { + "source": "iana", + "extensions": ["wpd"] + }, + "application/vnd.wqd": { + "source": "iana", + "extensions": ["wqd"] + }, + "application/vnd.wrq-hp3000-labelled": { + "source": "iana" + }, + "application/vnd.wt.stf": { + "source": "iana", + "extensions": ["stf"] + }, + "application/vnd.wv.csp+wbxml": { + "source": "iana" + }, + "application/vnd.wv.csp+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.wv.ssp+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.xacml+json": { + "source": "iana", + "compressible": true + }, + "application/vnd.xara": { + "source": "iana", + "extensions": ["xar"] + }, + "application/vnd.xfdl": { + "source": "iana", + "extensions": ["xfdl"] + }, + "application/vnd.xfdl.webform": { + "source": "iana" + }, + "application/vnd.xmi+xml": { + "source": "iana", + "compressible": true + }, + "application/vnd.xmpie.cpkg": { + "source": "iana" + }, + "application/vnd.xmpie.dpkg": { + "source": "iana" + }, + "application/vnd.xmpie.plan": { + "source": "iana" + }, + "application/vnd.xmpie.ppkg": { + "source": "iana" + }, + "application/vnd.xmpie.xlim": { + "source": "iana" + }, + "application/vnd.yamaha.hv-dic": { + "source": "iana", + "extensions": ["hvd"] + }, + "application/vnd.yamaha.hv-script": { + "source": "iana", + "extensions": ["hvs"] + }, + "application/vnd.yamaha.hv-voice": { + "source": "iana", + "extensions": ["hvp"] + }, + "application/vnd.yamaha.openscoreformat": { + "source": "iana", + "extensions": ["osf"] + }, + "application/vnd.yamaha.openscoreformat.osfpvg+xml": { + "source": "iana", + "compressible": true, + "extensions": ["osfpvg"] + }, + "application/vnd.yamaha.remote-setup": { + "source": "iana" + }, + "application/vnd.yamaha.smaf-audio": { + "source": "iana", + "extensions": ["saf"] + }, + "application/vnd.yamaha.smaf-phrase": { + "source": "iana", + "extensions": ["spf"] + }, + "application/vnd.yamaha.through-ngn": { + "source": "iana" + }, + "application/vnd.yamaha.tunnel-udpencap": { + "source": "iana" + }, + "application/vnd.yaoweme": { + "source": "iana" + }, + "application/vnd.yellowriver-custom-menu": { + "source": "iana", + "extensions": ["cmp"] + }, + "application/vnd.youtube.yt": { + "source": "iana" + }, + "application/vnd.zul": { + "source": "iana", + "extensions": ["zir","zirz"] + }, + "application/vnd.zzazz.deck+xml": { + "source": "iana", + "compressible": true, + "extensions": ["zaz"] + }, + "application/voicexml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["vxml"] + }, + "application/voucher-cms+json": { + "source": "iana", + "compressible": true + }, + "application/vq-rtcpxr": { + "source": "iana" + }, + "application/wasm": { + "compressible": true, + "extensions": ["wasm"] + }, + "application/watcherinfo+xml": { + "source": "iana", + "compressible": true + }, + "application/webpush-options+json": { + "source": "iana", + "compressible": true + }, + "application/whoispp-query": { + "source": "iana" + }, + "application/whoispp-response": { + "source": "iana" + }, + "application/widget": { + "source": "iana", + "extensions": ["wgt"] + }, + "application/winhlp": { + "source": "apache", + "extensions": ["hlp"] + }, + "application/wita": { + "source": "iana" + }, + "application/wordperfect5.1": { + "source": "iana" + }, + "application/wsdl+xml": { + "source": "iana", + "compressible": true, + "extensions": ["wsdl"] + }, + "application/wspolicy+xml": { + "source": "iana", + "compressible": true, + "extensions": ["wspolicy"] + }, + "application/x-7z-compressed": { + "source": "apache", + "compressible": false, + "extensions": ["7z"] + }, + "application/x-abiword": { + "source": "apache", + "extensions": ["abw"] + }, + "application/x-ace-compressed": { + "source": "apache", + "extensions": ["ace"] + }, + "application/x-amf": { + "source": "apache" + }, + "application/x-apple-diskimage": { + "source": "apache", + "extensions": ["dmg"] + }, + "application/x-arj": { + "compressible": false, + "extensions": ["arj"] + }, + "application/x-authorware-bin": { + "source": "apache", + "extensions": ["aab","x32","u32","vox"] + }, + "application/x-authorware-map": { + "source": "apache", + "extensions": ["aam"] + }, + "application/x-authorware-seg": { + "source": "apache", + "extensions": ["aas"] + }, + "application/x-bcpio": { + "source": "apache", + "extensions": ["bcpio"] + }, + "application/x-bdoc": { + "compressible": false, + "extensions": ["bdoc"] + }, + "application/x-bittorrent": { + "source": "apache", + "extensions": ["torrent"] + }, + "application/x-blorb": { + "source": "apache", + "extensions": ["blb","blorb"] + }, + "application/x-bzip": { + "source": "apache", + "compressible": false, + "extensions": ["bz"] + }, + "application/x-bzip2": { + "source": "apache", + "compressible": false, + "extensions": ["bz2","boz"] + }, + "application/x-cbr": { + "source": "apache", + "extensions": ["cbr","cba","cbt","cbz","cb7"] + }, + "application/x-cdlink": { + "source": "apache", + "extensions": ["vcd"] + }, + "application/x-cfs-compressed": { + "source": "apache", + "extensions": ["cfs"] + }, + "application/x-chat": { + "source": "apache", + "extensions": ["chat"] + }, + "application/x-chess-pgn": { + "source": "apache", + "extensions": ["pgn"] + }, + "application/x-chrome-extension": { + "extensions": ["crx"] + }, + "application/x-cocoa": { + "source": "nginx", + "extensions": ["cco"] + }, + "application/x-compress": { + "source": "apache" + }, + "application/x-conference": { + "source": "apache", + "extensions": ["nsc"] + }, + "application/x-cpio": { + "source": "apache", + "extensions": ["cpio"] + }, + "application/x-csh": { + "source": "apache", + "extensions": ["csh"] + }, + "application/x-deb": { + "compressible": false + }, + "application/x-debian-package": { + "source": "apache", + "extensions": ["deb","udeb"] + }, + "application/x-dgc-compressed": { + "source": "apache", + "extensions": ["dgc"] + }, + "application/x-director": { + "source": "apache", + "extensions": ["dir","dcr","dxr","cst","cct","cxt","w3d","fgd","swa"] + }, + "application/x-doom": { + "source": "apache", + "extensions": ["wad"] + }, + "application/x-dtbncx+xml": { + "source": "apache", + "compressible": true, + "extensions": ["ncx"] + }, + "application/x-dtbook+xml": { + "source": "apache", + "compressible": true, + "extensions": ["dtb"] + }, + "application/x-dtbresource+xml": { + "source": "apache", + "compressible": true, + "extensions": ["res"] + }, + "application/x-dvi": { + "source": "apache", + "compressible": false, + "extensions": ["dvi"] + }, + "application/x-envoy": { + "source": "apache", + "extensions": ["evy"] + }, + "application/x-eva": { + "source": "apache", + "extensions": ["eva"] + }, + "application/x-font-bdf": { + "source": "apache", + "extensions": ["bdf"] + }, + "application/x-font-dos": { + "source": "apache" + }, + "application/x-font-framemaker": { + "source": "apache" + }, + "application/x-font-ghostscript": { + "source": "apache", + "extensions": ["gsf"] + }, + "application/x-font-libgrx": { + "source": "apache" + }, + "application/x-font-linux-psf": { + "source": "apache", + "extensions": ["psf"] + }, + "application/x-font-pcf": { + "source": "apache", + "extensions": ["pcf"] + }, + "application/x-font-snf": { + "source": "apache", + "extensions": ["snf"] + }, + "application/x-font-speedo": { + "source": "apache" + }, + "application/x-font-sunos-news": { + "source": "apache" + }, + "application/x-font-type1": { + "source": "apache", + "extensions": ["pfa","pfb","pfm","afm"] + }, + "application/x-font-vfont": { + "source": "apache" + }, + "application/x-freearc": { + "source": "apache", + "extensions": ["arc"] + }, + "application/x-futuresplash": { + "source": "apache", + "extensions": ["spl"] + }, + "application/x-gca-compressed": { + "source": "apache", + "extensions": ["gca"] + }, + "application/x-glulx": { + "source": "apache", + "extensions": ["ulx"] + }, + "application/x-gnumeric": { + "source": "apache", + "extensions": ["gnumeric"] + }, + "application/x-gramps-xml": { + "source": "apache", + "extensions": ["gramps"] + }, + "application/x-gtar": { + "source": "apache", + "extensions": ["gtar"] + }, + "application/x-gzip": { + "source": "apache" + }, + "application/x-hdf": { + "source": "apache", + "extensions": ["hdf"] + }, + "application/x-httpd-php": { + "compressible": true, + "extensions": ["php"] + }, + "application/x-install-instructions": { + "source": "apache", + "extensions": ["install"] + }, + "application/x-iso9660-image": { + "source": "apache", + "extensions": ["iso"] + }, + "application/x-java-archive-diff": { + "source": "nginx", + "extensions": ["jardiff"] + }, + "application/x-java-jnlp-file": { + "source": "apache", + "compressible": false, + "extensions": ["jnlp"] + }, + "application/x-javascript": { + "compressible": true + }, + "application/x-keepass2": { + "extensions": ["kdbx"] + }, + "application/x-latex": { + "source": "apache", + "compressible": false, + "extensions": ["latex"] + }, + "application/x-lua-bytecode": { + "extensions": ["luac"] + }, + "application/x-lzh-compressed": { + "source": "apache", + "extensions": ["lzh","lha"] + }, + "application/x-makeself": { + "source": "nginx", + "extensions": ["run"] + }, + "application/x-mie": { + "source": "apache", + "extensions": ["mie"] + }, + "application/x-mobipocket-ebook": { + "source": "apache", + "extensions": ["prc","mobi"] + }, + "application/x-mpegurl": { + "compressible": false + }, + "application/x-ms-application": { + "source": "apache", + "extensions": ["application"] + }, + "application/x-ms-shortcut": { + "source": "apache", + "extensions": ["lnk"] + }, + "application/x-ms-wmd": { + "source": "apache", + "extensions": ["wmd"] + }, + "application/x-ms-wmz": { + "source": "apache", + "extensions": ["wmz"] + }, + "application/x-ms-xbap": { + "source": "apache", + "extensions": ["xbap"] + }, + "application/x-msaccess": { + "source": "apache", + "extensions": ["mdb"] + }, + "application/x-msbinder": { + "source": "apache", + "extensions": ["obd"] + }, + "application/x-mscardfile": { + "source": "apache", + "extensions": ["crd"] + }, + "application/x-msclip": { + "source": "apache", + "extensions": ["clp"] + }, + "application/x-msdos-program": { + "extensions": ["exe"] + }, + "application/x-msdownload": { + "source": "apache", + "extensions": ["exe","dll","com","bat","msi"] + }, + "application/x-msmediaview": { + "source": "apache", + "extensions": ["mvb","m13","m14"] + }, + "application/x-msmetafile": { + "source": "apache", + "extensions": ["wmf","wmz","emf","emz"] + }, + "application/x-msmoney": { + "source": "apache", + "extensions": ["mny"] + }, + "application/x-mspublisher": { + "source": "apache", + "extensions": ["pub"] + }, + "application/x-msschedule": { + "source": "apache", + "extensions": ["scd"] + }, + "application/x-msterminal": { + "source": "apache", + "extensions": ["trm"] + }, + "application/x-mswrite": { + "source": "apache", + "extensions": ["wri"] + }, + "application/x-netcdf": { + "source": "apache", + "extensions": ["nc","cdf"] + }, + "application/x-ns-proxy-autoconfig": { + "compressible": true, + "extensions": ["pac"] + }, + "application/x-nzb": { + "source": "apache", + "extensions": ["nzb"] + }, + "application/x-perl": { + "source": "nginx", + "extensions": ["pl","pm"] + }, + "application/x-pilot": { + "source": "nginx", + "extensions": ["prc","pdb"] + }, + "application/x-pkcs12": { + "source": "apache", + "compressible": false, + "extensions": ["p12","pfx"] + }, + "application/x-pkcs7-certificates": { + "source": "apache", + "extensions": ["p7b","spc"] + }, + "application/x-pkcs7-certreqresp": { + "source": "apache", + "extensions": ["p7r"] + }, + "application/x-pki-message": { + "source": "iana" + }, + "application/x-rar-compressed": { + "source": "apache", + "compressible": false, + "extensions": ["rar"] + }, + "application/x-redhat-package-manager": { + "source": "nginx", + "extensions": ["rpm"] + }, + "application/x-research-info-systems": { + "source": "apache", + "extensions": ["ris"] + }, + "application/x-sea": { + "source": "nginx", + "extensions": ["sea"] + }, + "application/x-sh": { + "source": "apache", + "compressible": true, + "extensions": ["sh"] + }, + "application/x-shar": { + "source": "apache", + "extensions": ["shar"] + }, + "application/x-shockwave-flash": { + "source": "apache", + "compressible": false, + "extensions": ["swf"] + }, + "application/x-silverlight-app": { + "source": "apache", + "extensions": ["xap"] + }, + "application/x-sql": { + "source": "apache", + "extensions": ["sql"] + }, + "application/x-stuffit": { + "source": "apache", + "compressible": false, + "extensions": ["sit"] + }, + "application/x-stuffitx": { + "source": "apache", + "extensions": ["sitx"] + }, + "application/x-subrip": { + "source": "apache", + "extensions": ["srt"] + }, + "application/x-sv4cpio": { + "source": "apache", + "extensions": ["sv4cpio"] + }, + "application/x-sv4crc": { + "source": "apache", + "extensions": ["sv4crc"] + }, + "application/x-t3vm-image": { + "source": "apache", + "extensions": ["t3"] + }, + "application/x-tads": { + "source": "apache", + "extensions": ["gam"] + }, + "application/x-tar": { + "source": "apache", + "compressible": true, + "extensions": ["tar"] + }, + "application/x-tcl": { + "source": "apache", + "extensions": ["tcl","tk"] + }, + "application/x-tex": { + "source": "apache", + "extensions": ["tex"] + }, + "application/x-tex-tfm": { + "source": "apache", + "extensions": ["tfm"] + }, + "application/x-texinfo": { + "source": "apache", + "extensions": ["texinfo","texi"] + }, + "application/x-tgif": { + "source": "apache", + "extensions": ["obj"] + }, + "application/x-ustar": { + "source": "apache", + "extensions": ["ustar"] + }, + "application/x-virtualbox-hdd": { + "compressible": true, + "extensions": ["hdd"] + }, + "application/x-virtualbox-ova": { + "compressible": true, + "extensions": ["ova"] + }, + "application/x-virtualbox-ovf": { + "compressible": true, + "extensions": ["ovf"] + }, + "application/x-virtualbox-vbox": { + "compressible": true, + "extensions": ["vbox"] + }, + "application/x-virtualbox-vbox-extpack": { + "compressible": false, + "extensions": ["vbox-extpack"] + }, + "application/x-virtualbox-vdi": { + "compressible": true, + "extensions": ["vdi"] + }, + "application/x-virtualbox-vhd": { + "compressible": true, + "extensions": ["vhd"] + }, + "application/x-virtualbox-vmdk": { + "compressible": true, + "extensions": ["vmdk"] + }, + "application/x-wais-source": { + "source": "apache", + "extensions": ["src"] + }, + "application/x-web-app-manifest+json": { + "compressible": true, + "extensions": ["webapp"] + }, + "application/x-www-form-urlencoded": { + "source": "iana", + "compressible": true + }, + "application/x-x509-ca-cert": { + "source": "iana", + "extensions": ["der","crt","pem"] + }, + "application/x-x509-ca-ra-cert": { + "source": "iana" + }, + "application/x-x509-next-ca-cert": { + "source": "iana" + }, + "application/x-xfig": { + "source": "apache", + "extensions": ["fig"] + }, + "application/x-xliff+xml": { + "source": "apache", + "compressible": true, + "extensions": ["xlf"] + }, + "application/x-xpinstall": { + "source": "apache", + "compressible": false, + "extensions": ["xpi"] + }, + "application/x-xz": { + "source": "apache", + "extensions": ["xz"] + }, + "application/x-zmachine": { + "source": "apache", + "extensions": ["z1","z2","z3","z4","z5","z6","z7","z8"] + }, + "application/x400-bp": { + "source": "iana" + }, + "application/xacml+xml": { + "source": "iana", + "compressible": true + }, + "application/xaml+xml": { + "source": "apache", + "compressible": true, + "extensions": ["xaml"] + }, + "application/xcap-att+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xav"] + }, + "application/xcap-caps+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xca"] + }, + "application/xcap-diff+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xdf"] + }, + "application/xcap-el+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xel"] + }, + "application/xcap-error+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xer"] + }, + "application/xcap-ns+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xns"] + }, + "application/xcon-conference-info+xml": { + "source": "iana", + "compressible": true + }, + "application/xcon-conference-info-diff+xml": { + "source": "iana", + "compressible": true + }, + "application/xenc+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xenc"] + }, + "application/xhtml+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xhtml","xht"] + }, + "application/xhtml-voice+xml": { + "source": "apache", + "compressible": true + }, + "application/xliff+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xlf"] + }, + "application/xml": { + "source": "iana", + "compressible": true, + "extensions": ["xml","xsl","xsd","rng"] + }, + "application/xml-dtd": { + "source": "iana", + "compressible": true, + "extensions": ["dtd"] + }, + "application/xml-external-parsed-entity": { + "source": "iana" + }, + "application/xml-patch+xml": { + "source": "iana", + "compressible": true + }, + "application/xmpp+xml": { + "source": "iana", + "compressible": true + }, + "application/xop+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xop"] + }, + "application/xproc+xml": { + "source": "apache", + "compressible": true, + "extensions": ["xpl"] + }, + "application/xslt+xml": { + "source": "iana", + "compressible": true, + "extensions": ["xslt"] + }, + "application/xspf+xml": { + "source": "apache", + "compressible": true, + "extensions": ["xspf"] + }, + "application/xv+xml": { + "source": "iana", + "compressible": true, + "extensions": ["mxml","xhvml","xvml","xvm"] + }, + "application/yang": { + "source": "iana", + "extensions": ["yang"] + }, + "application/yang-data+json": { + "source": "iana", + "compressible": true + }, + "application/yang-data+xml": { + "source": "iana", + "compressible": true + }, + "application/yang-patch+json": { + "source": "iana", + "compressible": true + }, + "application/yang-patch+xml": { + "source": "iana", + "compressible": true + }, + "application/yin+xml": { + "source": "iana", + "compressible": true, + "extensions": ["yin"] + }, + "application/zip": { + "source": "iana", + "compressible": false, + "extensions": ["zip"] + }, + "application/zlib": { + "source": "iana" + }, + "application/zstd": { + "source": "iana" + }, + "audio/1d-interleaved-parityfec": { + "source": "iana" + }, + "audio/32kadpcm": { + "source": "iana" + }, + "audio/3gpp": { + "source": "iana", + "compressible": false, + "extensions": ["3gpp"] + }, + "audio/3gpp2": { + "source": "iana" + }, + "audio/aac": { + "source": "iana" + }, + "audio/ac3": { + "source": "iana" + }, + "audio/adpcm": { + "source": "apache", + "extensions": ["adp"] + }, + "audio/amr": { + "source": "iana" + }, + "audio/amr-wb": { + "source": "iana" + }, + "audio/amr-wb+": { + "source": "iana" + }, + "audio/aptx": { + "source": "iana" + }, + "audio/asc": { + "source": "iana" + }, + "audio/atrac-advanced-lossless": { + "source": "iana" + }, + "audio/atrac-x": { + "source": "iana" + }, + "audio/atrac3": { + "source": "iana" + }, + "audio/basic": { + "source": "iana", + "compressible": false, + "extensions": ["au","snd"] + }, + "audio/bv16": { + "source": "iana" + }, + "audio/bv32": { + "source": "iana" + }, + "audio/clearmode": { + "source": "iana" + }, + "audio/cn": { + "source": "iana" + }, + "audio/dat12": { + "source": "iana" + }, + "audio/dls": { + "source": "iana" + }, + "audio/dsr-es201108": { + "source": "iana" + }, + "audio/dsr-es202050": { + "source": "iana" + }, + "audio/dsr-es202211": { + "source": "iana" + }, + "audio/dsr-es202212": { + "source": "iana" + }, + "audio/dv": { + "source": "iana" + }, + "audio/dvi4": { + "source": "iana" + }, + "audio/eac3": { + "source": "iana" + }, + "audio/encaprtp": { + "source": "iana" + }, + "audio/evrc": { + "source": "iana" + }, + "audio/evrc-qcp": { + "source": "iana" + }, + "audio/evrc0": { + "source": "iana" + }, + "audio/evrc1": { + "source": "iana" + }, + "audio/evrcb": { + "source": "iana" + }, + "audio/evrcb0": { + "source": "iana" + }, + "audio/evrcb1": { + "source": "iana" + }, + "audio/evrcnw": { + "source": "iana" + }, + "audio/evrcnw0": { + "source": "iana" + }, + "audio/evrcnw1": { + "source": "iana" + }, + "audio/evrcwb": { + "source": "iana" + }, + "audio/evrcwb0": { + "source": "iana" + }, + "audio/evrcwb1": { + "source": "iana" + }, + "audio/evs": { + "source": "iana" + }, + "audio/flexfec": { + "source": "iana" + }, + "audio/fwdred": { + "source": "iana" + }, + "audio/g711-0": { + "source": "iana" + }, + "audio/g719": { + "source": "iana" + }, + "audio/g722": { + "source": "iana" + }, + "audio/g7221": { + "source": "iana" + }, + "audio/g723": { + "source": "iana" + }, + "audio/g726-16": { + "source": "iana" + }, + "audio/g726-24": { + "source": "iana" + }, + "audio/g726-32": { + "source": "iana" + }, + "audio/g726-40": { + "source": "iana" + }, + "audio/g728": { + "source": "iana" + }, + "audio/g729": { + "source": "iana" + }, + "audio/g7291": { + "source": "iana" + }, + "audio/g729d": { + "source": "iana" + }, + "audio/g729e": { + "source": "iana" + }, + "audio/gsm": { + "source": "iana" + }, + "audio/gsm-efr": { + "source": "iana" + }, + "audio/gsm-hr-08": { + "source": "iana" + }, + "audio/ilbc": { + "source": "iana" + }, + "audio/ip-mr_v2.5": { + "source": "iana" + }, + "audio/isac": { + "source": "apache" + }, + "audio/l16": { + "source": "iana" + }, + "audio/l20": { + "source": "iana" + }, + "audio/l24": { + "source": "iana", + "compressible": false + }, + "audio/l8": { + "source": "iana" + }, + "audio/lpc": { + "source": "iana" + }, + "audio/melp": { + "source": "iana" + }, + "audio/melp1200": { + "source": "iana" + }, + "audio/melp2400": { + "source": "iana" + }, + "audio/melp600": { + "source": "iana" + }, + "audio/mhas": { + "source": "iana" + }, + "audio/midi": { + "source": "apache", + "extensions": ["mid","midi","kar","rmi"] + }, + "audio/mobile-xmf": { + "source": "iana", + "extensions": ["mxmf"] + }, + "audio/mp3": { + "compressible": false, + "extensions": ["mp3"] + }, + "audio/mp4": { + "source": "iana", + "compressible": false, + "extensions": ["m4a","mp4a"] + }, + "audio/mp4a-latm": { + "source": "iana" + }, + "audio/mpa": { + "source": "iana" + }, + "audio/mpa-robust": { + "source": "iana" + }, + "audio/mpeg": { + "source": "iana", + "compressible": false, + "extensions": ["mpga","mp2","mp2a","mp3","m2a","m3a"] + }, + "audio/mpeg4-generic": { + "source": "iana" + }, + "audio/musepack": { + "source": "apache" + }, + "audio/ogg": { + "source": "iana", + "compressible": false, + "extensions": ["oga","ogg","spx"] + }, + "audio/opus": { + "source": "iana" + }, + "audio/parityfec": { + "source": "iana" + }, + "audio/pcma": { + "source": "iana" + }, + "audio/pcma-wb": { + "source": "iana" + }, + "audio/pcmu": { + "source": "iana" + }, + "audio/pcmu-wb": { + "source": "iana" + }, + "audio/prs.sid": { + "source": "iana" + }, + "audio/qcelp": { + "source": "iana" + }, + "audio/raptorfec": { + "source": "iana" + }, + "audio/red": { + "source": "iana" + }, + "audio/rtp-enc-aescm128": { + "source": "iana" + }, + "audio/rtp-midi": { + "source": "iana" + }, + "audio/rtploopback": { + "source": "iana" + }, + "audio/rtx": { + "source": "iana" + }, + "audio/s3m": { + "source": "apache", + "extensions": ["s3m"] + }, + "audio/silk": { + "source": "apache", + "extensions": ["sil"] + }, + "audio/smv": { + "source": "iana" + }, + "audio/smv-qcp": { + "source": "iana" + }, + "audio/smv0": { + "source": "iana" + }, + "audio/sp-midi": { + "source": "iana" + }, + "audio/speex": { + "source": "iana" + }, + "audio/t140c": { + "source": "iana" + }, + "audio/t38": { + "source": "iana" + }, + "audio/telephone-event": { + "source": "iana" + }, + "audio/tetra_acelp": { + "source": "iana" + }, + "audio/tetra_acelp_bb": { + "source": "iana" + }, + "audio/tone": { + "source": "iana" + }, + "audio/uemclip": { + "source": "iana" + }, + "audio/ulpfec": { + "source": "iana" + }, + "audio/usac": { + "source": "iana" + }, + "audio/vdvi": { + "source": "iana" + }, + "audio/vmr-wb": { + "source": "iana" + }, + "audio/vnd.3gpp.iufp": { + "source": "iana" + }, + "audio/vnd.4sb": { + "source": "iana" + }, + "audio/vnd.audiokoz": { + "source": "iana" + }, + "audio/vnd.celp": { + "source": "iana" + }, + "audio/vnd.cisco.nse": { + "source": "iana" + }, + "audio/vnd.cmles.radio-events": { + "source": "iana" + }, + "audio/vnd.cns.anp1": { + "source": "iana" + }, + "audio/vnd.cns.inf1": { + "source": "iana" + }, + "audio/vnd.dece.audio": { + "source": "iana", + "extensions": ["uva","uvva"] + }, + "audio/vnd.digital-winds": { + "source": "iana", + "extensions": ["eol"] + }, + "audio/vnd.dlna.adts": { + "source": "iana" + }, + "audio/vnd.dolby.heaac.1": { + "source": "iana" + }, + "audio/vnd.dolby.heaac.2": { + "source": "iana" + }, + "audio/vnd.dolby.mlp": { + "source": "iana" + }, + "audio/vnd.dolby.mps": { + "source": "iana" + }, + "audio/vnd.dolby.pl2": { + "source": "iana" + }, + "audio/vnd.dolby.pl2x": { + "source": "iana" + }, + "audio/vnd.dolby.pl2z": { + "source": "iana" + }, + "audio/vnd.dolby.pulse.1": { + "source": "iana" + }, + "audio/vnd.dra": { + "source": "iana", + "extensions": ["dra"] + }, + "audio/vnd.dts": { + "source": "iana", + "extensions": ["dts"] + }, + "audio/vnd.dts.hd": { + "source": "iana", + "extensions": ["dtshd"] + }, + "audio/vnd.dts.uhd": { + "source": "iana" + }, + "audio/vnd.dvb.file": { + "source": "iana" + }, + "audio/vnd.everad.plj": { + "source": "iana" + }, + "audio/vnd.hns.audio": { + "source": "iana" + }, + "audio/vnd.lucent.voice": { + "source": "iana", + "extensions": ["lvp"] + }, + "audio/vnd.ms-playready.media.pya": { + "source": "iana", + "extensions": ["pya"] + }, + "audio/vnd.nokia.mobile-xmf": { + "source": "iana" + }, + "audio/vnd.nortel.vbk": { + "source": "iana" + }, + "audio/vnd.nuera.ecelp4800": { + "source": "iana", + "extensions": ["ecelp4800"] + }, + "audio/vnd.nuera.ecelp7470": { + "source": "iana", + "extensions": ["ecelp7470"] + }, + "audio/vnd.nuera.ecelp9600": { + "source": "iana", + "extensions": ["ecelp9600"] + }, + "audio/vnd.octel.sbc": { + "source": "iana" + }, + "audio/vnd.presonus.multitrack": { + "source": "iana" + }, + "audio/vnd.qcelp": { + "source": "iana" + }, + "audio/vnd.rhetorex.32kadpcm": { + "source": "iana" + }, + "audio/vnd.rip": { + "source": "iana", + "extensions": ["rip"] + }, + "audio/vnd.rn-realaudio": { + "compressible": false + }, + "audio/vnd.sealedmedia.softseal.mpeg": { + "source": "iana" + }, + "audio/vnd.vmx.cvsd": { + "source": "iana" + }, + "audio/vnd.wave": { + "compressible": false + }, + "audio/vorbis": { + "source": "iana", + "compressible": false + }, + "audio/vorbis-config": { + "source": "iana" + }, + "audio/wav": { + "compressible": false, + "extensions": ["wav"] + }, + "audio/wave": { + "compressible": false, + "extensions": ["wav"] + }, + "audio/webm": { + "source": "apache", + "compressible": false, + "extensions": ["weba"] + }, + "audio/x-aac": { + "source": "apache", + "compressible": false, + "extensions": ["aac"] + }, + "audio/x-aiff": { + "source": "apache", + "extensions": ["aif","aiff","aifc"] + }, + "audio/x-caf": { + "source": "apache", + "compressible": false, + "extensions": ["caf"] + }, + "audio/x-flac": { + "source": "apache", + "extensions": ["flac"] + }, + "audio/x-m4a": { + "source": "nginx", + "extensions": ["m4a"] + }, + "audio/x-matroska": { + "source": "apache", + "extensions": ["mka"] + }, + "audio/x-mpegurl": { + "source": "apache", + "extensions": ["m3u"] + }, + "audio/x-ms-wax": { + "source": "apache", + "extensions": ["wax"] + }, + "audio/x-ms-wma": { + "source": "apache", + "extensions": ["wma"] + }, + "audio/x-pn-realaudio": { + "source": "apache", + "extensions": ["ram","ra"] + }, + "audio/x-pn-realaudio-plugin": { + "source": "apache", + "extensions": ["rmp"] + }, + "audio/x-realaudio": { + "source": "nginx", + "extensions": ["ra"] + }, + "audio/x-tta": { + "source": "apache" + }, + "audio/x-wav": { + "source": "apache", + "extensions": ["wav"] + }, + "audio/xm": { + "source": "apache", + "extensions": ["xm"] + }, + "chemical/x-cdx": { + "source": "apache", + "extensions": ["cdx"] + }, + "chemical/x-cif": { + "source": "apache", + "extensions": ["cif"] + }, + "chemical/x-cmdf": { + "source": "apache", + "extensions": ["cmdf"] + }, + "chemical/x-cml": { + "source": "apache", + "extensions": ["cml"] + }, + "chemical/x-csml": { + "source": "apache", + "extensions": ["csml"] + }, + "chemical/x-pdb": { + "source": "apache" + }, + "chemical/x-xyz": { + "source": "apache", + "extensions": ["xyz"] + }, + "font/collection": { + "source": "iana", + "extensions": ["ttc"] + }, + "font/otf": { + "source": "iana", + "compressible": true, + "extensions": ["otf"] + }, + "font/sfnt": { + "source": "iana" + }, + "font/ttf": { + "source": "iana", + "compressible": true, + "extensions": ["ttf"] + }, + "font/woff": { + "source": "iana", + "extensions": ["woff"] + }, + "font/woff2": { + "source": "iana", + "extensions": ["woff2"] + }, + "image/aces": { + "source": "iana", + "extensions": ["exr"] + }, + "image/apng": { + "compressible": false, + "extensions": ["apng"] + }, + "image/avci": { + "source": "iana" + }, + "image/avcs": { + "source": "iana" + }, + "image/bmp": { + "source": "iana", + "compressible": true, + "extensions": ["bmp"] + }, + "image/cgm": { + "source": "iana", + "extensions": ["cgm"] + }, + "image/dicom-rle": { + "source": "iana", + "extensions": ["drle"] + }, + "image/emf": { + "source": "iana", + "extensions": ["emf"] + }, + "image/fits": { + "source": "iana", + "extensions": ["fits"] + }, + "image/g3fax": { + "source": "iana", + "extensions": ["g3"] + }, + "image/gif": { + "source": "iana", + "compressible": false, + "extensions": ["gif"] + }, + "image/heic": { + "source": "iana", + "extensions": ["heic"] + }, + "image/heic-sequence": { + "source": "iana", + "extensions": ["heics"] + }, + "image/heif": { + "source": "iana", + "extensions": ["heif"] + }, + "image/heif-sequence": { + "source": "iana", + "extensions": ["heifs"] + }, + "image/hej2k": { + "source": "iana", + "extensions": ["hej2"] + }, + "image/hsj2": { + "source": "iana", + "extensions": ["hsj2"] + }, + "image/ief": { + "source": "iana", + "extensions": ["ief"] + }, + "image/jls": { + "source": "iana", + "extensions": ["jls"] + }, + "image/jp2": { + "source": "iana", + "compressible": false, + "extensions": ["jp2","jpg2"] + }, + "image/jpeg": { + "source": "iana", + "compressible": false, + "extensions": ["jpeg","jpg","jpe"] + }, + "image/jph": { + "source": "iana", + "extensions": ["jph"] + }, + "image/jphc": { + "source": "iana", + "extensions": ["jhc"] + }, + "image/jpm": { + "source": "iana", + "compressible": false, + "extensions": ["jpm"] + }, + "image/jpx": { + "source": "iana", + "compressible": false, + "extensions": ["jpx","jpf"] + }, + "image/jxr": { + "source": "iana", + "extensions": ["jxr"] + }, + "image/jxra": { + "source": "iana", + "extensions": ["jxra"] + }, + "image/jxrs": { + "source": "iana", + "extensions": ["jxrs"] + }, + "image/jxs": { + "source": "iana", + "extensions": ["jxs"] + }, + "image/jxsc": { + "source": "iana", + "extensions": ["jxsc"] + }, + "image/jxsi": { + "source": "iana", + "extensions": ["jxsi"] + }, + "image/jxss": { + "source": "iana", + "extensions": ["jxss"] + }, + "image/ktx": { + "source": "iana", + "extensions": ["ktx"] + }, + "image/naplps": { + "source": "iana" + }, + "image/pjpeg": { + "compressible": false + }, + "image/png": { + "source": "iana", + "compressible": false, + "extensions": ["png"] + }, + "image/prs.btif": { + "source": "iana", + "extensions": ["btif"] + }, + "image/prs.pti": { + "source": "iana", + "extensions": ["pti"] + }, + "image/pwg-raster": { + "source": "iana" + }, + "image/sgi": { + "source": "apache", + "extensions": ["sgi"] + }, + "image/svg+xml": { + "source": "iana", + "compressible": true, + "extensions": ["svg","svgz"] + }, + "image/t38": { + "source": "iana", + "extensions": ["t38"] + }, + "image/tiff": { + "source": "iana", + "compressible": false, + "extensions": ["tif","tiff"] + }, + "image/tiff-fx": { + "source": "iana", + "extensions": ["tfx"] + }, + "image/vnd.adobe.photoshop": { + "source": "iana", + "compressible": true, + "extensions": ["psd"] + }, + "image/vnd.airzip.accelerator.azv": { + "source": "iana", + "extensions": ["azv"] + }, + "image/vnd.cns.inf2": { + "source": "iana" + }, + "image/vnd.dece.graphic": { + "source": "iana", + "extensions": ["uvi","uvvi","uvg","uvvg"] + }, + "image/vnd.djvu": { + "source": "iana", + "extensions": ["djvu","djv"] + }, + "image/vnd.dvb.subtitle": { + "source": "iana", + "extensions": ["sub"] + }, + "image/vnd.dwg": { + "source": "iana", + "extensions": ["dwg"] + }, + "image/vnd.dxf": { + "source": "iana", + "extensions": ["dxf"] + }, + "image/vnd.fastbidsheet": { + "source": "iana", + "extensions": ["fbs"] + }, + "image/vnd.fpx": { + "source": "iana", + "extensions": ["fpx"] + }, + "image/vnd.fst": { + "source": "iana", + "extensions": ["fst"] + }, + "image/vnd.fujixerox.edmics-mmr": { + "source": "iana", + "extensions": ["mmr"] + }, + "image/vnd.fujixerox.edmics-rlc": { + "source": "iana", + "extensions": ["rlc"] + }, + "image/vnd.globalgraphics.pgb": { + "source": "iana" + }, + "image/vnd.microsoft.icon": { + "source": "iana", + "extensions": ["ico"] + }, + "image/vnd.mix": { + "source": "iana" + }, + "image/vnd.mozilla.apng": { + "source": "iana" + }, + "image/vnd.ms-dds": { + "extensions": ["dds"] + }, + "image/vnd.ms-modi": { + "source": "iana", + "extensions": ["mdi"] + }, + "image/vnd.ms-photo": { + "source": "apache", + "extensions": ["wdp"] + }, + "image/vnd.net-fpx": { + "source": "iana", + "extensions": ["npx"] + }, + "image/vnd.radiance": { + "source": "iana" + }, + "image/vnd.sealed.png": { + "source": "iana" + }, + "image/vnd.sealedmedia.softseal.gif": { + "source": "iana" + }, + "image/vnd.sealedmedia.softseal.jpg": { + "source": "iana" + }, + "image/vnd.svf": { + "source": "iana" + }, + "image/vnd.tencent.tap": { + "source": "iana", + "extensions": ["tap"] + }, + "image/vnd.valve.source.texture": { + "source": "iana", + "extensions": ["vtf"] + }, + "image/vnd.wap.wbmp": { + "source": "iana", + "extensions": ["wbmp"] + }, + "image/vnd.xiff": { + "source": "iana", + "extensions": ["xif"] + }, + "image/vnd.zbrush.pcx": { + "source": "iana", + "extensions": ["pcx"] + }, + "image/webp": { + "source": "apache", + "extensions": ["webp"] + }, + "image/wmf": { + "source": "iana", + "extensions": ["wmf"] + }, + "image/x-3ds": { + "source": "apache", + "extensions": ["3ds"] + }, + "image/x-cmu-raster": { + "source": "apache", + "extensions": ["ras"] + }, + "image/x-cmx": { + "source": "apache", + "extensions": ["cmx"] + }, + "image/x-freehand": { + "source": "apache", + "extensions": ["fh","fhc","fh4","fh5","fh7"] + }, + "image/x-icon": { + "source": "apache", + "compressible": true, + "extensions": ["ico"] + }, + "image/x-jng": { + "source": "nginx", + "extensions": ["jng"] + }, + "image/x-mrsid-image": { + "source": "apache", + "extensions": ["sid"] + }, + "image/x-ms-bmp": { + "source": "nginx", + "compressible": true, + "extensions": ["bmp"] + }, + "image/x-pcx": { + "source": "apache", + "extensions": ["pcx"] + }, + "image/x-pict": { + "source": "apache", + "extensions": ["pic","pct"] + }, + "image/x-portable-anymap": { + "source": "apache", + "extensions": ["pnm"] + }, + "image/x-portable-bitmap": { + "source": "apache", + "extensions": ["pbm"] + }, + "image/x-portable-graymap": { + "source": "apache", + "extensions": ["pgm"] + }, + "image/x-portable-pixmap": { + "source": "apache", + "extensions": ["ppm"] + }, + "image/x-rgb": { + "source": "apache", + "extensions": ["rgb"] + }, + "image/x-tga": { + "source": "apache", + "extensions": ["tga"] + }, + "image/x-xbitmap": { + "source": "apache", + "extensions": ["xbm"] + }, + "image/x-xcf": { + "compressible": false + }, + "image/x-xpixmap": { + "source": "apache", + "extensions": ["xpm"] + }, + "image/x-xwindowdump": { + "source": "apache", + "extensions": ["xwd"] + }, + "message/cpim": { + "source": "iana" + }, + "message/delivery-status": { + "source": "iana" + }, + "message/disposition-notification": { + "source": "iana", + "extensions": [ + "disposition-notification" + ] + }, + "message/external-body": { + "source": "iana" + }, + "message/feedback-report": { + "source": "iana" + }, + "message/global": { + "source": "iana", + "extensions": ["u8msg"] + }, + "message/global-delivery-status": { + "source": "iana", + "extensions": ["u8dsn"] + }, + "message/global-disposition-notification": { + "source": "iana", + "extensions": ["u8mdn"] + }, + "message/global-headers": { + "source": "iana", + "extensions": ["u8hdr"] + }, + "message/http": { + "source": "iana", + "compressible": false + }, + "message/imdn+xml": { + "source": "iana", + "compressible": true + }, + "message/news": { + "source": "iana" + }, + "message/partial": { + "source": "iana", + "compressible": false + }, + "message/rfc822": { + "source": "iana", + "compressible": true, + "extensions": ["eml","mime"] + }, + "message/s-http": { + "source": "iana" + }, + "message/sip": { + "source": "iana" + }, + "message/sipfrag": { + "source": "iana" + }, + "message/tracking-status": { + "source": "iana" + }, + "message/vnd.si.simp": { + "source": "iana" + }, + "message/vnd.wfa.wsc": { + "source": "iana", + "extensions": ["wsc"] + }, + "model/3mf": { + "source": "iana", + "extensions": ["3mf"] + }, + "model/gltf+json": { + "source": "iana", + "compressible": true, + "extensions": ["gltf"] + }, + "model/gltf-binary": { + "source": "iana", + "compressible": true, + "extensions": ["glb"] + }, + "model/iges": { + "source": "iana", + "compressible": false, + "extensions": ["igs","iges"] + }, + "model/mesh": { + "source": "iana", + "compressible": false, + "extensions": ["msh","mesh","silo"] + }, + "model/mtl": { + "source": "iana", + "extensions": ["mtl"] + }, + "model/obj": { + "source": "iana", + "extensions": ["obj"] + }, + "model/stl": { + "source": "iana", + "extensions": ["stl"] + }, + "model/vnd.collada+xml": { + "source": "iana", + "compressible": true, + "extensions": ["dae"] + }, + "model/vnd.dwf": { + "source": "iana", + "extensions": ["dwf"] + }, + "model/vnd.flatland.3dml": { + "source": "iana" + }, + "model/vnd.gdl": { + "source": "iana", + "extensions": ["gdl"] + }, + "model/vnd.gs-gdl": { + "source": "apache" + }, + "model/vnd.gs.gdl": { + "source": "iana" + }, + "model/vnd.gtw": { + "source": "iana", + "extensions": ["gtw"] + }, + "model/vnd.moml+xml": { + "source": "iana", + "compressible": true + }, + "model/vnd.mts": { + "source": "iana", + "extensions": ["mts"] + }, + "model/vnd.opengex": { + "source": "iana", + "extensions": ["ogex"] + }, + "model/vnd.parasolid.transmit.binary": { + "source": "iana", + "extensions": ["x_b"] + }, + "model/vnd.parasolid.transmit.text": { + "source": "iana", + "extensions": ["x_t"] + }, + "model/vnd.rosette.annotated-data-model": { + "source": "iana" + }, + "model/vnd.usdz+zip": { + "source": "iana", + "compressible": false, + "extensions": ["usdz"] + }, + "model/vnd.valve.source.compiled-map": { + "source": "iana", + "extensions": ["bsp"] + }, + "model/vnd.vtu": { + "source": "iana", + "extensions": ["vtu"] + }, + "model/vrml": { + "source": "iana", + "compressible": false, + "extensions": ["wrl","vrml"] + }, + "model/x3d+binary": { + "source": "apache", + "compressible": false, + "extensions": ["x3db","x3dbz"] + }, + "model/x3d+fastinfoset": { + "source": "iana", + "extensions": ["x3db"] + }, + "model/x3d+vrml": { + "source": "apache", + "compressible": false, + "extensions": ["x3dv","x3dvz"] + }, + "model/x3d+xml": { + "source": "iana", + "compressible": true, + "extensions": ["x3d","x3dz"] + }, + "model/x3d-vrml": { + "source": "iana", + "extensions": ["x3dv"] + }, + "multipart/alternative": { + "source": "iana", + "compressible": false + }, + "multipart/appledouble": { + "source": "iana" + }, + "multipart/byteranges": { + "source": "iana" + }, + "multipart/digest": { + "source": "iana" + }, + "multipart/encrypted": { + "source": "iana", + "compressible": false + }, + "multipart/form-data": { + "source": "iana", + "compressible": false + }, + "multipart/header-set": { + "source": "iana" + }, + "multipart/mixed": { + "source": "iana" + }, + "multipart/multilingual": { + "source": "iana" + }, + "multipart/parallel": { + "source": "iana" + }, + "multipart/related": { + "source": "iana", + "compressible": false + }, + "multipart/report": { + "source": "iana" + }, + "multipart/signed": { + "source": "iana", + "compressible": false + }, + "multipart/vnd.bint.med-plus": { + "source": "iana" + }, + "multipart/voice-message": { + "source": "iana" + }, + "multipart/x-mixed-replace": { + "source": "iana" + }, + "text/1d-interleaved-parityfec": { + "source": "iana" + }, + "text/cache-manifest": { + "source": "iana", + "compressible": true, + "extensions": ["appcache","manifest"] + }, + "text/calendar": { + "source": "iana", + "extensions": ["ics","ifb"] + }, + "text/calender": { + "compressible": true + }, + "text/cmd": { + "compressible": true + }, + "text/coffeescript": { + "extensions": ["coffee","litcoffee"] + }, + "text/css": { + "source": "iana", + "charset": "UTF-8", + "compressible": true, + "extensions": ["css"] + }, + "text/csv": { + "source": "iana", + "compressible": true, + "extensions": ["csv"] + }, + "text/csv-schema": { + "source": "iana" + }, + "text/directory": { + "source": "iana" + }, + "text/dns": { + "source": "iana" + }, + "text/ecmascript": { + "source": "iana" + }, + "text/encaprtp": { + "source": "iana" + }, + "text/enriched": { + "source": "iana" + }, + "text/flexfec": { + "source": "iana" + }, + "text/fwdred": { + "source": "iana" + }, + "text/grammar-ref-list": { + "source": "iana" + }, + "text/html": { + "source": "iana", + "compressible": true, + "extensions": ["html","htm","shtml"] + }, + "text/jade": { + "extensions": ["jade"] + }, + "text/javascript": { + "source": "iana", + "compressible": true + }, + "text/jcr-cnd": { + "source": "iana" + }, + "text/jsx": { + "compressible": true, + "extensions": ["jsx"] + }, + "text/less": { + "compressible": true, + "extensions": ["less"] + }, + "text/markdown": { + "source": "iana", + "compressible": true, + "extensions": ["markdown","md"] + }, + "text/mathml": { + "source": "nginx", + "extensions": ["mml"] + }, + "text/mdx": { + "compressible": true, + "extensions": ["mdx"] + }, + "text/mizar": { + "source": "iana" + }, + "text/n3": { + "source": "iana", + "charset": "UTF-8", + "compressible": true, + "extensions": ["n3"] + }, + "text/parameters": { + "source": "iana", + "charset": "UTF-8" + }, + "text/parityfec": { + "source": "iana" + }, + "text/plain": { + "source": "iana", + "compressible": true, + "extensions": ["txt","text","conf","def","list","log","in","ini"] + }, + "text/provenance-notation": { + "source": "iana", + "charset": "UTF-8" + }, + "text/prs.fallenstein.rst": { + "source": "iana" + }, + "text/prs.lines.tag": { + "source": "iana", + "extensions": ["dsc"] + }, + "text/prs.prop.logic": { + "source": "iana" + }, + "text/raptorfec": { + "source": "iana" + }, + "text/red": { + "source": "iana" + }, + "text/rfc822-headers": { + "source": "iana" + }, + "text/richtext": { + "source": "iana", + "compressible": true, + "extensions": ["rtx"] + }, + "text/rtf": { + "source": "iana", + "compressible": true, + "extensions": ["rtf"] + }, + "text/rtp-enc-aescm128": { + "source": "iana" + }, + "text/rtploopback": { + "source": "iana" + }, + "text/rtx": { + "source": "iana" + }, + "text/sgml": { + "source": "iana", + "extensions": ["sgml","sgm"] + }, + "text/shex": { + "extensions": ["shex"] + }, + "text/slim": { + "extensions": ["slim","slm"] + }, + "text/strings": { + "source": "iana" + }, + "text/stylus": { + "extensions": ["stylus","styl"] + }, + "text/t140": { + "source": "iana" + }, + "text/tab-separated-values": { + "source": "iana", + "compressible": true, + "extensions": ["tsv"] + }, + "text/troff": { + "source": "iana", + "extensions": ["t","tr","roff","man","me","ms"] + }, + "text/turtle": { + "source": "iana", + "charset": "UTF-8", + "extensions": ["ttl"] + }, + "text/ulpfec": { + "source": "iana" + }, + "text/uri-list": { + "source": "iana", + "compressible": true, + "extensions": ["uri","uris","urls"] + }, + "text/vcard": { + "source": "iana", + "compressible": true, + "extensions": ["vcard"] + }, + "text/vnd.a": { + "source": "iana" + }, + "text/vnd.abc": { + "source": "iana" + }, + "text/vnd.ascii-art": { + "source": "iana" + }, + "text/vnd.curl": { + "source": "iana", + "extensions": ["curl"] + }, + "text/vnd.curl.dcurl": { + "source": "apache", + "extensions": ["dcurl"] + }, + "text/vnd.curl.mcurl": { + "source": "apache", + "extensions": ["mcurl"] + }, + "text/vnd.curl.scurl": { + "source": "apache", + "extensions": ["scurl"] + }, + "text/vnd.debian.copyright": { + "source": "iana", + "charset": "UTF-8" + }, + "text/vnd.dmclientscript": { + "source": "iana" + }, + "text/vnd.dvb.subtitle": { + "source": "iana", + "extensions": ["sub"] + }, + "text/vnd.esmertec.theme-descriptor": { + "source": "iana", + "charset": "UTF-8" + }, + "text/vnd.ficlab.flt": { + "source": "iana" + }, + "text/vnd.fly": { + "source": "iana", + "extensions": ["fly"] + }, + "text/vnd.fmi.flexstor": { + "source": "iana", + "extensions": ["flx"] + }, + "text/vnd.gml": { + "source": "iana" + }, + "text/vnd.graphviz": { + "source": "iana", + "extensions": ["gv"] + }, + "text/vnd.hgl": { + "source": "iana" + }, + "text/vnd.in3d.3dml": { + "source": "iana", + "extensions": ["3dml"] + }, + "text/vnd.in3d.spot": { + "source": "iana", + "extensions": ["spot"] + }, + "text/vnd.iptc.newsml": { + "source": "iana" + }, + "text/vnd.iptc.nitf": { + "source": "iana" + }, + "text/vnd.latex-z": { + "source": "iana" + }, + "text/vnd.motorola.reflex": { + "source": "iana" + }, + "text/vnd.ms-mediapackage": { + "source": "iana" + }, + "text/vnd.net2phone.commcenter.command": { + "source": "iana" + }, + "text/vnd.radisys.msml-basic-layout": { + "source": "iana" + }, + "text/vnd.senx.warpscript": { + "source": "iana" + }, + "text/vnd.si.uricatalogue": { + "source": "iana" + }, + "text/vnd.sosi": { + "source": "iana" + }, + "text/vnd.sun.j2me.app-descriptor": { + "source": "iana", + "charset": "UTF-8", + "extensions": ["jad"] + }, + "text/vnd.trolltech.linguist": { + "source": "iana", + "charset": "UTF-8" + }, + "text/vnd.wap.si": { + "source": "iana" + }, + "text/vnd.wap.sl": { + "source": "iana" + }, + "text/vnd.wap.wml": { + "source": "iana", + "extensions": ["wml"] + }, + "text/vnd.wap.wmlscript": { + "source": "iana", + "extensions": ["wmls"] + }, + "text/vtt": { + "source": "iana", + "charset": "UTF-8", + "compressible": true, + "extensions": ["vtt"] + }, + "text/x-asm": { + "source": "apache", + "extensions": ["s","asm"] + }, + "text/x-c": { + "source": "apache", + "extensions": ["c","cc","cxx","cpp","h","hh","dic"] + }, + "text/x-component": { + "source": "nginx", + "extensions": ["htc"] + }, + "text/x-fortran": { + "source": "apache", + "extensions": ["f","for","f77","f90"] + }, + "text/x-gwt-rpc": { + "compressible": true + }, + "text/x-handlebars-template": { + "extensions": ["hbs"] + }, + "text/x-java-source": { + "source": "apache", + "extensions": ["java"] + }, + "text/x-jquery-tmpl": { + "compressible": true + }, + "text/x-lua": { + "extensions": ["lua"] + }, + "text/x-markdown": { + "compressible": true, + "extensions": ["mkd"] + }, + "text/x-nfo": { + "source": "apache", + "extensions": ["nfo"] + }, + "text/x-opml": { + "source": "apache", + "extensions": ["opml"] + }, + "text/x-org": { + "compressible": true, + "extensions": ["org"] + }, + "text/x-pascal": { + "source": "apache", + "extensions": ["p","pas"] + }, + "text/x-processing": { + "compressible": true, + "extensions": ["pde"] + }, + "text/x-sass": { + "extensions": ["sass"] + }, + "text/x-scss": { + "extensions": ["scss"] + }, + "text/x-setext": { + "source": "apache", + "extensions": ["etx"] + }, + "text/x-sfv": { + "source": "apache", + "extensions": ["sfv"] + }, + "text/x-suse-ymp": { + "compressible": true, + "extensions": ["ymp"] + }, + "text/x-uuencode": { + "source": "apache", + "extensions": ["uu"] + }, + "text/x-vcalendar": { + "source": "apache", + "extensions": ["vcs"] + }, + "text/x-vcard": { + "source": "apache", + "extensions": ["vcf"] + }, + "text/xml": { + "source": "iana", + "compressible": true, + "extensions": ["xml"] + }, + "text/xml-external-parsed-entity": { + "source": "iana" + }, + "text/yaml": { + "extensions": ["yaml","yml"] + }, + "video/1d-interleaved-parityfec": { + "source": "iana" + }, + "video/3gpp": { + "source": "iana", + "extensions": ["3gp","3gpp"] + }, + "video/3gpp-tt": { + "source": "iana" + }, + "video/3gpp2": { + "source": "iana", + "extensions": ["3g2"] + }, + "video/bmpeg": { + "source": "iana" + }, + "video/bt656": { + "source": "iana" + }, + "video/celb": { + "source": "iana" + }, + "video/dv": { + "source": "iana" + }, + "video/encaprtp": { + "source": "iana" + }, + "video/flexfec": { + "source": "iana" + }, + "video/h261": { + "source": "iana", + "extensions": ["h261"] + }, + "video/h263": { + "source": "iana", + "extensions": ["h263"] + }, + "video/h263-1998": { + "source": "iana" + }, + "video/h263-2000": { + "source": "iana" + }, + "video/h264": { + "source": "iana", + "extensions": ["h264"] + }, + "video/h264-rcdo": { + "source": "iana" + }, + "video/h264-svc": { + "source": "iana" + }, + "video/h265": { + "source": "iana" + }, + "video/iso.segment": { + "source": "iana" + }, + "video/jpeg": { + "source": "iana", + "extensions": ["jpgv"] + }, + "video/jpeg2000": { + "source": "iana" + }, + "video/jpm": { + "source": "apache", + "extensions": ["jpm","jpgm"] + }, + "video/mj2": { + "source": "iana", + "extensions": ["mj2","mjp2"] + }, + "video/mp1s": { + "source": "iana" + }, + "video/mp2p": { + "source": "iana" + }, + "video/mp2t": { + "source": "iana", + "extensions": ["ts"] + }, + "video/mp4": { + "source": "iana", + "compressible": false, + "extensions": ["mp4","mp4v","mpg4"] + }, + "video/mp4v-es": { + "source": "iana" + }, + "video/mpeg": { + "source": "iana", + "compressible": false, + "extensions": ["mpeg","mpg","mpe","m1v","m2v"] + }, + "video/mpeg4-generic": { + "source": "iana" + }, + "video/mpv": { + "source": "iana" + }, + "video/nv": { + "source": "iana" + }, + "video/ogg": { + "source": "iana", + "compressible": false, + "extensions": ["ogv"] + }, + "video/parityfec": { + "source": "iana" + }, + "video/pointer": { + "source": "iana" + }, + "video/quicktime": { + "source": "iana", + "compressible": false, + "extensions": ["qt","mov"] + }, + "video/raptorfec": { + "source": "iana" + }, + "video/raw": { + "source": "iana" + }, + "video/rtp-enc-aescm128": { + "source": "iana" + }, + "video/rtploopback": { + "source": "iana" + }, + "video/rtx": { + "source": "iana" + }, + "video/smpte291": { + "source": "iana" + }, + "video/smpte292m": { + "source": "iana" + }, + "video/ulpfec": { + "source": "iana" + }, + "video/vc1": { + "source": "iana" + }, + "video/vc2": { + "source": "iana" + }, + "video/vnd.cctv": { + "source": "iana" + }, + "video/vnd.dece.hd": { + "source": "iana", + "extensions": ["uvh","uvvh"] + }, + "video/vnd.dece.mobile": { + "source": "iana", + "extensions": ["uvm","uvvm"] + }, + "video/vnd.dece.mp4": { + "source": "iana" + }, + "video/vnd.dece.pd": { + "source": "iana", + "extensions": ["uvp","uvvp"] + }, + "video/vnd.dece.sd": { + "source": "iana", + "extensions": ["uvs","uvvs"] + }, + "video/vnd.dece.video": { + "source": "iana", + "extensions": ["uvv","uvvv"] + }, + "video/vnd.directv.mpeg": { + "source": "iana" + }, + "video/vnd.directv.mpeg-tts": { + "source": "iana" + }, + "video/vnd.dlna.mpeg-tts": { + "source": "iana" + }, + "video/vnd.dvb.file": { + "source": "iana", + "extensions": ["dvb"] + }, + "video/vnd.fvt": { + "source": "iana", + "extensions": ["fvt"] + }, + "video/vnd.hns.video": { + "source": "iana" + }, + "video/vnd.iptvforum.1dparityfec-1010": { + "source": "iana" + }, + "video/vnd.iptvforum.1dparityfec-2005": { + "source": "iana" + }, + "video/vnd.iptvforum.2dparityfec-1010": { + "source": "iana" + }, + "video/vnd.iptvforum.2dparityfec-2005": { + "source": "iana" + }, + "video/vnd.iptvforum.ttsavc": { + "source": "iana" + }, + "video/vnd.iptvforum.ttsmpeg2": { + "source": "iana" + }, + "video/vnd.motorola.video": { + "source": "iana" + }, + "video/vnd.motorola.videop": { + "source": "iana" + }, + "video/vnd.mpegurl": { + "source": "iana", + "extensions": ["mxu","m4u"] + }, + "video/vnd.ms-playready.media.pyv": { + "source": "iana", + "extensions": ["pyv"] + }, + "video/vnd.nokia.interleaved-multimedia": { + "source": "iana" + }, + "video/vnd.nokia.mp4vr": { + "source": "iana" + }, + "video/vnd.nokia.videovoip": { + "source": "iana" + }, + "video/vnd.objectvideo": { + "source": "iana" + }, + "video/vnd.radgamettools.bink": { + "source": "iana" + }, + "video/vnd.radgamettools.smacker": { + "source": "iana" + }, + "video/vnd.sealed.mpeg1": { + "source": "iana" + }, + "video/vnd.sealed.mpeg4": { + "source": "iana" + }, + "video/vnd.sealed.swf": { + "source": "iana" + }, + "video/vnd.sealedmedia.softseal.mov": { + "source": "iana" + }, + "video/vnd.uvvu.mp4": { + "source": "iana", + "extensions": ["uvu","uvvu"] + }, + "video/vnd.vivo": { + "source": "iana", + "extensions": ["viv"] + }, + "video/vnd.youtube.yt": { + "source": "iana" + }, + "video/vp8": { + "source": "iana" + }, + "video/webm": { + "source": "apache", + "compressible": false, + "extensions": ["webm"] + }, + "video/x-f4v": { + "source": "apache", + "extensions": ["f4v"] + }, + "video/x-fli": { + "source": "apache", + "extensions": ["fli"] + }, + "video/x-flv": { + "source": "apache", + "compressible": false, + "extensions": ["flv"] + }, + "video/x-m4v": { + "source": "apache", + "extensions": ["m4v"] + }, + "video/x-matroska": { + "source": "apache", + "compressible": false, + "extensions": ["mkv","mk3d","mks"] + }, + "video/x-mng": { + "source": "apache", + "extensions": ["mng"] + }, + "video/x-ms-asf": { + "source": "apache", + "extensions": ["asf","asx"] + }, + "video/x-ms-vob": { + "source": "apache", + "extensions": ["vob"] + }, + "video/x-ms-wm": { + "source": "apache", + "extensions": ["wm"] + }, + "video/x-ms-wmv": { + "source": "apache", + "compressible": false, + "extensions": ["wmv"] + }, + "video/x-ms-wmx": { + "source": "apache", + "extensions": ["wmx"] + }, + "video/x-ms-wvx": { + "source": "apache", + "extensions": ["wvx"] + }, + "video/x-msvideo": { + "source": "apache", + "extensions": ["avi"] + }, + "video/x-sgi-movie": { + "source": "apache", + "extensions": ["movie"] + }, + "video/x-smv": { + "source": "apache", + "extensions": ["smv"] + }, + "x-conference/x-cooltalk": { + "source": "apache", + "extensions": ["ice"] + }, + "x-shader/x-fragment": { + "compressible": true + }, + "x-shader/x-vertex": { + "compressible": true + } +} diff --git a/node_modules/mime-db/index.js b/node_modules/mime-db/index.js new file mode 100644 index 0000000..551031f --- /dev/null +++ b/node_modules/mime-db/index.js @@ -0,0 +1,11 @@ +/*! + * mime-db + * Copyright(c) 2014 Jonathan Ong + * MIT Licensed + */ + +/** + * Module exports. + */ + +module.exports = require('./db.json') diff --git a/node_modules/mime-db/package.json b/node_modules/mime-db/package.json new file mode 100644 index 0000000..1be2fba --- /dev/null +++ b/node_modules/mime-db/package.json @@ -0,0 +1,103 @@ +{ + "_from": "mime-db@1.44.0", + "_id": "mime-db@1.44.0", + "_inBundle": false, + "_integrity": "sha512-/NOTfLrsPBVeH7YtFPgsVWveuL+4SjjYxaQ1xtM1KMFj7HdxlBlxeyNLzhyJVx7r4rZGJAZ/6lkKCitSc/Nmpg==", + "_location": "/mime-db", + "_phantomChildren": {}, + "_requested": { + "type": "version", + "registry": true, + "raw": "mime-db@1.44.0", + "name": "mime-db", + "escapedName": "mime-db", + "rawSpec": "1.44.0", + "saveSpec": null, + "fetchSpec": "1.44.0" + }, + "_requiredBy": [ + "/compressible", + "/mime-types" + ], + "_resolved": "https://registry.npmjs.org/mime-db/-/mime-db-1.44.0.tgz", + "_shasum": "fa11c5eb0aca1334b4233cb4d52f10c5a6272f92", + "_spec": "mime-db@1.44.0", + "_where": "/home/martin/dev/multiview/node_modules/mime-types", + "bugs": { + "url": "https://github.com/jshttp/mime-db/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com" + }, + { + "name": "Robert Kieffer", + "email": "robert@broofa.com", + "url": "http://github.com/broofa" + } + ], + "deprecated": false, + "description": "Media Type Database", + "devDependencies": { + "bluebird": "3.7.2", + "co": "4.6.0", + "cogent": "1.0.1", + "csv-parse": "4.8.9", + "eslint": "6.8.0", + "eslint-config-standard": "14.1.1", + "eslint-plugin-import": "2.20.2", + "eslint-plugin-markdown": "1.0.2", + "eslint-plugin-node": "11.1.0", + "eslint-plugin-promise": "4.2.1", + "eslint-plugin-standard": "4.0.1", + "gnode": "0.1.2", + "mocha": "7.1.1", + "nyc": "15.0.1", + "raw-body": "2.4.1", + "stream-to-array": "2.3.0" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "HISTORY.md", + "LICENSE", + "README.md", + "db.json", + "index.js" + ], + "homepage": "https://github.com/jshttp/mime-db#readme", + "keywords": [ + "mime", + "db", + "type", + "types", + "database", + "charset", + "charsets" + ], + "license": "MIT", + "name": "mime-db", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/mime-db.git" + }, + "scripts": { + "build": "node scripts/build", + "fetch": "node scripts/fetch-apache && gnode scripts/fetch-iana && node scripts/fetch-nginx", + "lint": "eslint --plugin markdown --ext js,md .", + "test": "mocha --reporter spec --bail --check-leaks test/", + "test-cov": "nyc --reporter=html --reporter=text npm test", + "test-travis": "nyc --reporter=text npm test", + "update": "npm run fetch && npm run build", + "version": "node scripts/version-history.js && git add HISTORY.md" + }, + "version": "1.44.0" +} diff --git a/node_modules/mime-types/HISTORY.md b/node_modules/mime-types/HISTORY.md new file mode 100644 index 0000000..e93149a --- /dev/null +++ b/node_modules/mime-types/HISTORY.md @@ -0,0 +1,333 @@ +2.1.27 / 2020-04-23 +=================== + + * deps: mime-db@1.44.0 + - Add charsets from IANA + - Add extension `.cjs` to `application/node` + - Add new upstream MIME types + +2.1.26 / 2020-01-05 +=================== + + * deps: mime-db@1.43.0 + - Add `application/x-keepass2` with extension `.kdbx` + - Add extension `.mxmf` to `audio/mobile-xmf` + - Add extensions from IANA for `application/*+xml` types + - Add new upstream MIME types + +2.1.25 / 2019-11-12 +=================== + + * deps: mime-db@1.42.0 + - Add new upstream MIME types + - Add `application/toml` with extension `.toml` + - Add `image/vnd.ms-dds` with extension `.dds` + +2.1.24 / 2019-04-20 +=================== + + * deps: mime-db@1.40.0 + - Add extensions from IANA for `model/*` types + - Add `text/mdx` with extension `.mdx` + +2.1.23 / 2019-04-17 +=================== + + * deps: mime-db@~1.39.0 + - Add extensions `.siv` and `.sieve` to `application/sieve` + - Add new upstream MIME types + +2.1.22 / 2019-02-14 +=================== + + * deps: mime-db@~1.38.0 + - Add extension `.nq` to `application/n-quads` + - Add extension `.nt` to `application/n-triples` + - Add new upstream MIME types + - Mark `text/less` as compressible + +2.1.21 / 2018-10-19 +=================== + + * deps: mime-db@~1.37.0 + - Add extensions to HEIC image types + - Add new upstream MIME types + +2.1.20 / 2018-08-26 +=================== + + * deps: mime-db@~1.36.0 + - Add Apple file extensions from IANA + - Add extensions from IANA for `image/*` types + - Add new upstream MIME types + +2.1.19 / 2018-07-17 +=================== + + * deps: mime-db@~1.35.0 + - Add extension `.csl` to `application/vnd.citationstyles.style+xml` + - Add extension `.es` to `application/ecmascript` + - Add extension `.owl` to `application/rdf+xml` + - Add new upstream MIME types + - Add UTF-8 as default charset for `text/turtle` + +2.1.18 / 2018-02-16 +=================== + + * deps: mime-db@~1.33.0 + - Add `application/raml+yaml` with extension `.raml` + - Add `application/wasm` with extension `.wasm` + - Add `text/shex` with extension `.shex` + - Add extensions for JPEG-2000 images + - Add extensions from IANA for `message/*` types + - Add new upstream MIME types + - Update font MIME types + - Update `text/hjson` to registered `application/hjson` + +2.1.17 / 2017-09-01 +=================== + + * deps: mime-db@~1.30.0 + - Add `application/vnd.ms-outlook` + - Add `application/x-arj` + - Add extension `.mjs` to `application/javascript` + - Add glTF types and extensions + - Add new upstream MIME types + - Add `text/x-org` + - Add VirtualBox MIME types + - Fix `source` records for `video/*` types that are IANA + - Update `font/opentype` to registered `font/otf` + +2.1.16 / 2017-07-24 +=================== + + * deps: mime-db@~1.29.0 + - Add `application/fido.trusted-apps+json` + - Add extension `.wadl` to `application/vnd.sun.wadl+xml` + - Add extension `.gz` to `application/gzip` + - Add new upstream MIME types + - Update extensions `.md` and `.markdown` to be `text/markdown` + +2.1.15 / 2017-03-23 +=================== + + * deps: mime-db@~1.27.0 + - Add new mime types + - Add `image/apng` + +2.1.14 / 2017-01-14 +=================== + + * deps: mime-db@~1.26.0 + - Add new mime types + +2.1.13 / 2016-11-18 +=================== + + * deps: mime-db@~1.25.0 + - Add new mime types + +2.1.12 / 2016-09-18 +=================== + + * deps: mime-db@~1.24.0 + - Add new mime types + - Add `audio/mp3` + +2.1.11 / 2016-05-01 +=================== + + * deps: mime-db@~1.23.0 + - Add new mime types + +2.1.10 / 2016-02-15 +=================== + + * deps: mime-db@~1.22.0 + - Add new mime types + - Fix extension of `application/dash+xml` + - Update primary extension for `audio/mp4` + +2.1.9 / 2016-01-06 +================== + + * deps: mime-db@~1.21.0 + - Add new mime types + +2.1.8 / 2015-11-30 +================== + + * deps: mime-db@~1.20.0 + - Add new mime types + +2.1.7 / 2015-09-20 +================== + + * deps: mime-db@~1.19.0 + - Add new mime types + +2.1.6 / 2015-09-03 +================== + + * deps: mime-db@~1.18.0 + - Add new mime types + +2.1.5 / 2015-08-20 +================== + + * deps: mime-db@~1.17.0 + - Add new mime types + +2.1.4 / 2015-07-30 +================== + + * deps: mime-db@~1.16.0 + - Add new mime types + +2.1.3 / 2015-07-13 +================== + + * deps: mime-db@~1.15.0 + - Add new mime types + +2.1.2 / 2015-06-25 +================== + + * deps: mime-db@~1.14.0 + - Add new mime types + +2.1.1 / 2015-06-08 +================== + + * perf: fix deopt during mapping + +2.1.0 / 2015-06-07 +================== + + * Fix incorrectly treating extension-less file name as extension + - i.e. `'path/to/json'` will no longer return `application/json` + * Fix `.charset(type)` to accept parameters + * Fix `.charset(type)` to match case-insensitive + * Improve generation of extension to MIME mapping + * Refactor internals for readability and no argument reassignment + * Prefer `application/*` MIME types from the same source + * Prefer any type over `application/octet-stream` + * deps: mime-db@~1.13.0 + - Add nginx as a source + - Add new mime types + +2.0.14 / 2015-06-06 +=================== + + * deps: mime-db@~1.12.0 + - Add new mime types + +2.0.13 / 2015-05-31 +=================== + + * deps: mime-db@~1.11.0 + - Add new mime types + +2.0.12 / 2015-05-19 +=================== + + * deps: mime-db@~1.10.0 + - Add new mime types + +2.0.11 / 2015-05-05 +=================== + + * deps: mime-db@~1.9.1 + - Add new mime types + +2.0.10 / 2015-03-13 +=================== + + * deps: mime-db@~1.8.0 + - Add new mime types + +2.0.9 / 2015-02-09 +================== + + * deps: mime-db@~1.7.0 + - Add new mime types + - Community extensions ownership transferred from `node-mime` + +2.0.8 / 2015-01-29 +================== + + * deps: mime-db@~1.6.0 + - Add new mime types + +2.0.7 / 2014-12-30 +================== + + * deps: mime-db@~1.5.0 + - Add new mime types + - Fix various invalid MIME type entries + +2.0.6 / 2014-12-30 +================== + + * deps: mime-db@~1.4.0 + - Add new mime types + - Fix various invalid MIME type entries + - Remove example template MIME types + +2.0.5 / 2014-12-29 +================== + + * deps: mime-db@~1.3.1 + - Fix missing extensions + +2.0.4 / 2014-12-10 +================== + + * deps: mime-db@~1.3.0 + - Add new mime types + +2.0.3 / 2014-11-09 +================== + + * deps: mime-db@~1.2.0 + - Add new mime types + +2.0.2 / 2014-09-28 +================== + + * deps: mime-db@~1.1.0 + - Add new mime types + - Add additional compressible + - Update charsets + +2.0.1 / 2014-09-07 +================== + + * Support Node.js 0.6 + +2.0.0 / 2014-09-02 +================== + + * Use `mime-db` + * Remove `.define()` + +1.0.2 / 2014-08-04 +================== + + * Set charset=utf-8 for `text/javascript` + +1.0.1 / 2014-06-24 +================== + + * Add `text/jsx` type + +1.0.0 / 2014-05-12 +================== + + * Return `false` for unknown types + * Set charset=utf-8 for `application/json` + +0.1.0 / 2014-05-02 +================== + + * Initial release diff --git a/node_modules/mime-types/LICENSE b/node_modules/mime-types/LICENSE new file mode 100644 index 0000000..0616607 --- /dev/null +++ b/node_modules/mime-types/LICENSE @@ -0,0 +1,23 @@ +(The MIT License) + +Copyright (c) 2014 Jonathan Ong +Copyright (c) 2015 Douglas Christopher Wilson + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/mime-types/README.md b/node_modules/mime-types/README.md new file mode 100644 index 0000000..3863339 --- /dev/null +++ b/node_modules/mime-types/README.md @@ -0,0 +1,123 @@ +# mime-types + +[![NPM Version][npm-version-image]][npm-url] +[![NPM Downloads][npm-downloads-image]][npm-url] +[![Node.js Version][node-version-image]][node-version-url] +[![Build Status][travis-image]][travis-url] +[![Test Coverage][coveralls-image]][coveralls-url] + +The ultimate javascript content-type utility. + +Similar to [the `mime@1.x` module](https://www.npmjs.com/package/mime), except: + +- __No fallbacks.__ Instead of naively returning the first available type, + `mime-types` simply returns `false`, so do + `var type = mime.lookup('unrecognized') || 'application/octet-stream'`. +- No `new Mime()` business, so you could do `var lookup = require('mime-types').lookup`. +- No `.define()` functionality +- Bug fixes for `.lookup(path)` + +Otherwise, the API is compatible with `mime` 1.x. + +## Install + +This is a [Node.js](https://nodejs.org/en/) module available through the +[npm registry](https://www.npmjs.com/). Installation is done using the +[`npm install` command](https://docs.npmjs.com/getting-started/installing-npm-packages-locally): + +```sh +$ npm install mime-types +``` + +## Adding Types + +All mime types are based on [mime-db](https://www.npmjs.com/package/mime-db), +so open a PR there if you'd like to add mime types. + +## API + + + +```js +var mime = require('mime-types') +``` + +All functions return `false` if input is invalid or not found. + +### mime.lookup(path) + +Lookup the content-type associated with a file. + + + +```js +mime.lookup('json') // 'application/json' +mime.lookup('.md') // 'text/markdown' +mime.lookup('file.html') // 'text/html' +mime.lookup('folder/file.js') // 'application/javascript' +mime.lookup('folder/.htaccess') // false + +mime.lookup('cats') // false +``` + +### mime.contentType(type) + +Create a full content-type header given a content-type or extension. +When given an extension, `mime.lookup` is used to get the matching +content-type, otherwise the given content-type is used. Then if the +content-type does not already have a `charset` parameter, `mime.charset` +is used to get the default charset and add to the returned content-type. + + + +```js +mime.contentType('markdown') // 'text/x-markdown; charset=utf-8' +mime.contentType('file.json') // 'application/json; charset=utf-8' +mime.contentType('text/html') // 'text/html; charset=utf-8' +mime.contentType('text/html; charset=iso-8859-1') // 'text/html; charset=iso-8859-1' + +// from a full path +mime.contentType(path.extname('/path/to/file.json')) // 'application/json; charset=utf-8' +``` + +### mime.extension(type) + +Get the default extension for a content-type. + + + +```js +mime.extension('application/octet-stream') // 'bin' +``` + +### mime.charset(type) + +Lookup the implied default charset of a content-type. + + + +```js +mime.charset('text/markdown') // 'UTF-8' +``` + +### var type = mime.types[extension] + +A map of content-types by extension. + +### [extensions...] = mime.extensions[type] + +A map of extensions by content-type. + +## License + +[MIT](LICENSE) + +[coveralls-image]: https://badgen.net/coveralls/c/github/jshttp/mime-types/master +[coveralls-url]: https://coveralls.io/r/jshttp/mime-types?branch=master +[node-version-image]: https://badgen.net/npm/node/mime-types +[node-version-url]: https://nodejs.org/en/download +[npm-downloads-image]: https://badgen.net/npm/dm/mime-types +[npm-url]: https://npmjs.org/package/mime-types +[npm-version-image]: https://badgen.net/npm/v/mime-types +[travis-image]: https://badgen.net/travis/jshttp/mime-types/master +[travis-url]: https://travis-ci.org/jshttp/mime-types diff --git a/node_modules/mime-types/index.js b/node_modules/mime-types/index.js new file mode 100644 index 0000000..b9f34d5 --- /dev/null +++ b/node_modules/mime-types/index.js @@ -0,0 +1,188 @@ +/*! + * mime-types + * Copyright(c) 2014 Jonathan Ong + * Copyright(c) 2015 Douglas Christopher Wilson + * MIT Licensed + */ + +'use strict' + +/** + * Module dependencies. + * @private + */ + +var db = require('mime-db') +var extname = require('path').extname + +/** + * Module variables. + * @private + */ + +var EXTRACT_TYPE_REGEXP = /^\s*([^;\s]*)(?:;|\s|$)/ +var TEXT_TYPE_REGEXP = /^text\//i + +/** + * Module exports. + * @public + */ + +exports.charset = charset +exports.charsets = { lookup: charset } +exports.contentType = contentType +exports.extension = extension +exports.extensions = Object.create(null) +exports.lookup = lookup +exports.types = Object.create(null) + +// Populate the extensions/types maps +populateMaps(exports.extensions, exports.types) + +/** + * Get the default charset for a MIME type. + * + * @param {string} type + * @return {boolean|string} + */ + +function charset (type) { + if (!type || typeof type !== 'string') { + return false + } + + // TODO: use media-typer + var match = EXTRACT_TYPE_REGEXP.exec(type) + var mime = match && db[match[1].toLowerCase()] + + if (mime && mime.charset) { + return mime.charset + } + + // default text/* to utf-8 + if (match && TEXT_TYPE_REGEXP.test(match[1])) { + return 'UTF-8' + } + + return false +} + +/** + * Create a full Content-Type header given a MIME type or extension. + * + * @param {string} str + * @return {boolean|string} + */ + +function contentType (str) { + // TODO: should this even be in this module? + if (!str || typeof str !== 'string') { + return false + } + + var mime = str.indexOf('/') === -1 + ? exports.lookup(str) + : str + + if (!mime) { + return false + } + + // TODO: use content-type or other module + if (mime.indexOf('charset') === -1) { + var charset = exports.charset(mime) + if (charset) mime += '; charset=' + charset.toLowerCase() + } + + return mime +} + +/** + * Get the default extension for a MIME type. + * + * @param {string} type + * @return {boolean|string} + */ + +function extension (type) { + if (!type || typeof type !== 'string') { + return false + } + + // TODO: use media-typer + var match = EXTRACT_TYPE_REGEXP.exec(type) + + // get extensions + var exts = match && exports.extensions[match[1].toLowerCase()] + + if (!exts || !exts.length) { + return false + } + + return exts[0] +} + +/** + * Lookup the MIME type for a file path/extension. + * + * @param {string} path + * @return {boolean|string} + */ + +function lookup (path) { + if (!path || typeof path !== 'string') { + return false + } + + // get the extension ("ext" or ".ext" or full path) + var extension = extname('x.' + path) + .toLowerCase() + .substr(1) + + if (!extension) { + return false + } + + return exports.types[extension] || false +} + +/** + * Populate the extensions and types maps. + * @private + */ + +function populateMaps (extensions, types) { + // source preference (least -> most) + var preference = ['nginx', 'apache', undefined, 'iana'] + + Object.keys(db).forEach(function forEachMimeType (type) { + var mime = db[type] + var exts = mime.extensions + + if (!exts || !exts.length) { + return + } + + // mime -> extensions + extensions[type] = exts + + // extension -> mime + for (var i = 0; i < exts.length; i++) { + var extension = exts[i] + + if (types[extension]) { + var from = preference.indexOf(db[types[extension]].source) + var to = preference.indexOf(mime.source) + + if (types[extension] !== 'application/octet-stream' && + (from > to || (from === to && types[extension].substr(0, 12) === 'application/'))) { + // skip the remapping + continue + } + } + + // set the extension -> mime + types[extension] = type + } + }) +} diff --git a/node_modules/mime-types/package.json b/node_modules/mime-types/package.json new file mode 100644 index 0000000..217b4f9 --- /dev/null +++ b/node_modules/mime-types/package.json @@ -0,0 +1,87 @@ +{ + "_from": "mime-types@~2.1.24", + "_id": "mime-types@2.1.27", + "_inBundle": false, + "_integrity": "sha512-JIhqnCasI9yD+SsmkquHBxTSEuZdQX5BuQnS2Vc7puQQQ+8yiP5AY5uWhpdv4YL4VM5c6iliiYWPgJ/nJQLp7w==", + "_location": "/mime-types", + "_phantomChildren": {}, + "_requested": { + "type": "range", + "registry": true, + "raw": "mime-types@~2.1.24", + "name": "mime-types", + "escapedName": "mime-types", + "rawSpec": "~2.1.24", + "saveSpec": null, + "fetchSpec": "~2.1.24" + }, + "_requiredBy": [ + "/accepts" + ], + "_resolved": "https://registry.npmjs.org/mime-types/-/mime-types-2.1.27.tgz", + "_shasum": "47949f98e279ea53119f5722e0f34e529bec009f", + "_spec": "mime-types@~2.1.24", + "_where": "/home/martin/dev/multiview/node_modules/accepts", + "bugs": { + "url": "https://github.com/jshttp/mime-types/issues" + }, + "bundleDependencies": false, + "contributors": [ + { + "name": "Douglas Christopher Wilson", + "email": "doug@somethingdoug.com" + }, + { + "name": "Jeremiah Senkpiel", + "email": "fishrock123@rocketmail.com", + "url": "https://searchbeam.jit.su" + }, + { + "name": "Jonathan Ong", + "email": "me@jongleberry.com", + "url": "http://jongleberry.com" + } + ], + "dependencies": { + "mime-db": "1.44.0" + }, + "deprecated": false, + "description": "The ultimate javascript content-type utility.", + "devDependencies": { + "eslint": "6.8.0", + "eslint-config-standard": "14.1.1", + "eslint-plugin-import": "2.20.2", + "eslint-plugin-markdown": "1.0.2", + "eslint-plugin-node": "11.1.0", + "eslint-plugin-promise": "4.2.1", + "eslint-plugin-standard": "4.0.1", + "mocha": "7.1.1", + "nyc": "15.0.1" + }, + "engines": { + "node": ">= 0.6" + }, + "files": [ + "HISTORY.md", + "LICENSE", + "index.js" + ], + "homepage": "https://github.com/jshttp/mime-types#readme", + "keywords": [ + "mime", + "types" + ], + "license": "MIT", + "name": "mime-types", + "repository": { + "type": "git", + "url": "git+https://github.com/jshttp/mime-types.git" + }, + "scripts": { + "lint": "eslint --plugin markdown --ext js,md .", + "test": "mocha --reporter spec test/test.js", + "test-cov": "nyc --reporter=html --reporter=text npm test", + "test-travis": "nyc --reporter=text npm test" + }, + "version": "2.1.27" +} diff --git a/node_modules/mime/CHANGELOG.md b/node_modules/mime/CHANGELOG.md new file mode 100644 index 0000000..78a2e99 --- /dev/null +++ b/node_modules/mime/CHANGELOG.md @@ -0,0 +1,270 @@ +# Changelog + +All notable changes to this project will be documented in this file. See [standard-version](https://github.com/conventional-changelog/standard-version) for commit guidelines. + +### [2.4.5](https://github.com/broofa/node-mime/compare/v2.4.4...v2.4.5) (2020-05-01) + + +### Bug Fixes + +* fix [#236](https://github.com/broofa/node-mime/issues/236) ([7f4ecd0](https://github.com/broofa/node-mime/commit/7f4ecd0d850ed22c9e3bfda2c11fc74e4dde12a7)) +* update to latest mime-db ([c5cb3f2](https://github.com/broofa/node-mime/commit/c5cb3f2ab8b07642a066efbde1142af1b90c927b)) + +### [2.4.4](https://github.com/broofa/node-mime/compare/v2.4.3...v2.4.4) (2019-06-07) + + + +## [2.4.3](https://github.com/broofa/node-mime/compare/v2.4.2...v2.4.3) (2019-05-15) + + + +## [2.4.2](https://github.com/broofa/node-mime/compare/v2.4.1...v2.4.2) (2019-04-07) + + +### Bug Fixes + +* don't use arrow function introduced in 2.4.1 ([2e00b5c](https://github.com/broofa/node-mime/commit/2e00b5c)) + + + +## [2.4.1](https://github.com/broofa/node-mime/compare/v2.4.0...v2.4.1) (2019-04-03) + + +### Bug Fixes + +* update MDN and mime-db types ([3e567a9](https://github.com/broofa/node-mime/commit/3e567a9)) + + + + +# [2.4.0](https://github.com/broofa/node-mime/compare/v2.3.1...v2.4.0) (2018-11-26) + + +### Features + +* Bind exported methods ([9d2a7b8](https://github.com/broofa/node-mime/commit/9d2a7b8)) +* update to mime-db@1.37.0 ([49e6e41](https://github.com/broofa/node-mime/commit/49e6e41)) + + + + +## [2.3.1](https://github.com/broofa/node-mime/compare/v2.3.0...v2.3.1) (2018-04-11) + + +### Bug Fixes + +* fix [#198](https://github.com/broofa/node-mime/issues/198) ([25ca180](https://github.com/broofa/node-mime/commit/25ca180)) + + + + +# [2.3.0](https://github.com/broofa/node-mime/compare/v2.2.2...v2.3.0) (2018-04-11) + + +### Bug Fixes + +* fix [#192](https://github.com/broofa/node-mime/issues/192) ([5c35df6](https://github.com/broofa/node-mime/commit/5c35df6)) + + +### Features + +* add travis-ci testing ([d64160f](https://github.com/broofa/node-mime/commit/d64160f)) + + + + +## [2.2.2](https://github.com/broofa/node-mime/compare/v2.2.1...v2.2.2) (2018-03-30) + + +### Bug Fixes + +* update types files to mime-db@1.32.0 ([85aac16](https://github.com/broofa/node-mime/commit/85aac16)) + + + + +## [2.2.1](https://github.com/broofa/node-mime/compare/v2.2.0...v2.2.1) (2018-03-30) + + +### Bug Fixes + +* Retain type->extension mappings for non-default types. Fixes [#180](https://github.com/broofa/node-mime/issues/180) ([b5c83fb](https://github.com/broofa/node-mime/commit/b5c83fb)) + + + + +# [2.2.0](https://github.com/broofa/node-mime/compare/v2.1.0...v2.2.0) (2018-01-04) + + +### Features + +* Retain type->extension mappings for non-default types. Fixes [#180](https://github.com/broofa/node-mime/issues/180) ([10f82ac](https://github.com/broofa/node-mime/commit/10f82ac)) + + + + +# [2.1.0](https://github.com/broofa/node-mime/compare/v2.0.5...v2.1.0) (2017-12-22) + + +### Features + +* Upgrade to mime-db@1.32.0. Fixes [#185](https://github.com/broofa/node-mime/issues/185) ([3f775ba](https://github.com/broofa/node-mime/commit/3f775ba)) + + + + +## [2.0.5](https://github.com/broofa/node-mime/compare/v2.0.1...v2.0.5) (2017-12-22) + + +### Bug Fixes + +* ES5 support (back to node v0.4) ([f14ccb6](https://github.com/broofa/node-mime/commit/f14ccb6)) + + + +# Changelog + +## v2.0.4 (24/11/2017) +- [**closed**] Switch to mime-score module for resolving extension contention issues. [#182](https://github.com/broofa/node-mime/issues/182) +- [**closed**] Update mime-db to 1.31.0 in v1.x branch [#181](https://github.com/broofa/node-mime/issues/181) + +--- + +## v1.5.0 (22/11/2017) +- [**closed**] need ES5 version ready in npm package [#179](https://github.com/broofa/node-mime/issues/179) +- [**closed**] mime-db no trace of iWork - pages / numbers / etc. [#178](https://github.com/broofa/node-mime/issues/178) +- [**closed**] How it works in brownser ? [#176](https://github.com/broofa/node-mime/issues/176) +- [**closed**] Missing `./Mime` [#175](https://github.com/broofa/node-mime/issues/175) +- [**closed**] Vulnerable Regular Expression [#167](https://github.com/broofa/node-mime/issues/167) + +--- + +## v2.0.3 (25/09/2017) +*No changelog for this release.* + +--- + +## v1.4.1 (25/09/2017) +- [**closed**] Issue when bundling with webpack [#172](https://github.com/broofa/node-mime/issues/172) + +--- + +## v2.0.2 (15/09/2017) +- [**V2**] fs.readFileSync is not a function [#165](https://github.com/broofa/node-mime/issues/165) +- [**closed**] The extension for video/quicktime should map to .mov, not .qt [#164](https://github.com/broofa/node-mime/issues/164) +- [**V2**] [v2 Feedback request] Mime class API [#163](https://github.com/broofa/node-mime/issues/163) +- [**V2**] [v2 Feedback request] Resolving conflicts over extensions [#162](https://github.com/broofa/node-mime/issues/162) +- [**V2**] Allow callers to load module with official, full, or no defined types. [#161](https://github.com/broofa/node-mime/issues/161) +- [**V2**] Use "facets" to resolve extension conflicts [#160](https://github.com/broofa/node-mime/issues/160) +- [**V2**] Remove fs and path dependencies [#152](https://github.com/broofa/node-mime/issues/152) +- [**V2**] Default content-type should not be application/octet-stream [#139](https://github.com/broofa/node-mime/issues/139) +- [**V2**] reset mime-types [#124](https://github.com/broofa/node-mime/issues/124) +- [**V2**] Extensionless paths should return null or false [#113](https://github.com/broofa/node-mime/issues/113) + +--- + +## v2.0.1 (14/09/2017) +- [**closed**] Changelog for v2.0 does not mention breaking changes [#171](https://github.com/broofa/node-mime/issues/171) +- [**closed**] MIME breaking with 'class' declaration as it is without 'use strict mode' [#170](https://github.com/broofa/node-mime/issues/170) + +--- + +## v2.0.0 (12/09/2017) +- [**closed**] woff and woff2 [#168](https://github.com/broofa/node-mime/issues/168) + +--- + +## v1.4.0 (28/08/2017) +- [**closed**] support for ac3 voc files [#159](https://github.com/broofa/node-mime/issues/159) +- [**closed**] Help understanding change from application/xml to text/xml [#158](https://github.com/broofa/node-mime/issues/158) +- [**closed**] no longer able to override mimetype [#157](https://github.com/broofa/node-mime/issues/157) +- [**closed**] application/vnd.adobe.photoshop [#147](https://github.com/broofa/node-mime/issues/147) +- [**closed**] Directories should appear as something other than application/octet-stream [#135](https://github.com/broofa/node-mime/issues/135) +- [**closed**] requested features [#131](https://github.com/broofa/node-mime/issues/131) +- [**closed**] Make types.json loading optional? [#129](https://github.com/broofa/node-mime/issues/129) +- [**closed**] Cannot find module './types.json' [#120](https://github.com/broofa/node-mime/issues/120) +- [**V2**] .wav files show up as "audio/x-wav" instead of "audio/x-wave" [#118](https://github.com/broofa/node-mime/issues/118) +- [**closed**] Don't be a pain in the ass for node community [#108](https://github.com/broofa/node-mime/issues/108) +- [**closed**] don't make default_type global [#78](https://github.com/broofa/node-mime/issues/78) +- [**closed**] mime.extension() fails if the content-type is parameterized [#74](https://github.com/broofa/node-mime/issues/74) + +--- + +## v1.3.6 (11/05/2017) +- [**closed**] .md should be text/markdown as of March 2016 [#154](https://github.com/broofa/node-mime/issues/154) +- [**closed**] Error while installing mime [#153](https://github.com/broofa/node-mime/issues/153) +- [**closed**] application/manifest+json [#149](https://github.com/broofa/node-mime/issues/149) +- [**closed**] Dynamic adaptive streaming over HTTP (DASH) file extension typo [#141](https://github.com/broofa/node-mime/issues/141) +- [**closed**] charsets image/png undefined [#140](https://github.com/broofa/node-mime/issues/140) +- [**closed**] Mime-db dependency out of date [#130](https://github.com/broofa/node-mime/issues/130) +- [**closed**] how to support plist？ [#126](https://github.com/broofa/node-mime/issues/126) +- [**closed**] how does .types file format look like? [#123](https://github.com/broofa/node-mime/issues/123) +- [**closed**] Feature: support for expanding MIME patterns [#121](https://github.com/broofa/node-mime/issues/121) +- [**closed**] DEBUG_MIME doesn't work [#117](https://github.com/broofa/node-mime/issues/117) + +--- + +## v1.3.4 (06/02/2015) +*No changelog for this release.* + +--- + +## v1.3.3 (06/02/2015) +*No changelog for this release.* + +--- + +## v1.3.1 (05/02/2015) +- [**closed**] Consider adding support for Handlebars .hbs file ending [#111](https://github.com/broofa/node-mime/issues/111) +- [**closed**] Consider adding support for hjson. [#110](https://github.com/broofa/node-mime/issues/110) +- [**closed**] Add mime type for Opus audio files [#94](https://github.com/broofa/node-mime/issues/94) +- [**closed**] Consider making the `Requesting New Types` information more visible [#77](https://github.com/broofa/node-mime/issues/77) + +--- + +## v1.3.0 (05/02/2015) +- [**closed**] Add common name? [#114](https://github.com/broofa/node-mime/issues/114) +- [**closed**] application/x-yaml [#104](https://github.com/broofa/node-mime/issues/104) +- [**closed**] Add mime type for WOFF file format 2.0 [#102](https://github.com/broofa/node-mime/issues/102) +- [**closed**] application/x-msi for .msi [#99](https://github.com/broofa/node-mime/issues/99) +- [**closed**] Add mimetype for gettext translation files [#98](https://github.com/broofa/node-mime/issues/98) +- [**closed**] collaborators [#88](https://github.com/broofa/node-mime/issues/88) +- [**closed**] getting errot in installation of mime module...any1 can help? [#87](https://github.com/broofa/node-mime/issues/87) +- [**closed**] should application/json's charset be utf8? [#86](https://github.com/broofa/node-mime/issues/86) +- [**closed**] Add "license" and "licenses" to package.json [#81](https://github.com/broofa/node-mime/issues/81) +- [**closed**] lookup with extension-less file on Windows returns wrong type [#68](https://github.com/broofa/node-mime/issues/68) + +--- + +## v1.2.11 (15/08/2013) +- [**closed**] Update mime.types [#65](https://github.com/broofa/node-mime/issues/65) +- [**closed**] Publish a new version [#63](https://github.com/broofa/node-mime/issues/63) +- [**closed**] README should state upfront that "application/octet-stream" is default for unknown extension [#55](https://github.com/broofa/node-mime/issues/55) +- [**closed**] Suggested improvement to the charset API [#52](https://github.com/broofa/node-mime/issues/52) + +--- + +## v1.2.10 (25/07/2013) +- [**closed**] Mime type for woff files should be application/font-woff and not application/x-font-woff [#62](https://github.com/broofa/node-mime/issues/62) +- [**closed**] node.types in conflict with mime.types [#51](https://github.com/broofa/node-mime/issues/51) + +--- + +## v1.2.9 (17/01/2013) +- [**closed**] Please update "mime" NPM [#49](https://github.com/broofa/node-mime/issues/49) +- [**closed**] Please add semicolon [#46](https://github.com/broofa/node-mime/issues/46) +- [**closed**] parse full mime types [#43](https://github.com/broofa/node-mime/issues/43) + +--- + +## v1.2.8 (10/01/2013) +- [**closed**] /js directory mime is application/javascript. Is it correct? [#47](https://github.com/broofa/node-mime/issues/47) +- [**closed**] Add mime types for lua code. [#45](https://github.com/broofa/node-mime/issues/45) + +--- + +## v1.2.7 (19/10/2012) +- [**closed**] cannot install 1.2.7 via npm [#41](https://github.com/broofa/node-mime/issues/41) +- [**closed**] Transfer ownership to @broofa [#36](https://github.com/broofa/node-mime/issues/36) +- [**closed**] it's wrong to set charset to UTF-8 for text [#30](https://github.com/broofa/node-mime/issues/30) +- [**closed**] Allow multiple instances of MIME types container [#27](https://github.com/broofa/node-mime/issues/27) diff --git a/node_modules/mime/LICENSE b/node_modules/mime/LICENSE new file mode 100644 index 0000000..d3f46f7 --- /dev/null +++ b/node_modules/mime/LICENSE @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) 2010 Benjamin Thomas, Robert Kieffer + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/node_modules/mime/Mime.js b/node_modules/mime/Mime.js new file mode 100644 index 0000000..7fe3921 --- /dev/null +++ b/node_modules/mime/Mime.js @@ -0,0 +1,95 @@ +'use strict'; + +/** + * @param typeMap [Object] Map of MIME type -> Array[extensions] + * @param ... + */ +function Mime() { + this._types = Object.create(null); + this._extensions = Object.create(null); + + for (var i = 0; i < arguments.length; i++) { + this.define(arguments[i]); + } + + this.define = this.define.bind(this); + this.getType = this.getType.bind(this); + this.getExtension = this.getExtension.bind(this); +} + +/** + * Define mimetype -> extension mappings. Each key is a mime-type that maps + * to an array of extensions associated with the type. The first extension is + * used as the default extension for the type. + * + * e.g. mime.define({'audio/ogg', ['oga', 'ogg', 'spx']}); + * + * If a type declares an extension that has already been defined, an error will + * be thrown. To suppress this error and force the extension to be associated + * with the new type, pass `force`=true. Alternatively, you may prefix the + * extension with "*" to map the type to extension, without mapping the + * extension to the type. + * + * e.g. mime.define({'audio/wav', ['wav']}, {'audio/x-wav', ['*wav']}); + * + * + * @param map (Object) type definitions + * @param force (Boolean) if true, force overriding of existing definitions + */ +Mime.prototype.define = function(typeMap, force) { + for (var type in typeMap) { + var extensions = typeMap[type].map(function(t) {return t.toLowerCase()}); + type = type.toLowerCase(); + + for (var i = 0; i < extensions.length; i++) { + var ext = extensions[i]; + + // '*' prefix = not the preferred type for this extension. So fixup the + // extension, and skip it. + if (ext[0] == '*') { + continue; + } + + if (!force && (ext in this._types)) { + throw new Error( + 'Attempt to change mapping for "' + ext + + '" extension from "' + this._types[ext] + '" to "' + type + + '". Pass `force=true` to allow this, otherwise remove "' + ext + + '" from the list of extensions for "' + type + '".' + ); + } + + this._types[ext] = type; + } + + // Use first extension as default + if (force || !this._extensions[type]) { + var ext = extensions[0]; + this._extensions[type] = (ext[0] != '*') ? ext : ext.substr(1) + } + } +}; + +/** + * Lookup a mime type based on extension + */ +Mime.prototype.getType = function(path) { + path = String(path); + var last = path.replace(/^.*[/\\]/, '').toLowerCase(); + var ext = last.replace(/^.*\./, '').toLowerCase(); + + var hasPath = last.length < path.length; + var hasDot = ext.length < last.length - 1; + + return (hasDot || !hasPath) && this._types[ext] || null; +}; + +/** + * Return file extension associated with a mime type + */ +Mime.prototype.getExtension = function(type) { + type = /^\s*([^;\s]*)/.test(type) && RegExp.$1; + return type && this._extensions[type.toLowerCase()] || null; +}; + +module.exports = Mime; diff --git a/node_modules/mime/README.md b/node_modules/mime/README.md new file mode 100644 index 0000000..9e08202 --- /dev/null +++ b/node_modules/mime/README.md @@ -0,0 +1,187 @@ + +# Mime + +A comprehensive, compact MIME type module. + +[![Build Status](https://travis-ci.org/broofa/node-mime.svg?branch=master)](https://travis-ci.org/broofa/node-mime) + +## Version 2 Notes + +Version 2 is a breaking change from 1.x as the semver implies. Specifically: + +* `lookup()` renamed to `getType()` +* `extension()` renamed to `getExtension()` +* `charset()` and `load()` methods have been removed + +If you prefer the legacy version of this module please `npm install mime@^1`. Version 1 docs may be found [here](https://github.com/broofa/node-mime/tree/v1.4.0). + +## Install + +### NPM +``` +npm install mime +``` + +### Browser + +It is recommended that you use a bundler such as +[webpack](https://webpack.github.io/) or [browserify](http://browserify.org/) to +package your code. However, browser-ready versions are available via wzrd.in. +E.g. For the full version: + + + +